Select the statement(s) that explain(s) the relationship between the arrangement of elements by size and first...
Select the statement(s) that explain(s) the relationship between the arrangement of elements by size and first ionization energy.
a. The two arrangements are the same because IE of elements increases from left to right and the radii of elements decreases from left to right.
b. The first set of paired electrons in a p subshell experience a large amount of electron-electron repulsion, making the fourth electron in a p subshell easy to remove.
c. A full s subshell is able to shield a newly filled p subshell from the nucleus, making the first electron in a p subshell easy to remove.
d. The third unpaired electron in a p subshell causes a lot of electron-electron repulsion among the orbitals, making the third electron in a p subshell easy to remove.
e. A p subshell with only one unpaired electron is extremely stable, making the fifth electron in a p subshell easy to remove.
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Select the statement(s) that explain(s) the relationship between
the arrangement of elements by size and first...
Match the words in the left column to the appropriate blanks in the sentences on the...
Match the words in the left column to the appropriate blanks in the sentences on the right. zero The third ionization energy of manganese is greater than that of both chromium and iron This is best explained by noting that Mn2+ has paired electrons in its 3d orbitals, while Cr2+ has of paired electrons in its 3d orbitals and Fe2+ has of paired electrons in its 3d orbitals. Therefore, the larger Z value of Mn explains why it has a...
The first ionzation energy generally increases from left to right across a period. However, there are...
The first ionzation energy generally increases from left to right across a period. However, there are some exceptions to this trend. For example, boron has a smaller ionization energy than beryllium even though it lies to the right of it in the same period Select the statement that explains this exception to the trend in ionization energy. The 2p electron in boron experience a greater effective nuclear charge than the 2s electrons in beryllium, meaning it is easier to remove...
Ionization energy (Ei) is the amount of energy required to remove an electron from a neutral...
Ionization energy (Ei) is the amount of energy required to remove an electron from a neutral gaseous atom or gaseous ion. Electrons are attracted to the positively charged nucleus; therefore removing an electron requires energy. The process is endothermic, and so ionization energies have a positive value. The first ionization energy (Ei1) is the energy associated with the removal of an electron from the neutral gaseous atom. The reaction is represented for the generalized atom X as X→X++e− The amount...
7.90 Rank the following elements in order of increasing ionization energy: Mg, P. O. 7.91 Use...
7.90 Rank the following elements in order of increasing ionization energy: Mg, P. O. 7.91 Use electron configurations to explain why more energy is required to remove an electron from a lithium atom than from a sodium atom. 7.93 Use electron configurations to explain why the ionization energy for fluorine is greater than that for oxygen. 7.95 Write balanced equations that represent the processes that correspond to the first and second ionization energies for magnesium. 7.96 Which ionization energy (IE....
8. Select the true statement. a. Atomic radius increases going from left to right across a...
8. Select the true statement. a. Atomic radius increases going from left to right across a period. b. The p electrons in fluorine are more poorly shielded from the nuclear charge than the p electrons in carbon. c. Cations are larger than their corresponding neutral atoms. d. Anions are smaller than their corresponding neutral atoms. e. Ionic radius generally decreases down a group. 9. (ACS question) Which of these elements has the highest first ionization energy? a. Ne b. F...
Please read the article and answer about questions. You and the Law Business and law are...
Please read the article and answer about questions. You and the Law Business and law are inseparable. For B-Money, the two predictably merged when he was negotiat- ing a deal for his tracks. At other times, the merger is unpredictable, like when your business faces an unexpected auto accident, product recall, or government regulation change. In either type of situation, when business owners know the law, they can better protect themselves and sometimes even avoid the problems completely. This chapter...
Discussion questions 1. What is the link between internal marketing and service quality in the ai...
Discussion questions
1. What is the link between internal marketing and service
quality in the airline industry?
2. What internal marketing programmes could British Airways
put into place to avoid further internal unrest? What potential is
there to extend auch programmes to external partners?
3. What challenges may BA face in implementing an internal
marketing programme to deliver value to its customers?
(1981)ǐn the context ofbank marketing ths theme has bon pururd by other, nashri oriented towards the identification of...
Using the book, write another paragraph or two: write 170 words: Q: Compare the assumptions of...
Using the book, write another paragraph or two: write 170
words:
Q: Compare the assumptions of physician-centered and
collaborative communication. How is the caregiver’s role different
in each model? How is the patient’s role different?
Answer: Physical-centered communication involves the specialists
taking control of the conversation. They decide on the topics of
discussion and when to end the process. The patient responds to the
issues raised by the caregiver and acts accordingly. On the other
hand, Collaborative communication involves a...
CASE 20 Enron: Not Accounting for the Future* INTRODUCTION Once upon a time, there was a...
CASE 20 Enron: Not Accounting for the Future* INTRODUCTION Once upon a time, there was a gleaming office tower in Houston, Texas. In front of that gleaming tower was a giant "E" slowly revolving, flashing in the hot Texas sun. But in 2001, the Enron Corporation, which once ranked among the top Fortune 500 companies, would collapse under a mountain of debt that had been concealed through a complex scheme of off-balance-sheet partnerships. Forced to declare bankruptcy, the energy firm...
Case: Enron: Questionable Accounting Leads to CollapseIntroductionOnce upon a time, there was a gleaming...
Case: Enron: Questionable Accounting Leads to CollapseIntroductionOnce upon a time, there was a gleaming office tower in Houston, Texas. In front of that gleaming tower was a giant “E,” slowly revolving, flashing in the hot Texas sun. But in 2001, the Enron Corporation, which once ranked among the top Fortune 500 companies, would collapse under a mountain of debt that had been concealed through a complex scheme of off-balance-sheet partnerships. Forced to declare bankruptcy, the energy firm laid off 4,000...
Match the words in the left column to the appropriate blanks in the sentences on the right. zero The third ionization energy of manganese is greater than that of both chromium and iron This is best explained by noting that Mn2+ has paired electrons in its 3d orbitals, while Cr2+ has of paired electrons in its 3d orbitals and Fe2+ has of paired electrons in its 3d orbitals. Therefore, the larger Z value of Mn explains why it has a...
The first ionzation energy generally increases from left to right across a period. However, there are some exceptions to this trend. For example, boron has a smaller ionization energy than beryllium even though it lies to the right of it in the same period Select the statement that explains this exception to the trend in ionization energy. The 2p electron in boron experience a greater effective nuclear charge than the 2s electrons in beryllium, meaning it is easier to remove...
7.90 Rank the following elements in order of increasing ionization energy: Mg, P. O. 7.91 Use electron configurations to explain why more energy is required to remove an electron from a lithium atom than from a sodium atom. 7.93 Use electron configurations to explain why the ionization energy for fluorine is greater than that for oxygen. 7.95 Write balanced equations that represent the processes that correspond to the first and second ionization energies for magnesium. 7.96 Which ionization energy (IE....
8. Select the true statement. a. Atomic radius increases going from left to right across a period. b. The p electrons in fluorine are more poorly shielded from the nuclear charge than the p electrons in carbon. c. Cations are larger than their corresponding neutral atoms. d. Anions are smaller than their corresponding neutral atoms. e. Ionic radius generally decreases down a group. 9. (ACS question) Which of these elements has the highest first ionization energy? a. Ne b. F...
Discussion questions
1. What is the link between internal marketing and service
quality in the airline industry?
2. What internal marketing programmes could British Airways
put into place to avoid further internal unrest? What potential is
there to extend auch programmes to external partners?
3. What challenges may BA face in implementing an internal
marketing programme to deliver value to its customers?
(1981)ǐn the context ofbank marketing ths theme has bon pururd by other, nashri oriented towards the identification of...
Using the book, write another paragraph or two: write 170
words:
Q: Compare the assumptions of physician-centered and
collaborative communication. How is the caregiver’s role different
in each model? How is the patient’s role different?
Answer: Physical-centered communication involves the specialists
taking control of the conversation. They decide on the topics of
discussion and when to end the process. The patient responds to the
issues raised by the caregiver and acts accordingly. On the other
hand, Collaborative communication involves a...
CASE 20 Enron: Not Accounting for the Future* INTRODUCTION Once upon a time, there was a gleaming office tower in Houston, Texas. In front of that gleaming tower was a giant "E" slowly revolving, flashing in the hot Texas sun. But in 2001, the Enron Corporation, which once ranked among the top Fortune 500 companies, would collapse under a mountain of debt that had been concealed through a complex scheme of off-balance-sheet partnerships. Forced to declare bankruptcy, the energy firm...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 3 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 52 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago