Please explain in detail ( a paragraph or more) why C-C bonds and O-H bonds are...
Please explain in detail ( a paragraph or more) why C-C bonds and O-H bonds are significant in Grignard reactions?
Homework Answers
Grignard reaction is a addition reaction of alkyl magnesium halide (nucleophile in nature) to the carbonyl functionality.
In which nucleophilic alkyl/aryl group (carbon having negative charge) will adds the carbonyl carbon to form C-C bond, and in final step salt of magnesium bromide present as OMgBr will be hydrolyzed to form O-H bond.
Add Answer to:
Please explain in detail ( a paragraph or more) why C-C bonds
and O-H bonds are...
Explain in detail why does bromination of ethoxy benzene occur more rapidly than phenyl benzoate? Please...
Explain in detail why does bromination of ethoxy benzene occur more rapidly than phenyl benzoate? Please illustrate also.
Please answer the following questions in detail ( two paragraph at least ): What is the...
Please answer the following questions in detail ( two paragraph at least ): What is the basic difference between synchronous machine and induction machine? Why induction motor is more common as compared to induction generator?
(Please explain in detail in a paragraph) Chapter 10 explains that because of the methods of...
(Please explain in detail in a paragraph) Chapter 10 explains that because of the methods of financing, the absence of tax and profit requirements, and political and social factors, the criteria used in evaluating privately financed projects frequently cannot be applied to public works. The benefit-cost ratio (B-C) has remained a popular method for evaluating the financial performance of public projects. Chapter 11 addresses sensitivity analysis among alternatives to be made or the acceptability of a project to be determined...
The answer is c, Could you please explain in detail why The answer for this is...
The answer is c, Could you please explain in detail why
The answer for this is d
The answer is b, but d makes more sense to me
Anwer is d
/25. The formate anion, HCO, has delocalized electrons that populate three-centre n molecular orbitals similar to those of ozone. Assuming a ground state electron configuration, which of the following best represents the electron populations in these delocalized orbitals for the fomate anion? a. b. d. 元事 - 元* 元*...
Please explain in DETAIL why mental health care services are important in the US. *Please answer in DETAIL and provide A...
Please explain in DETAIL why mental health care services are important in the US. *Please answer in DETAIL and provide ALL websites used*
Please explain the mechanisms of these reactions in detail 0 6. CrO HO OH OH 3....
Please explain the mechanisms of these reactions in
detail
0 6. CrO HO OH OH 3. 1. PCC 2·PhMgBr 3. H note: Ph .CH,MgBr (xs) OCH, 2. H,O 3. HCI CI
Please Explain in detail. Thanks h a titration that Initiatly Contains Carbonats and bicarbonat&, Of titrant...
Please Explain in detail. Thanks
h a titration that Initiatly Contains Carbonats and bicarbonat&, Of titrant required to reach tee tre volum tirst equivalence Point is Less than that require dl to titrate from the first equivalence point to the Serond Explain why?
please explain in detail why C is the correct choice why cant all the choice be...
please explain in detail why C is the correct choice why cant all
the choice be the answer?
2. Which of the following statements about a well-maintained yard best conveys the general nature of the externality? a. A well-maintained yard conveys a positive externality because it increases the home's market value. yard conveys a negative externality because it increases the property tax liability of the owner. c. A well-maintained yard conveys a positive externality because it increases the value of...
Please explain in detail why alkenes and water do or do not mix.
Please explain in detail why alkenes and water do or do not mix.
Can competition or predation cause extinction? Why or why not? Please explain your answer in detail.
Can competition or predation cause extinction? Why or why not? Please explain your answer in detail.
The answer is c, Could you please explain in detail why
The answer for this is d
The answer is b, but d makes more sense to me
Anwer is d
/25. The formate anion, HCO, has delocalized electrons that populate three-centre n molecular orbitals similar to those of ozone. Assuming a ground state electron configuration, which of the following best represents the electron populations in these delocalized orbitals for the fomate anion? a. b. d. 元事 - 元* 元*...
Please explain the mechanisms of these reactions in
detail
0 6. CrO HO OH OH 3. 1. PCC 2·PhMgBr 3. H note: Ph .CH,MgBr (xs) OCH, 2. H,O 3. HCI CI
Please Explain in detail. Thanks
h a titration that Initiatly Contains Carbonats and bicarbonat&, Of titrant required to reach tee tre volum tirst equivalence Point is Less than that require dl to titrate from the first equivalence point to the Serond Explain why?
please explain in detail why C is the correct choice why cant all
the choice be the answer?
2. Which of the following statements about a well-maintained yard best conveys the general nature of the externality? a. A well-maintained yard conveys a positive externality because it increases the home's market value. yard conveys a negative externality because it increases the property tax liability of the owner. c. A well-maintained yard conveys a positive externality because it increases the value of...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 24 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago