Homework Answers
Add Answer to:
#27. Draw a MO diagram for NO. Which of the following statements is incorrect? a) NO...
The following questions are true/false 1. The potential energy associated with London dispersion interactions decreases with...
The following questions are true/false 1. The potential energy associated with London dispersion interactions decreases with intermolecular distance as r-12 (where r is the intermolecular distance). 2. SiH4 is more polarizable than CH4. 3. In H2, the antibonding orbital formed by linear combination of two 1s orbitals has zero nodes. 4. In N2, the π bonding orbital formed by linear combination of two 2p orbitals has one node. 5. CO2 has zero total permanent dipole moment. 6. The kinetic energy...
please answer question 6 using question 5 and the molecular orbital diagram given. 5) BEN B...
please answer question 6 using question 5 and the molecular orbital
diagram given.
5) BEN B 2s-14.0s 2p-8.30 N 25-255la 2p-13 18 8.s01 111 13.18 E -14.051 The S p mua should be considered because the BN vere to be pa mikg Wauld change fram diamagaetic h paranetic As an aove wilh the ixking thare Ore ro uapaund electran whlk it t were to be m ovng tha Csp and he Wd Swtching causng th Tp to have upaised tlectrans...
14 Which of the following is true if a molecule possesses lone pairs on the central...
14 Which of the following is true if a molecule possesses lone pairs on the central atom but is not hydrogen bonded? (A) the molecule will have a hydrogen bonded directly to an N, O, or F (B) the molecule will be nonpolar (C) the molecule will be an ionic crystal lattice structure where there are strong clectrostatic (D) the molecule will be polar 15 A substance with strong intermolecular forces will have (A) low boiling point (B) high reactivity...
A species has the following MO configuration: (σ1s)2(σ1s*)2(σ2s)2(σ2s*)2(σ2p)2(π2p)2 The substance is: A. Paramagnetic with one unpaired...
A species has the following MO configuration: (σ1s)2(σ1s*)2(σ2s)2(σ2s*)2(σ2p)2(π2p)2 The substance is: A. Paramagnetic with one unpaired electron B. Two unpaired electrons C. Three unpaired electrons D. Four unpaired electrons E. Diamagnetic
please explain all 18. Which choice contains a set of isoelectronic species? A. O?-and Nat B....
please explain all
18. Which choice contains a set of isoelectronic species? A. O?-and Nat B. 02- and S? C. 02- and F2 D. 02- and P3-only 19. What element is represented by the electron configuration 1s22s22p“3s 3p3? Α. Ρ '.' B. S C. Si D. As 20. How many single bonds, double bonds and lone pairs are predicted on the nitrogen atom for ONCI (Nitrogen is the central element, so the skeleton can be visualized in the order O-N-CI)?...
answers given but please show work on how you get to that answer. 16. Which one...
answers given but please show work on how you get to that
answer.
16. Which one of the following statements about valence electron c Tollowing statements about valence electron configurations is incorrect? A) A single neutral phosphorus atom, P, has 5 valence electrons. B) A single neutral carbon atom, C, has 2 unpaired valence electrons. (C) A single neutral sulfur atom, S, has 2 valence electrons. D) A single neutral nitrogen atom, N, has 3 unpaired valence electrons. E) A...
Hi there I need help please. 26. Which of the following does not have eight valence...
Hi there I need help please.
26. Which of the following does not have eight valence electrons? A) Ca+ B) Rb+ C) Xe D) Br E) All of the above have eight valence electrons. as the magnitude of the ion 27. In ionic bond formation, the lattice energy of ions charges A) decrease, decrease, decrease B) increases, increase, increase C) decreases, increase, increase D) increases, increase, decrease E) increases, decrease, decrease and the radii 28. Which formula/name pair is incorrect?...
Answer true or false. 1. Atoms that lose electrons to achieve a filled valence shell become...
Answer true or false. 1. Atoms that lose electrons to achieve a filled valence shell become cations and form ionic bonds with anions. 2. Ionic bonds tend to form between elements on the left side of the Periodic Table, and covalent bonds tend to form between elements on the right side of the Periodic Table. 3. Electronegativity is a measure of an atom's attraction for the electrons it shares in a chemical bond with another atom. 4. Fluorine, in the...
6. Draw the electron dot formula for the chlorate ion, ClO3-, and state the type of bonds...
6. Draw the electron dot formula for the chlorate ion, ClO3-, and state the type of bonds in a chlorate ion. A) 1 single bond & 2 double bonds B) 3 single bonds C) 2 single bonds & 1 double bond D) 2 single bonds and 1 triple bond E) none of the above 7. What is the electron pair geometry for a phosphine molecule, PH3? A) bent B) linear C) tetrahedral D) trigonal pyramidal E) none of the above 8. Predict which of the following...
25) Identify the element with the following electron configuration: [Kr5e14d5 A) Cr 8) Ni D) Tc E) Mo F) Re 26) How...
25) Identify the element with the following electron configuration: [Kr5e14d5 A) Cr 8) Ni D) Tc E) Mo F) Re 26) How many unpaired electrons are present in the ground state sulphur atom? A) 0 B) 1 C) 2 D) 3 E) 4 F) 5 27) Identify the set of three quantum numbers that could represent the valence electrons in Sr A) -4,1 1, m= 1 B) n=4,1-0, m- 1 c)n 5,I= 1, m-1 -5,1-0, my = 0 D) E)...
please answer question 6 using question 5 and the molecular orbital
diagram given.
5) BEN B 2s-14.0s 2p-8.30 N 25-255la 2p-13 18 8.s01 111 13.18 E -14.051 The S p mua should be considered because the BN vere to be pa mikg Wauld change fram diamagaetic h paranetic As an aove wilh the ixking thare Ore ro uapaund electran whlk it t were to be m ovng tha Csp and he Wd Swtching causng th Tp to have upaised tlectrans...
14 Which of the following is true if a molecule possesses lone pairs on the central atom but is not hydrogen bonded? (A) the molecule will have a hydrogen bonded directly to an N, O, or F (B) the molecule will be nonpolar (C) the molecule will be an ionic crystal lattice structure where there are strong clectrostatic (D) the molecule will be polar 15 A substance with strong intermolecular forces will have (A) low boiling point (B) high reactivity...
please explain all
18. Which choice contains a set of isoelectronic species? A. O?-and Nat B. 02- and S? C. 02- and F2 D. 02- and P3-only 19. What element is represented by the electron configuration 1s22s22p“3s 3p3? Α. Ρ '.' B. S C. Si D. As 20. How many single bonds, double bonds and lone pairs are predicted on the nitrogen atom for ONCI (Nitrogen is the central element, so the skeleton can be visualized in the order O-N-CI)?...
answers given but please show work on how you get to that
answer.
16. Which one of the following statements about valence electron c Tollowing statements about valence electron configurations is incorrect? A) A single neutral phosphorus atom, P, has 5 valence electrons. B) A single neutral carbon atom, C, has 2 unpaired valence electrons. (C) A single neutral sulfur atom, S, has 2 valence electrons. D) A single neutral nitrogen atom, N, has 3 unpaired valence electrons. E) A...
Hi there I need help please.
26. Which of the following does not have eight valence electrons? A) Ca+ B) Rb+ C) Xe D) Br E) All of the above have eight valence electrons. as the magnitude of the ion 27. In ionic bond formation, the lattice energy of ions charges A) decrease, decrease, decrease B) increases, increase, increase C) decreases, increase, increase D) increases, increase, decrease E) increases, decrease, decrease and the radii 28. Which formula/name pair is incorrect?...
25) Identify the element with the following electron configuration: [Kr5e14d5 A) Cr 8) Ni D) Tc E) Mo F) Re 26) How many unpaired electrons are present in the ground state sulphur atom? A) 0 B) 1 C) 2 D) 3 E) 4 F) 5 27) Identify the set of three quantum numbers that could represent the valence electrons in Sr A) -4,1 1, m= 1 B) n=4,1-0, m- 1 c)n 5,I= 1, m-1 -5,1-0, my = 0 D) E)...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago