Homework Answers
From reaction,
When 5 mol of CO2 is produced, energy = -3535 KJ
So,
When 1 mol of CO2 is produced, energy = -3535/5 = -707 KJ
So, 707 KJ is amount of energy obtained per mol of CO2 produced
Answer: 707 KJ/mol
Add Answer to:
Estimate the environmental value of pentane, C_5H_12. The environmental value is the amount of energy obtained...
Assume that the complete combustion of one mole of fructose, a monosaccharide, to carbon dioxide and...
Assume that the complete combustion of one mole of fructose, a
monosaccharide, to carbon dioxide and water liberates 2810 kJ of
energy (Δ?°′=−2810 kJ/mol ). If the energy generated by the
combustion of fructose is entirely converted to the synthesis of a
hypothetical compound X, calculate the number of moles of the
compound that could theoretically be generated. Use the value
Δ?°′compound X=−75.7 kJ/mol . Round your answer to two significant
figures.
Thank you!!
Assume that the complete combustion of...
oriocatorass References Quinone is an important type of molecule that is involved in photosynthesis. The transport...
oriocatorass References Quinone is an important type of molecule that is involved in photosynthesis. The transport of electrons mediated by quinone in certain enzymes allows plants to take water, carbon dioxide, and the energy of sunlight to create glucose. A 0.1939-g sample of quinone (CeH,O2) is burned in a bomb calorimeter with a heat capacity of 1.56 kJC. The temperature of the calorimeter increases by 3.1°C. Calculate the energy of combustion of quinone per gram and per mole kJ/g Energy...
Use the table to answer questions about bond energies. Bond Bond Energy (KJ/mol) C—C 347 C=C...
Use the table to answer questions about bond energies. Bond Bond Energy (KJ/mol) C—C 347 C=C 611 C-H 414 C-O 360 C=O 736 O-O 142 O=O 498 H-O 464 (i) Calculate the bond energy for breaking all the bonds in a mole of methane, CH4 Express your answer numerically in kilojoules per mole. Change in Heat Ch4 ?=KJ/mol (ii) Calculate the bond energy for breaking all the bonds in a mole of O2 molecules? Express your answer numerically in kilojoules...
Assume that the complete combustion of one mole of glucose to carbon dioxide and water liberates...
Assume that the complete combustion of one mole of glucose to carbon dioxide and water liberates 2870 kJ/mol (AG' = -2870 kJ/mol). If one contraction cycle in muscle requires 63 kJ, and the energy from the combustion of glucose is converted with an efficiency of 43% to contraction, how many contraction cycles could theoretically be fueled by the complete combustion of one mole of glucose? Round your answer to the nearest whole number. cycles per mole glucose =
Assume that the complete combustion of one mole of glucose to carbon dioxide and water liberates...
Assume that the complete combustion of one mole of glucose to carbon dioxide and water liberates 2870 kJ/mol (ΔG°′=−2870 kJ/mol). If one contraction cycle in muscle requires 61 kJ, and the energy from the combustion of glucose is converted with an efficiency of 37% to contraction, how many contraction cycles could theoretically be fueled by the complete combustion of one mole of glucose? Round your answer to the nearest whole number. CYCLE PER MOLE GLUCOSE =
Assume that the complete combustion of one mole of glucose to carbon dioxide and water liberates...
Assume that the complete combustion of one mole of glucose to carbon dioxide and water liberates 2870 kJ/mol ( Δ?°′=−2870 kJ/mol ). If one contraction cycle in muscle requires 67 kJ , and the energy from the combustion of glucose is converted with an efficiency of 43% to contraction, how many contraction cycles could theoretically be fueled by the complete combustion of one mole of glucose? Round your answer to the nearest whole number. Cycles per mole glucose = ___________...
Attempt 6 Assume that the complete combustion of one mole of glucose to carbon dioxide and...
Attempt 6 Assume that the complete combustion of one mole of glucose to carbon dioxide and water liberates 2870 kJ/mol (AG"' = -2870 kJ/mol). If one contraction cycle in muscle requires 57 kJ, and the energy from the combustion of glucose is converted with an efficiency of 45% to contraction, how many contraction cycles could theoretically be fueled by the complete combustion of one mole of glucose? Round your answer to the nearest whole number. cycles per mole glucose =
Many power plants produce energy by burning carbon-based fuels, which also produces carbon dioxide Carbon dioxide...
Many power plants produce energy by burning carbon-based fuels, which also produces carbon dioxide Carbon dioxide is a greenhouse gas, so over-production can have negative effects on the environment. Use enthalpy of formation data to calculate the number of moles of CO2(g) produced per megajoule of heat released from the combustion of each fuel under standard conditions (1 atm and 25 °C). (a) coal, C(s, graphite); (b) natural gas, CH4(g): Number Number mol MJ1 mol MJ (c) propane, C3Hs(g); (d)...
Many power plants produce energy by burning carbon-based fuels, which also produces carbon dioxide. Carbon dioxide...
Many power plants produce energy by burning carbon-based fuels, which also produces carbon dioxide. Carbon dioxide is a greenhouse gas, so over-production can have negative effects on the environment. Use enthalpy of formation data to calculate the number of moles of CO2(g) produced per megajoule of heat released from the combustion of each fuel under standard conditions (1 atm and 25 �C). Each must be in mol * MJ^-1 (a) coal, C(s, graphite) (b) natural gas, CH4(g); (c) propane, C3H8(g);...
assume the products of combustion are carbon dioxide gas and liquid water. write a balanced chemical...
assume the products of combustion are carbon dioxide
gas and liquid water. write a balanced chemical equation. what is
the heat of formation of Quinine?
Assume the products of combustion are carbon dioxide gas and liquid water. Write a balanced chemical equation. What is the heat of formation of quinine? 6. A 2.200 g sample of quinine (C&H,O) is burned in a bomb calorimeter whose total heat capacity is 7.854 kJ/°C. The temperature of the calorimeter increases from 23.44°C to...
Assume that the complete combustion of one mole of fructose, a
monosaccharide, to carbon dioxide and water liberates 2810 kJ of
energy (Δ?°′=−2810 kJ/mol ). If the energy generated by the
combustion of fructose is entirely converted to the synthesis of a
hypothetical compound X, calculate the number of moles of the
compound that could theoretically be generated. Use the value
Δ?°′compound X=−75.7 kJ/mol . Round your answer to two significant
figures.
Thank you!!
Assume that the complete combustion of...
oriocatorass References Quinone is an important type of molecule that is involved in photosynthesis. The transport of electrons mediated by quinone in certain enzymes allows plants to take water, carbon dioxide, and the energy of sunlight to create glucose. A 0.1939-g sample of quinone (CeH,O2) is burned in a bomb calorimeter with a heat capacity of 1.56 kJC. The temperature of the calorimeter increases by 3.1°C. Calculate the energy of combustion of quinone per gram and per mole kJ/g Energy...
Assume that the complete combustion of one mole of glucose to carbon dioxide and water liberates 2870 kJ/mol (AG' = -2870 kJ/mol). If one contraction cycle in muscle requires 63 kJ, and the energy from the combustion of glucose is converted with an efficiency of 43% to contraction, how many contraction cycles could theoretically be fueled by the complete combustion of one mole of glucose? Round your answer to the nearest whole number. cycles per mole glucose =
Attempt 6 Assume that the complete combustion of one mole of glucose to carbon dioxide and water liberates 2870 kJ/mol (AG"' = -2870 kJ/mol). If one contraction cycle in muscle requires 57 kJ, and the energy from the combustion of glucose is converted with an efficiency of 45% to contraction, how many contraction cycles could theoretically be fueled by the complete combustion of one mole of glucose? Round your answer to the nearest whole number. cycles per mole glucose =
Many power plants produce energy by burning carbon-based fuels, which also produces carbon dioxide Carbon dioxide is a greenhouse gas, so over-production can have negative effects on the environment. Use enthalpy of formation data to calculate the number of moles of CO2(g) produced per megajoule of heat released from the combustion of each fuel under standard conditions (1 atm and 25 °C). (a) coal, C(s, graphite); (b) natural gas, CH4(g): Number Number mol MJ1 mol MJ (c) propane, C3Hs(g); (d)...
assume the products of combustion are carbon dioxide
gas and liquid water. write a balanced chemical equation. what is
the heat of formation of Quinine?
Assume the products of combustion are carbon dioxide gas and liquid water. Write a balanced chemical equation. What is the heat of formation of quinine? 6. A 2.200 g sample of quinine (C&H,O) is burned in a bomb calorimeter whose total heat capacity is 7.854 kJ/°C. The temperature of the calorimeter increases from 23.44°C to...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago