Homework Answers
Answer:
Given mass of oxalic acid H2C2O4.2H2O=1.543 g and molar mass=126 g/mol.
Given volume=100 ml=0.1 L
We know that concentration C=moles/volume (L)
moles of oxalic acid=mass/molar mass=1.543 g/126 g/mol=0.01224 mol
Therfore concentration C= 0.0124 mol/0.1L=0.1224 M
Actual concentration of oxalic acid=0.122 M.
Add Answer to:
4) Estimate volume of base required to complete the titration. mol . Note that you are...
To calculate the concentration of a solution using acid–base titration data. In an acid–base titration, an...
To calculate the concentration of a solution using acid–base titration data. In an acid–base titration, an acid (or base) of known concentration is added to a base (or acid) of unknown concentration until the number of moles of H+ and OH- are equal, a condition called the equivalence point. Since you know the number of moles of H+ (or OH- ) that you added, you can determine the number of moles of OH- (or H+) in the unknown solution. For...
To calculate the concentration of a solution using acid–base titration data. In an acid–base titration, an...
To calculate the concentration of a solution using acid–base titration data. In an acid–base titration, an acid (or base) of known concentration is added to a base (or acid) of unknown concentration until the number of moles of H+ and OH- are equal, a condition called the equivalence point. Since you know the number of moles of H+ (or OH- ) that you added, you can determine the number of moles of OH- (or H+) in the unknown solution. For...
Part A The volume required to reach the equivalence point of an acid-base litration depends on...
Part A The volume required to reach the equivalence point of an acid-base litration depends on the volume and concentration of the acid or base to be titrated and on the concentration of the acid or base used to do the titration. It does not, however, depend on the whether or not the acid or base being litrated is strong or weak. Explain Match the words in the left column to the appropriate blanks in the sentences on the right...
It's a weak acid strong base titration Experiment 4: Identification of an unknown acid by titration...
It's a weak acid strong base titration
Experiment 4: Identification of an unknown acid by titration Page 2 of 15 Background In this experiment, you will use both qualitative and quantitative properties to determine an unknown acid's identity and concentration. To do this analysis, you will perform a titration of your unknown acid sample-specifically a potentiometric titration where you use a pH meter and record pH values during the titration, combined with a visual titration using a color indi- cator...
Use the titration curve of a weak acid with a strong base below to answer the...
Use the titration curve of a weak acid with a strong base below to answer the following questions. Identify the Equivalence Point of Titration and label it on the titration curve below. (ii) What is the Titrant (iii) From the graph, what is the [H^+] and the volume of NaOH used to reach the equivalence point. (iv) Calculate the [OH^-] at the equivalence point (v) What is the pKa of the acid used for titration? (vi) Calculate the Ka of...
Calculations: Show work. a) From the graph, find the volume of base needed to reach the...
Calculations: Show work.
a) From the graph, find the volume of base needed to reach the
first equivalence point.
b)Subtract the volume of NaOH needed to reach the first
equivalence from that needed to reach the second equivalence point.
Use this as the volume of the base.
c) Find the moles of base.
d)Write and balance the ewuation for the reaction between the
acid used and NaOH.
e)Calculate the moles of acid required to react with the
calculated moles of...
a) Use this plot to estimate the volume of NaOH required to reach the equivalence point...
a) Use this plot to estimate the volume of NaOH
required to reach the equivalence point of each titration
curve.
b) Estimate the original concentration of weak acid in
solution before strong base was added.
c) Find the midpoint pH for each of the trials using
half the volume of NaOH required to reach the equivalence point for
that trial. Check if this pH is at the most flat part of the
titration curve. This is the pKa of the...
Anita Math Acid-Base Titrations Compatibility Mede Saved to this PC T Tools Tell me what you...
Anita Math Acid-Base Titrations Compatibility Mede Saved to this PC T Tools Tell me what you want to dos Design Layout References Malings Review View Help Design Layout A AAa E wRo 112 AaßbCcl AaBbC AallbCcl AaBbCcl AaBbCcD AaBbC daBbCel & .A . Emphasis Heading 1 1 Normal Subtitle Tele Intense Q S Strong Font Styles Paragraph Acid /Base Titrations: Pre-Laboratory Assignment 1 Give at least two characteristics desirable in a primary standard. 2. Define equivalence point and titration gnd...
I'm not sure about how I'm supposed to find NaOH concentration from a strong acid and...
I'm not sure about how I'm supposed to find NaOH
concentration from a strong acid and strong base titration. I'm
thinking that 2.5×10^-8 mol per L that I calculated would make the
moles of NaOH 2.5x10^-8 mol since it's a one to one
ratio.
Hydrochloric acid titration: Confirming the concentration of NaOH Concentration of HCl solution from the stock bottle: _ 0.OSM! Initial pH of HCl solution: 1.66 pH Volume NaOH (mL) Concentration of NaOH (M) Non Phenolphthalein (end point)...
based on thw data can someone solve question number 1, 2, 3, 4 18 Acid-Base Reactions...
based on thw data can someone solve question number 1, 2, 3,
4
18 Acid-Base Reactions Titration Curve Consider a 10. mL sample of 0.10 M HCI. a) What is the pH of the solution? b)How many ml. of 0.10 M NaOH would be required to neutralize it? c) what is the pH of the neutralized solution? d) What would the pH of the solution be if you added 20. mL of NaOH? volume ofvolumef 0.10 M HCI 0.10 M...
Part A The volume required to reach the equivalence point of an acid-base litration depends on the volume and concentration of the acid or base to be titrated and on the concentration of the acid or base used to do the titration. It does not, however, depend on the whether or not the acid or base being litrated is strong or weak. Explain Match the words in the left column to the appropriate blanks in the sentences on the right...
It's a weak acid strong base titration
Experiment 4: Identification of an unknown acid by titration Page 2 of 15 Background In this experiment, you will use both qualitative and quantitative properties to determine an unknown acid's identity and concentration. To do this analysis, you will perform a titration of your unknown acid sample-specifically a potentiometric titration where you use a pH meter and record pH values during the titration, combined with a visual titration using a color indi- cator...
Use the titration curve of a weak acid with a strong base below to answer the following questions. Identify the Equivalence Point of Titration and label it on the titration curve below. (ii) What is the Titrant (iii) From the graph, what is the [H^+] and the volume of NaOH used to reach the equivalence point. (iv) Calculate the [OH^-] at the equivalence point (v) What is the pKa of the acid used for titration? (vi) Calculate the Ka of...
Calculations: Show work.
a) From the graph, find the volume of base needed to reach the
first equivalence point.
b)Subtract the volume of NaOH needed to reach the first
equivalence from that needed to reach the second equivalence point.
Use this as the volume of the base.
c) Find the moles of base.
d)Write and balance the ewuation for the reaction between the
acid used and NaOH.
e)Calculate the moles of acid required to react with the
calculated moles of...
a) Use this plot to estimate the volume of NaOH
required to reach the equivalence point of each titration
curve.
b) Estimate the original concentration of weak acid in
solution before strong base was added.
c) Find the midpoint pH for each of the trials using
half the volume of NaOH required to reach the equivalence point for
that trial. Check if this pH is at the most flat part of the
titration curve. This is the pKa of the...
Anita Math Acid-Base Titrations Compatibility Mede Saved to this PC T Tools Tell me what you want to dos Design Layout References Malings Review View Help Design Layout A AAa E wRo 112 AaßbCcl AaBbC AallbCcl AaBbCcl AaBbCcD AaBbC daBbCel & .A . Emphasis Heading 1 1 Normal Subtitle Tele Intense Q S Strong Font Styles Paragraph Acid /Base Titrations: Pre-Laboratory Assignment 1 Give at least two characteristics desirable in a primary standard. 2. Define equivalence point and titration gnd...
I'm not sure about how I'm supposed to find NaOH
concentration from a strong acid and strong base titration. I'm
thinking that 2.5×10^-8 mol per L that I calculated would make the
moles of NaOH 2.5x10^-8 mol since it's a one to one
ratio.
Hydrochloric acid titration: Confirming the concentration of NaOH Concentration of HCl solution from the stock bottle: _ 0.OSM! Initial pH of HCl solution: 1.66 pH Volume NaOH (mL) Concentration of NaOH (M) Non Phenolphthalein (end point)...
based on thw data can someone solve question number 1, 2, 3,
4
18 Acid-Base Reactions Titration Curve Consider a 10. mL sample of 0.10 M HCI. a) What is the pH of the solution? b)How many ml. of 0.10 M NaOH would be required to neutralize it? c) what is the pH of the neutralized solution? d) What would the pH of the solution be if you added 20. mL of NaOH? volume ofvolumef 0.10 M HCI 0.10 M...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 16 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago