Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Review titration problems and how to solve for the unknown concentration. a) If it takes 83.0...
1- It takes 83.0 mL of a 0.45 M NaOH solution to neutralize 235 mL of...
1- It takes 83.0 mL of a 0.45 M NaOH solution to neutralize 235 mL of an HCI solution. What is the concentration of the HCl solution? 2- It takes 12.5 mL of a 0.30 M HCl solution to neutralize 285 mL of NaOH solution. What is the concentration of the NaOH solution? 3- During titration, 22.4 mLofo.100 M NaOH was required to neutralize the acidic analyte. Calculate the number of moles of sodium hydroxide in the titer.
Acid - Base Titration Experiment ACID-BASE TITRATION CHEM 1111 Name Date: Post - Laboratory Review Questions...
Acid - Base Titration Experiment ACID-BASE TITRATION CHEM 1111 Name Date: Post - Laboratory Review Questions and Exercises DUE AFTER COMPLETING LAB. ANSWER IN THE SPACE PROVIDED 1. Write the Molecular, Complete, and Net equations for the neutralization reaction of HC and No. 2. How many milliliters of 0.50 M Phosphoric acid, H,PO.. are required to neutralize 25,0 mL of 0.50 M NaOH? 3. Why should you plan to start the titration with the acid and base burettes filled exactly...
page 74 Exp. 9: Acid-Base Titration Questions (show your work for the math problems!) Write a...
page 74 Exp. 9: Acid-Base Titration Questions (show your work for the math problems!) Write a balanced equation as in footnote 2 for the neutralization of formic acid with sodium hydroxide. 1. H-C-OH Formic acid If an air bubble is t initially in the tip of the vinegar buret, but disappears' during the 2. course of the titration, how would this affeet your calculation for the concentration of (larger, smaller, no effect)? Explain your answer. Explain how the indicator phenolphthalein...
A 25.00 mL solution of H2SO4 of unknown concentration was titrated with a 3.15 M NaOH...
A 25.00 mL solution of H2SO4 of unknown concentration was titrated with a 3.15 M NaOH solution. What is the concentration of the H2SO4 solution if 36.01 mL of the NaOH solution is required neutralize the acid solution?
Suppose you are titrating a sulfuric acid solution of unknown concentration with a sodium hydroxide solution...
Suppose you are titrating a sulfuric acid solution of unknown concentration with a sodium hydroxide solution according to the equation H2SO4 + 2NaOH + 2H2O + Na2SO4 If you require 28.52 mL of 0.904 M NaOH solution to titrate 209.1 mL of H2SO4 solution, what is the concentration of the H2SO4 solution? Type answer:
The titration of 29.40 mL of HCl solution of unknown concentration requires 12.82 mL of a...
The titration of 29.40 mL of HCl solution of unknown concentration requires 12.82 mL of a 0.150 M NaOH solution to reach the equivalence point. What is the concentration of the unknown HCl solution in M?
2) The titration of 35.0 ml of an unknown concentration H2SO4 solution requires 42.6 ml of...
2) The titration of 35.0 ml of an unknown concentration H2SO4 solution requires 42.6 ml of 0.12 M LIOH solution. What is the concentration of the H2SO4 solution (in M)? Write the balanced equation first. 0.146 M ОА. 0.0730 M OB. 0.292 M Ос. 0.0365 M OD E. None of the above
An acid-base titration is performed: 250.0 mL of an unknown concentration of HCl(aq) is titrated to...
An acid-base titration is performed: 250.0 mL of an unknown concentration of HCl(aq) is titrated to the equivalence point with 36.7 mL of a 0.1000 M aqueous solution of NaOH. Which of the following statements is not true of this titration? A. At the equivalence point, the OH−concentration in the solution is 3.67×10−3 M. B. The pH is less than 7 after adding 25 mL of NaOH solution. C. The pH at the equivalence point is 7.00. D. The HCl...
I have the answers to these problems but I don't understand why these are the answers...
I have the answers to these problems but I don't understand why these are the answers and how to do them. 1. Vinegar was titrated with Mg(OH)2 to find the content of acetic acid (HC2H3O2). If 20.0mL of vinegar required 5.00 mL of .800M Mg(OH)2 to reach the end point, what is the concentration of acetic acid? (Answer: .400M) 2. A Student titrates 25.00mL of tap water with 18.2 mL of .100M AgNO3 to completely precipitate the chloride ion. The...
PRE LAB : Volumetric Titrations. (Acid-Base Titrations) Name: ID Date 1. How many mL of a...
PRE LAB : Volumetric Titrations. (Acid-Base Titrations) Name: ID Date 1. How many mL of a 0.103M NaOH solution are required to neutralize 10.00mL of a 0.198M HCI solution? 2. what is the difference between end point and equivalence point? 3. A titration is performed and 20.70 mL of 0.500M KOH is required to reach the end point when titrated against 15.00 mL of H2SO4 of unknown concentration. Write the chemical equation and solve for the molarity of the acid....
1- It takes 83.0 mL of a 0.45 M NaOH solution to neutralize 235 mL of an HCI solution. What is the concentration of the HCl solution? 2- It takes 12.5 mL of a 0.30 M HCl solution to neutralize 285 mL of NaOH solution. What is the concentration of the NaOH solution? 3- During titration, 22.4 mLofo.100 M NaOH was required to neutralize the acidic analyte. Calculate the number of moles of sodium hydroxide in the titer.
Acid - Base Titration Experiment ACID-BASE TITRATION CHEM 1111 Name Date: Post - Laboratory Review Questions and Exercises DUE AFTER COMPLETING LAB. ANSWER IN THE SPACE PROVIDED 1. Write the Molecular, Complete, and Net equations for the neutralization reaction of HC and No. 2. How many milliliters of 0.50 M Phosphoric acid, H,PO.. are required to neutralize 25,0 mL of 0.50 M NaOH? 3. Why should you plan to start the titration with the acid and base burettes filled exactly...
page 74 Exp. 9: Acid-Base Titration Questions (show your work for the math problems!) Write a balanced equation as in footnote 2 for the neutralization of formic acid with sodium hydroxide. 1. H-C-OH Formic acid If an air bubble is t initially in the tip of the vinegar buret, but disappears' during the 2. course of the titration, how would this affeet your calculation for the concentration of (larger, smaller, no effect)? Explain your answer. Explain how the indicator phenolphthalein...
Suppose you are titrating a sulfuric acid solution of unknown concentration with a sodium hydroxide solution according to the equation H2SO4 + 2NaOH + 2H2O + Na2SO4 If you require 28.52 mL of 0.904 M NaOH solution to titrate 209.1 mL of H2SO4 solution, what is the concentration of the H2SO4 solution? Type answer:
2) The titration of 35.0 ml of an unknown concentration H2SO4 solution requires 42.6 ml of 0.12 M LIOH solution. What is the concentration of the H2SO4 solution (in M)? Write the balanced equation first. 0.146 M ОА. 0.0730 M OB. 0.292 M Ос. 0.0365 M OD E. None of the above
PRE LAB : Volumetric Titrations. (Acid-Base Titrations) Name: ID Date 1. How many mL of a 0.103M NaOH solution are required to neutralize 10.00mL of a 0.198M HCI solution? 2. what is the difference between end point and equivalence point? 3. A titration is performed and 20.70 mL of 0.500M KOH is required to reach the end point when titrated against 15.00 mL of H2SO4 of unknown concentration. Write the chemical equation and solve for the molarity of the acid....
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 8 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 58 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago