The products formed in transesterification are biodiesel molecules and glycerol. These products don’t mix with each...
The products formed in transesterification are biodiesel molecules and glycerol. These products don’t mix with each other. Using the concepts of polarity and intermolecular forces of attractions, explain why they don’t mix with each other.
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
The products formed in transesterification are biodiesel
molecules and glycerol. These products don’t mix with each...
1.) Look up the by-product of this reaction – glycerol – and determine whether this is...
1.) Look up the by-product of this reaction – glycerol – and determine whether this is a useful molecule: would it make sense to save and recycle this by-product? Explain. 2.) As mentioned above, soap molecules and biodiesel molecules have remarkably different properties. Describe the intermolecular forces that lead to these differences. (i.e., what intermolecular forces describe the behavior of soap molecules? What IMFs dictate the behavior of biodiesel molecules?) Be specific! 3.) You will be using corn oil for...
3. Draw the triacylglyceride formed from glycerol and three molecules of oleic acid. 4. The melting...
3. Draw the triacylglyceride formed from glycerol and three molecules of oleic acid. 4. The melting point of stearic acid is 70°C, and the melting point of oleic acid is 4°C. Explain in detail why their melting points are so different. 5. Describe the primary, secondary and tertiary levels of structure of a protein. Which one(s) is affected by denaturation? 6. Draw the dipeptide formed from glycine and alanine. 114
show me the work in a clear hand writing so i can understand please Intermolecular Forces...
show me the work in a clear hand writing so i can understand
please
Intermolecular Forces and Boiling Point (3 pts) Formaldehyde (CH2O) appeared in your exam. (a) Use Lewis structures to show a molecule of formaldehyde forming hydrogen bonding attractions with a molecule of water. CLEARLY identify the donor and acceptor in this drawing. (b) Referring to your drawing above, briefly explain why two formaldehyde molecules can't form hydrogen bonding attractions between each other. (c) Formaldehyde molecules are twice...
TILCIUILL Formaldehyde (CH2O) appeared in your exam. (a) Use Lewis structures to show a molecule of...
TILCIUILL Formaldehyde (CH2O) appeared in your exam. (a) Use Lewis structures to show a molecule of formaldehyde forming hydrogen bonding attractions with a molecule of water. CLEARLY identify the donor and acceptor in this drawing. (b) Referring to your drawing above, briefly explain why two formaldehyde molecules can't form hydrogen bonding attractions between each other. (©) Formaldehyde molecules are twice as massive than both ammonia (NH3) and water (H2O). And yet, formaldehyde has nearly the same boiling point as ammonia,...
1. Triacylglycerols, or triglycerides, are triesters formed from glycerol and three _____ molecules. 2. Triacylglycerols are...
1. Triacylglycerols, or triglycerides, are triesters formed from glycerol and three _____ molecules. 2. Triacylglycerols are stored in _____ cells below the skin and concentrated in some regions of the body. 3. The _____ is the aqueous medium inside the cell, separated from water outside the cell by the cell membrane. 4. Which statement is not true? a) Vitamin A is obtained from liver, oily fish, and dairy products. b) Vitamin E is an antioxidant, protecting unsaturated side chains in...
8. Spectator ions a remain as ions in the reaction and precipitate b. remain as molecules...
8. Spectator ions a remain as ions in the reaction and precipitate b. remain as molecules in the reactions and precipitate c. They form precipitate because they do not participate in the reaction d. None of the above 9. Polyprotic acids are a. Acids with more than one Hydrogen b. Acids that can form both hydrogen and Hydronium ions c. Acids that can act as acceptors as well as donors of Hydrogen d. Acids that have sweet taste 10. In...
Discussion Questions The structures of acetanilide and malonic acid are provided below 1. For each structure,...
Discussion Questions The structures of acetanilide and malonic acid are provided below 1. For each structure, draw circles around the polar and nonpolar regions of the molecule, and label each circled regiorn with the type of intermolecular attractive force it can use to interact with other molecules. Acetanilide Malonic Acid но CH2 OH 2. Now-thoroughly explain (on the basis of polarity/nonpolarity and intermolecular attractive forces) how the acetanilide was separated from the malonic acid by recrystallization from water. And explain...
with others? Oil and water don't mix Gasoline and water also do not mix. However, mbul...
with others? Oil and water don't mix Gasoline and water also do not mix. However, mbul p ciples of Solubility. Why do some substances mix gasoline and oil do mix. To understand solubility we must look at two important characteristics: geometry and bond polarity ionic, nonpolar and polar). From these two characteristics the overall molecular polarity can be determined. The statement "like dissolves like" provides a good basis for understanding solubility. A substance with similar characteristics will mix with another...
I. Nylon 6-6 is a condensation polymer. The last two lab handouts pointed out that "condensation...
I. Nylon 6-6 is a condensation polymer. The last two lab handouts pointed out that "condensation reactions are extremely common among a variety of organic functional groups." Pick two appropriate functional groups (your choice) and draw structures to show the condensation reaction between them. Identify the functional groups that are reacting, as well as the linkage formed by the condensation. 2. Rather than use a carboxylic acid for the nylon condensation, you'll use the more reactive acid chloride. This must...
*Explanations should be brief. Draw a box around each final answer, if applicable.* 1. Consider intermolecular...
*Explanations should be brief. Draw a box around each final answer, if applicable.* 1. Consider intermolecular forces and kinetic energies with respect to a solid and a liquid. Explain why molecules in a liquid are free to move past each other, while molecules in a solid are held in fixed positions. 2. Use your knowledge of intermolecular forces to provide an explanation for why the boiling point of 2-hexanol is higher than the boiling point of 2,3-dimethyl-2-butanol. Be sure to...
3. Draw the triacylglyceride formed from glycerol and three molecules of oleic acid. 4. The melting point of stearic acid is 70°C, and the melting point of oleic acid is 4°C. Explain in detail why their melting points are so different. 5. Describe the primary, secondary and tertiary levels of structure of a protein. Which one(s) is affected by denaturation? 6. Draw the dipeptide formed from glycine and alanine. 114
show me the work in a clear hand writing so i can understand
please
Intermolecular Forces and Boiling Point (3 pts) Formaldehyde (CH2O) appeared in your exam. (a) Use Lewis structures to show a molecule of formaldehyde forming hydrogen bonding attractions with a molecule of water. CLEARLY identify the donor and acceptor in this drawing. (b) Referring to your drawing above, briefly explain why two formaldehyde molecules can't form hydrogen bonding attractions between each other. (c) Formaldehyde molecules are twice...
TILCIUILL Formaldehyde (CH2O) appeared in your exam. (a) Use Lewis structures to show a molecule of formaldehyde forming hydrogen bonding attractions with a molecule of water. CLEARLY identify the donor and acceptor in this drawing. (b) Referring to your drawing above, briefly explain why two formaldehyde molecules can't form hydrogen bonding attractions between each other. (©) Formaldehyde molecules are twice as massive than both ammonia (NH3) and water (H2O). And yet, formaldehyde has nearly the same boiling point as ammonia,...
8. Spectator ions a remain as ions in the reaction and precipitate b. remain as molecules in the reactions and precipitate c. They form precipitate because they do not participate in the reaction d. None of the above 9. Polyprotic acids are a. Acids with more than one Hydrogen b. Acids that can form both hydrogen and Hydronium ions c. Acids that can act as acceptors as well as donors of Hydrogen d. Acids that have sweet taste 10. In...
Discussion Questions The structures of acetanilide and malonic acid are provided below 1. For each structure, draw circles around the polar and nonpolar regions of the molecule, and label each circled regiorn with the type of intermolecular attractive force it can use to interact with other molecules. Acetanilide Malonic Acid но CH2 OH 2. Now-thoroughly explain (on the basis of polarity/nonpolarity and intermolecular attractive forces) how the acetanilide was separated from the malonic acid by recrystallization from water. And explain...
with others? Oil and water don't mix Gasoline and water also do not mix. However, mbul p ciples of Solubility. Why do some substances mix gasoline and oil do mix. To understand solubility we must look at two important characteristics: geometry and bond polarity ionic, nonpolar and polar). From these two characteristics the overall molecular polarity can be determined. The statement "like dissolves like" provides a good basis for understanding solubility. A substance with similar characteristics will mix with another...
I. Nylon 6-6 is a condensation polymer. The last two lab handouts pointed out that "condensation reactions are extremely common among a variety of organic functional groups." Pick two appropriate functional groups (your choice) and draw structures to show the condensation reaction between them. Identify the functional groups that are reacting, as well as the linkage formed by the condensation. 2. Rather than use a carboxylic acid for the nylon condensation, you'll use the more reactive acid chloride. This must...
*Explanations should be brief. Draw a box around each final answer, if applicable.* 1. Consider intermolecular forces and kinetic energies with respect to a solid and a liquid. Explain why molecules in a liquid are free to move past each other, while molecules in a solid are held in fixed positions. 2. Use your knowledge of intermolecular forces to provide an explanation for why the boiling point of 2-hexanol is higher than the boiling point of 2,3-dimethyl-2-butanol. Be sure to...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 7 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 57 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago