Homework Answers
According to the Lechatelier's principle, any change in factor at equilibrium will shift the equilibrium in that direction where it's effect of change reduces.
Thus, adding HCl and Mg shift equilibrium forward and increase amount of H2.
Removing H2 shift equilibrium forward where more H2 produced.
Answer is increasing the amount of HCl and Mg and removing H2 as it is formed.
Add Answer to:
Consider the following reaction, which of the following changes will produce more H2(g)? Select ALL that...
QUESTION 1 Consider the following chemical reaction: Mg(s) + 2HCl(aq) – MgCl2(aq) + H2(g) Which of...
QUESTION 1 Consider the following chemical reaction: Mg(s) + 2HCl(aq) – MgCl2(aq) + H2(g) Which of the following changes will decrease the rate of this reaction? Adding more solid Mg. Adding a catalyst. Decreasing the pressure of H2. Decreasing the temperature. Increasing the concentration of HCI.
QUESTION 1 Consider the following chemical reaction: Mg(s) + 2HCl(aq) → MgCl2(aq) + H2(g) Which of...
QUESTION 1 Consider the following chemical reaction: Mg(s) + 2HCl(aq) → MgCl2(aq) + H2(g) Which of the following changes will decrease the rate of this reaction? Adding more solid Mg. Adding a catalyst. Decreasing the pressure of H2. Decreasing the temperature. Increasing the concentration of HCI.
QUESTION 1 Consider the following chemical reaction: Mg(s) + 2HCl(aq) → MgCl2(aq) + H2(g) Which of...
QUESTION 1 Consider the following chemical reaction: Mg(s) + 2HCl(aq) → MgCl2(aq) + H2(g) Which of the following changes will increase the rate of this reaction? Decreasing the concentration of HCI. O Adding more MgCl2. O Increasing the pressure of H2. Decreasing the temperature. Adding a catalyst. N QUESTION 2
Consider the reaction, which is exothermic as written, 2H2(g) + X2(8)=2H2X(g). Which of the following changes...
Consider the reaction, which is exothermic as written, 2H2(g) + X2(8)=2H2X(g). Which of the following changes would result in the production of more H2X(g)? 1. adding H2(8) II. removing H2(8) III. reducing the volume of the container IV. removing X2(8) V. increasing the temperature VI. increasing the volume of the container VII. adding X2(g) VIII. reducing the temperature IX. adding a suitable catalyst
Consider the following reaction: 2 HCl(aq) + 1 Mg(s) → 1 MgCl2(aq) + 1 H2(g) ΔH°rx...
Consider the following reaction: 2 HCl(aq) + 1 Mg(s) → 1 MgCl2(aq) + 1 H2(g) ΔH°rx = -465.8 kJ Determine the amount of heat released, in kJ, of each of the following scenarios. Give each answer to 2 decimal places. (a) 10.69 g of Mg(s) is reacted with excess HCl(aq)· (c) 1.17 g of H2(g) is produced from the reaction after completion. (b) Excess Mg(s) is added to 440 mL of 0.996 M of HCl(aq)· (d) 580 mL of a...
Consider the reaction, which is exothermic as written, 2H2(g) + X2(g) =2H2X(g). Which of the following...
Consider the reaction, which is exothermic as written, 2H2(g) + X2(g) =2H2X(g). Which of the following changes would result in the production of more H2X(g)? I. adding H2(g) II. removing H2(g) III. reducing the volume of the container IV. removing X2(g) V. increasing the temperature VI. increasing the volume of the container VII. adding X2(8) VIII. reducing the temperature IX adding a suitable catalyst a) 1, II, VI, VIII Ob) I, III, VII, VIII OC) 1, III, VII, VIII, IX...
Consider the following reaction: Mg (s) + 2 HCl (aq) → MgCl2 (aq) + H2 (g)...
Consider the following reaction: Mg (s) + 2 HCl (aq) → MgCl2 (aq) + H2 (g) ΔHrxn = –4.6 × 102 kJ a. Is this reaction endothermic or exothermic? Circle one. [1] b. How much heat is evolved when 1.37 g of Mg are dissolved in excess HCl? [5] c. If 1.37 g of Mg are dissolved in enough HCl to make 250.0 mL of solution in a coffee-cup calorimeter, what is the final temperature of the solution? (Assume density...
1) The reaction below is exothermic 2SO2 (g) + O2(g) = 2803(g) + heat Le Châtelier's...
1) The reaction below is exothermic 2SO2 (g) + O2(g) ⇌ 2SO3(g) + heat Le Châtelier's Principle predicts that _______ will result in an increase in the number of moles of SO3 (g) in the reaction container. Which direction will the reaction shift: ? left or right A) increasing the volume of the container B) increasing the amount of SO2 C) removing some oxygen D) increasing the temperature E) decreasing the pressure 2) Consider the following reaction at equilibrium: 2SO2 (g) + O2 (g) ⇌ 2SO3 (g) + heat ΔH...
Consider the reaction H2(g) + Cl2(g) ⇌ 2HCl(g) which of the following stresses will cause the...
Consider the reaction H2(g) + Cl2(g) ⇌ 2HCl(g) which of the following stresses will cause the reaction shift in the forward direction? a. decreasing the pressure b. removing some HCl(g) c. increasing the pressure d. removing some H2(g) Consider the reaction N2(g)+2O2(g)→2NO2(g), which stress will cause the reaction shift to the left a. increasing the pressure b. removing some NO2(g) c. adding a catalyst d. decreasing the pressure Phenolphthalein is an indicator with a pH range from 8.3 to 10.0....
which if the following equations balanzed? select all that apply. Mg(s)+2HCl(aq) --> MgCl2 (aq) +H2 (g) 3Al(s) + 3Br...
which if the following equations balanzed? select all that apply. Mg(s)+2HCl(aq) --> MgCl2 (aq) +H2 (g) 3Al(s) + 3Br2(I) --> Al2Br3 (s) 2HgO(s) --> 2Hg(I) + O2 (g) N2+O2--> 2NO 2H2O2 --> 2 H2 +O2
QUESTION 1 Consider the following chemical reaction: Mg(s) + 2HCl(aq) – MgCl2(aq) + H2(g) Which of the following changes will decrease the rate of this reaction? Adding more solid Mg. Adding a catalyst. Decreasing the pressure of H2. Decreasing the temperature. Increasing the concentration of HCI.
QUESTION 1 Consider the following chemical reaction: Mg(s) + 2HCl(aq) → MgCl2(aq) + H2(g) Which of the following changes will decrease the rate of this reaction? Adding more solid Mg. Adding a catalyst. Decreasing the pressure of H2. Decreasing the temperature. Increasing the concentration of HCI.
QUESTION 1 Consider the following chemical reaction: Mg(s) + 2HCl(aq) → MgCl2(aq) + H2(g) Which of the following changes will increase the rate of this reaction? Decreasing the concentration of HCI. O Adding more MgCl2. O Increasing the pressure of H2. Decreasing the temperature. Adding a catalyst. N QUESTION 2
Consider the reaction, which is exothermic as written, 2H2(g) + X2(8)=2H2X(g). Which of the following changes would result in the production of more H2X(g)? 1. adding H2(8) II. removing H2(8) III. reducing the volume of the container IV. removing X2(8) V. increasing the temperature VI. increasing the volume of the container VII. adding X2(g) VIII. reducing the temperature IX. adding a suitable catalyst
Consider the reaction, which is exothermic as written, 2H2(g) + X2(g) =2H2X(g). Which of the following changes would result in the production of more H2X(g)? I. adding H2(g) II. removing H2(g) III. reducing the volume of the container IV. removing X2(g) V. increasing the temperature VI. increasing the volume of the container VII. adding X2(8) VIII. reducing the temperature IX adding a suitable catalyst a) 1, II, VI, VIII Ob) I, III, VII, VIII OC) 1, III, VII, VIII, IX...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago