derive the carry lookahead equations for the fast adder. please explain step by step
derive the carry lookahead equations for the fast adder.
please explain step by step
Homework Answers
Add Answer to:
derive the carry lookahead equations for the fast adder.
please explain step by step
3. Derive the carry input C5 for a 5-bit carry lookahead adder in terms of g,...
3. Derive the carry input C5 for a 5-bit carry lookahead adder in terms of g, p, G, and P. Assume that the numbers are represented as x4x3x2x1x0 and y4y3y2y1y0, and carry in as C0. Note: writing only the equation is not enough; you should show all the steps for obtaining such an equation
Derive the boolean expression for the output carry C4 for a 4-bit Carry Looka head Adder....
Derive the boolean expression for the output carry C4 for a 4-bit Carry Looka head Adder. Explain detail derivation steps. Add two numbers A=1110 and B=1011 with input carry C0 = 0 using Carry Lookahead Adder. Determine value of C4, C3, C2, C1 (use the expression derived in Q2) and S4, S3, S2, S1. Determine the overflow bit which is EXOR of carry going into MSB bit and carry coming from MSB bit i.e C4⊕C3.
What are the cost and delay for Stage 5 of a carry-lookahead adder? What is the...
What are the cost and delay for Stage 5 of a carry-lookahead adder? What is the total cost of an 8-bit carry-lookahead adder? (2.5 points) Implement the functionf(x1,x2,x3) = x2x3 + x1x3 + x1x2 using a 2:1 multiplexer and other logic gates (AND, OR, XOR, NOT). (2.5 points) Implement the function f(x1,x2,x3,x4) = Π M(0,1,4,5,7,10,11,14) using logic gates and a. an 8:1 multiplexer, with x1, x2 and x3 as select signals. b. a 4:1 multiplexer, with x3 and...
In the lookahead carry examples in the text, the span of the lookahead logic was 4 bits. Now assu...
In the lookahead carry examples in the text, the span of the
lookahead logic was 4 bits. Now assume that the span of the
lookahead logic increases to 6 bits. Show the block diagram for a
32-bit adder similar to figure 9.5 in the text and compute what the
total gate delay is to c32 and s31 .
7-4 7-4 13-0 3-0 15-12 15-12 11-8 y11-8 C12 C8 C0 4-bit adder 4-bit adder 4-bit adder 4-bit adder C16 S11-8 S7-4...
1. The following parts are about a 4-bit carry-lookahead adder (CLA) (3 points) Write the expanded...
1. The following parts are about a 4-bit carry-lookahead adder (CLA) (3 points) Write the expanded equations for os and cs of a 4-bit carry- lookahead adder, given Co, X3:0, and узо (make sure you know what"хзо" means). Write the generic forms of p, and g a. X3 : 0 (3 points) Calculate the hardware cost of just Stage 2? Include the cost for sa. (Remember the cost of a 3-input XOR?) b. (3 points) Determine the critical path (longest...
For a carry-lookahead adder (stage index starts from 0, i.e., Stage 0) , give the equation...
For a carry-lookahead adder (stage index starts from 0, i.e., Stage 0) , give the equation for c1 in terms of g's, p's, and c0
2. Consider two adders: a 64-bit ripple-carry adder and a 64-bit carry-lookahead adder with 4-bit blocks....
2. Consider two adders: a 64-bit ripple-carry adder and a 64-bit carry-lookahead adder with 4-bit blocks. These adders are built using only two-input gates. Each two-input gate has an area of 15 um', has a 50 ps delay, and has 20 ff of total gate capacitance. You may assume that the static power is negligible. (a) Determine the area, delay, and power of the adders (operating at 100 MHz and 1.2 V). (b) Draw a table containing the area, delay...
Please answer all 4 questions for a thumbs up! thank you Create a Hierarchical Carry-Lookahead Adder...
Please answer all 4 questions for a thumbs up! thank you Create a Hierarchical Carry-Lookahead Adder which can handle 16-bit numbers and is split into four segments 1.How many bits will each segment handle? 2.What is the equation for c16 in terms of G3, P3, and c12? 3.In terms of G3, G2, G1, G0, P3, P2, P1, P0, and c0? 4.What is the equation for G2 in terms of g11, g10, g9, g8, p11, p10, and p9?
Please I will literally take any help! I'm out of time!!! Literally had to repost this...
Please I will literally take any help! I'm out of time!!!
Literally had to repost this several times. I will rate super
fast!
1.1 Let's compare the performance of “ripple carry adder" and "carry lookahead adder". Assume that hardware corresponding to any Boolean equation containing only OR or AND terms, such as F = A. B or F = A + B, takes one time unit T. Equations that consist of the OR of several AND terms, e.g. F =...
Problem 2. Ripple Carry and Carry Look-ahead Adders For the binary adding circuit that adds n-bit...
Problem 2. Ripple Carry and Carry Look-ahead Adders For the binary adding circuit that adds n-bit inputs x and y, the following equation gives ci+1 (the carry out bit from the i" position) in terms of the inputs for the ih bit sum x, yi, and ci (the carry-in bit): Letting gi xiyi and pi = xi+yi, this can be expressed as: ci+1 = gi+piCi a) In a ripple carry adder structure, the carry bits are computed sequentially. That is,...
In the lookahead carry examples in the text, the span of the
lookahead logic was 4 bits. Now assume that the span of the
lookahead logic increases to 6 bits. Show the block diagram for a
32-bit adder similar to figure 9.5 in the text and compute what the
total gate delay is to c32 and s31 .
7-4 7-4 13-0 3-0 15-12 15-12 11-8 y11-8 C12 C8 C0 4-bit adder 4-bit adder 4-bit adder 4-bit adder C16 S11-8 S7-4...
1. The following parts are about a 4-bit carry-lookahead adder (CLA) (3 points) Write the expanded equations for os and cs of a 4-bit carry- lookahead adder, given Co, X3:0, and узо (make sure you know what"хзо" means). Write the generic forms of p, and g a. X3 : 0 (3 points) Calculate the hardware cost of just Stage 2? Include the cost for sa. (Remember the cost of a 3-input XOR?) b. (3 points) Determine the critical path (longest...
2. Consider two adders: a 64-bit ripple-carry adder and a 64-bit carry-lookahead adder with 4-bit blocks. These adders are built using only two-input gates. Each two-input gate has an area of 15 um', has a 50 ps delay, and has 20 ff of total gate capacitance. You may assume that the static power is negligible. (a) Determine the area, delay, and power of the adders (operating at 100 MHz and 1.2 V). (b) Draw a table containing the area, delay...
Please I will literally take any help! I'm out of time!!!
Literally had to repost this several times. I will rate super
fast!
1.1 Let's compare the performance of “ripple carry adder" and "carry lookahead adder". Assume that hardware corresponding to any Boolean equation containing only OR or AND terms, such as F = A. B or F = A + B, takes one time unit T. Equations that consist of the OR of several AND terms, e.g. F =...
Problem 2. Ripple Carry and Carry Look-ahead Adders For the binary adding circuit that adds n-bit inputs x and y, the following equation gives ci+1 (the carry out bit from the i" position) in terms of the inputs for the ih bit sum x, yi, and ci (the carry-in bit): Letting gi xiyi and pi = xi+yi, this can be expressed as: ci+1 = gi+piCi a) In a ripple carry adder structure, the carry bits are computed sequentially. That is,...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago