1. How does the sample separate on a TLC plate? 2.What are some ways to visualize...
1. How does the sample separate on a TLC plate?
2.What are some ways to visualize a TLC plate? Why may it be necessary to have more than one method to visualize a TLC plate?
3.Describe how to obtain a Retention Factor. What does the retention factor tell you?
Homework Answers
Add Answer to:
1. How does the sample separate on a TLC plate?
2.What are some ways to visualize...
Possible Quiz Questions 1 What two methods of visualizing spots on a TLC plate will you...
Possible Quiz Questions 1 What two methods of visualizing spots on a TLC plate will you use in this Give two reasons why would you predict that the elution solvents (hexanes or acetate) would not be visible under UV visualization? week's lab? ethyl 2. Define R 3. Calculate the R of the spot on the following TLC plate. 4. Which compound in each pair is predicted to have the higher Ri? a. CH3CH2CH2CH2OH and CH3CH2CH2CH28r b. CH3CH2CH2CH2OH and CH3CH2CH2CH2CH2CH2CH3 c....
9. Based on looking at your TLC plate taken during step 2 of Dilantin synthesis, answer...
9. Based on looking at your TLC plate taken during step 2 of Dilantin synthesis, answer the following questions (a) Which is more polar, benzoin or benzil? Circle Below. Benzoin Benzil (b) Now look at the structures of benzoin and benzil. Specifically explain why one of these compounds has a lower Rr value than the other. You must address structure in your answer. Explain in one or two sentences (c) How can you tell by TLC if your reaction went...
3. If the TLC plate development had stopped before the solvent front reached the top of...
3. If the TLC plate development had stopped before the solvent front reached the top of the TLC plate (i.e. maybe it reached the middle of the TLC plate when it was stopped, instead): a) Would the Rf values have been affected? If so, how? If not, why not? Give a numerical example to support your answer. b) Would the size of the spots have been affected? If so, how? If not, why not? (Hint: think about the diffusion of...
Post lab questions for chromatography and melting point lab. i have a few ideas of what the answers to these questions s...
Post lab questions for chromatography and melting point lab. i
have a few ideas of what the answers to these questions should be,
but I would like to double check. if anyone can help me, that would
be so awesome. Thank you!
A student cools a sample in a capillary tube after melting it. Upon attempting to determine the melting point on the same sample, the student does not obtain the same melting point. Why? A student places his TLC...
1. A TLC experiment is performed to separate a mixture of the compounds shown below. 5.2...
1. A TLC experiment is performed to separate a mixture of the compounds shown below. 5.2 cm 4.8 cm • C 0-H O-H 2.3 cm • B OCH3 Phenol Cyclohexadiene m-anisic acid 1.1 cm • A a) Draw dipole arrows / dipole moments present for each molecule (if they have any) (2 points) b) The experiment yielded the TLC plate given on the left. Match each spot to one of the three molecules. For each compound, explain what makes it...
1) A student develops their TLC plate and places it under a UV light, but nothing...
1) A student develops their TLC plate and places it under a UV light, but nothing appears. What mistake might the student have made? a) Spotted the compound below the level of eluent b) Spotted the compound above the level of eluent c) Used a sample that was too concentrated d) Used too much sample 2)Thin layer chromatography, TLC, is commonly used to monitor reactions to completion. Using this technique, what would indicate to a student that the reaction is...
Referring back to question 5 above, in the TLC plate on the left the eluting mobile...
Referring back to question 5 above, in the TLC plate on the left the eluting mobile phase solvent was ethyl acetate, in the plate on the right it was 97% ethyl acetate and 3% methanol. Explain why the Rf values in the plate on the right are larger than those in the plate on the left. Your explanation must be in the terms of intermolecular forces, you are not allowed to only use the word "polarity". There are THREE dynamical...
100 1. How western blot does works and explain some of its possible application? 2. While...
100 1. How western blot does works and explain some of its possible application? 2. While using the sample buffer (Leammli buffer), there was SDS (detergent). Why was the SDS necessary for running the gel? 3. Why was it necessary for the transfer to the nitrocellulose membrane? 4. The first stage of western blotting involves separating proteins using gel electrophoresis. On what basis does this technique separate proteins? 5. How can you test the efficiency of transfer of the protein...
How would a mixture of naphthalene and benzophenone behave on a TLC plate with hexanes /...
How would a mixture of naphthalene and benzophenone behave on a TLC plate with hexanes / acetone as the eluent? Compare the polarity of these two compounds. Outline the most commonly used procedure for the purification of an impure solid material using the technique of recrystallization. Why is acetone such a popular solvent? Point out one drawback in terms of safety considerations. Your final product might be impure since you suspect decomposition might have occurred. When determining the melting point...
can you please answer all 1. When you run a TLC of the reaction in ethyl...
can
you please answer all
1. When you run a TLC of the reaction in ethyl acetate : hexanes 1:1, the plate below is produced. Give a solvent system that would be expected to produce greater separation and a BRIEF (8 words) justification about your choice. (5 points) 7 6 5 4 3 b. Calculate the R for the bottom spot. (5 points) c. Which compound on the TLC plate is the most polar? (5 points) 2. Why is it...
Possible Quiz Questions 1 What two methods of visualizing spots on a TLC plate will you use in this Give two reasons why would you predict that the elution solvents (hexanes or acetate) would not be visible under UV visualization? week's lab? ethyl 2. Define R 3. Calculate the R of the spot on the following TLC plate. 4. Which compound in each pair is predicted to have the higher Ri? a. CH3CH2CH2CH2OH and CH3CH2CH2CH28r b. CH3CH2CH2CH2OH and CH3CH2CH2CH2CH2CH2CH3 c....
9. Based on looking at your TLC plate taken during step 2 of Dilantin synthesis, answer the following questions (a) Which is more polar, benzoin or benzil? Circle Below. Benzoin Benzil (b) Now look at the structures of benzoin and benzil. Specifically explain why one of these compounds has a lower Rr value than the other. You must address structure in your answer. Explain in one or two sentences (c) How can you tell by TLC if your reaction went...
Post lab questions for chromatography and melting point lab. i
have a few ideas of what the answers to these questions should be,
but I would like to double check. if anyone can help me, that would
be so awesome. Thank you!
A student cools a sample in a capillary tube after melting it. Upon attempting to determine the melting point on the same sample, the student does not obtain the same melting point. Why? A student places his TLC...
1. A TLC experiment is performed to separate a mixture of the compounds shown below. 5.2 cm 4.8 cm • C 0-H O-H 2.3 cm • B OCH3 Phenol Cyclohexadiene m-anisic acid 1.1 cm • A a) Draw dipole arrows / dipole moments present for each molecule (if they have any) (2 points) b) The experiment yielded the TLC plate given on the left. Match each spot to one of the three molecules. For each compound, explain what makes it...
Referring back to question 5 above, in the TLC plate on the left the eluting mobile phase solvent was ethyl acetate, in the plate on the right it was 97% ethyl acetate and 3% methanol. Explain why the Rf values in the plate on the right are larger than those in the plate on the left. Your explanation must be in the terms of intermolecular forces, you are not allowed to only use the word "polarity". There are THREE dynamical...
100 1. How western blot does works and explain some of its possible application? 2. While using the sample buffer (Leammli buffer), there was SDS (detergent). Why was the SDS necessary for running the gel? 3. Why was it necessary for the transfer to the nitrocellulose membrane? 4. The first stage of western blotting involves separating proteins using gel electrophoresis. On what basis does this technique separate proteins? 5. How can you test the efficiency of transfer of the protein...
can
you please answer all
1. When you run a TLC of the reaction in ethyl acetate : hexanes 1:1, the plate below is produced. Give a solvent system that would be expected to produce greater separation and a BRIEF (8 words) justification about your choice. (5 points) 7 6 5 4 3 b. Calculate the R for the bottom spot. (5 points) c. Which compound on the TLC plate is the most polar? (5 points) 2. Why is it...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 29 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago