Which is an example of a secondary metabolite? a. Substances that kill fungi that a bacterium...
Which is an example of a secondary metabolite?
a. Substances that kill fungi that a bacterium produces when in the presence of a fungus
b. The enzyme, TPI, which has a role in glycolysis
c. ATP
d.Glucose
e.Collagen used in connective tissue
Homework Answers
Option A
A secondary metabolite is a molecule which does not have a direct role in metabolism of the organism. Instead it confers certain unique advantages to the organism and is the byproduct of primary metabolic activities.
Substances that kill fungus and are produced by bacteria are non nutritive Chemicals and are generally product of primary metabolism in bacteria. Bacteria can survive even if this substance is not produced.
Second option is not a secondary metabolism because it is talking about an enzyme which is involved in glycolysis. Glycolysis is a primary metabolic process in all the organisms because without glycolysis there would be no cellular respiration.
ATP is also a primary metabolite because it is involved in providing energy to the cell to perform its metabolic activities.
Glucose is a primary metabolite because it is the energy fuel for all the cells. Without glucose, the cell would not be able to get energy by undertaking cellular respiration and also polysaccharides like cellulose, stars, glycogen and disaccharides like sucrose and lactose will not be synthesized.
Collagen is a protein which is involved in the formation of bones in human beings. It is also not a secondary metabolite. It has a direct role in the calcium metabolism of human beings.
Please rate.
Add Answer to:
Which is an example of a secondary metabolite?
a. Substances that kill fungi that a bacterium...
no explaination is needed 28) Which of the following is true for all exergonic reactions? A)...
no explaination is needed
28) Which of the following is true for all exergonic reactions? A) The reaction proceeds with a net release of free energy B) The products have more total energy than the reactants. C) A net input of energy from the surroundings is required for the reactions to proceed. D) The reactions are nonspontaneous 29) When ATP releases some energy, it also releases Inorganic phosphate. What purpose does this serve (if any) in the cell? A) It...
Can someone please help with questions ii-vi? 6. Many types of cancerous tumors have cells with...
Can someone please help with questions ii-vi?
6. Many types of cancerous tumors have cells with a high dependence on glycolysis for generating the ATP needed for growth. Even in the presence of oxygen, these cells use glycolysis and lactate fermentation as their main source of ATP. i.) Give a balanced reaction for the reaction catalyzed by the enzyme lactate dehydrogenase (LDH). Give the structures of pyruvate and lactate, and add the names of any additional reactants or products needed...
(13 points) A. Below is data collected for the reaction when metabolite Y is synthesized from...
(13 points) A. Below is data collected for the reaction when metabolite Y is synthesized from metabolite X under two different conditions Plot the data na single graph and label all axes. (pts) Condition 1 reaction progress (beginning to end) free energy Condition 2 reaction progress (beginning to end) free energy 1 3 8.25 8.5 .75 4 8 6 8.25 9 3 10 4 10.5 5 6 8.25 7 4 8 1.5 91 10 1 8 1.5 91 10 11...
17. At temperatures higher than the maximum growth temperature for an organism, A proteins are permanently...
17. At temperatures higher than the maximum growth temperature for an organism, A proteins are permanently denatured B membranes become too fuld for proper function Chydrogen bonds within molecules are broken DA and B E. A B and C 18 Some obligately anaerobic archaea are used in sewage treatment, and produce a fuel that can be used to produce electricity A thermophilic B. halophilic C. barophilic D. methanogenic E. psychrophilic 19. You open a jar that has been in the...
2. How is ATP used in most cell processes? a. It binds to a substrate and...
2. How is ATP used in most cell processes? a. It binds to a substrate and provides energy when the phosphate group is released. b. indirectly, by providing electrons to an acceptor c. Hydrolysis of ATP is coupled to an endergonic reaction. d. It increases the efficiency of some key enzymes. e. none of the above 2. How is ATP used in most cell processes? a. It binds to a substrate and provides energy when the phosphate group is released....
Which of the following is not an example of an evolutionary arms race? A. Herbivores evolve...
Which of the following is not an example of an evolutionary arms race? A. Herbivores evolve tolerance to increasingly toxic secondary metabolites produced by plants B. Lead morphology within a species of plant becomes more efficient at gathering light over time C. Phytolith abundance within plant tissue increases over evolutionary time as the thickness of herbivore tooth enamel becomes thicker D. Cactuses on the Galapagos Islands become taller and more tree like in the presence of giant tortoises
Which of the diagrams illustrates the way in which the rate of an enzyme-controlled reaction depends...
Which of the diagrams illustrates the way in which the rate of an enzyme-controlled reaction depends on substrate concentration? * А B Rate of reaction MÚN Substrate concentration A B D When starch and amylase are mixed in the presence of iodine solution, the blue-black colour rapidly disappears. This is due to the formation of which molecule? * glucose O glycogen sucrose O maltose Which of the following enzyme groups can catalyse oxidation reactions? * O phosphorylases isomerases hydrolases dehydrogenases...
Please answer all!! Thank you :) 6.) To establish a link between a specie bacterium is...
Please answer all!! Thank you :)
6.) To establish a link between a specie bacterium is present in affected individuals researchers need to perform to be absolutels 1. Isolate the bacterium in a pure cu also show similar symptoms. 2. Demonstrate that the bacterium is 3. Isolate the bacterium from an inte one that initially caused the infection 4. Infect another human patient to se A) I and 2 B) 1 and 3 um and intestinal disease, researchers have shown...
1. which is not a factor affecting membrane transport of a molecule? a. molecular size b....
1. which is not a factor affecting membrane transport of a molecule? a. molecular size b. lipid solubility c. its role in homeostasis d. concentration of the molecule 2. True or false: In allosteric enzyme inhibition, the active site is blocked by another molecule 3. Thyroxine (t4) is synthesized from the amino acid called tyrosine, therefore it belongs to the category of hormones called_____. however, since t4 is a ______ hormone, it utilizes an itracellular receptor mechanism. a. steroids; lipid-soluble...
QUESTION 1 Which of the following options lists the stages in cellular respiration in the correct...
QUESTION 1 Which of the following options lists the stages in cellular respiration in the correct order? A. glycolysis, oxidative phosphorylation, pyruvate oxidation, and the citric acid cycle B glycolysis, pyruvate oxidation, the citric acid cycle, and oxidative phosphorylation C. pyruvate oxidation, oxidative phosphorylation, glycolysis, and the citric acid cycle D. the citric acid cycle, oxidative phosphorylation, pyruvate oxidation, and glycolysis QUESTION 2 When a glucose molecule loses a hydrogen atom as the result of an oxidation-reduction reaction, the glucose...
no explaination is needed
28) Which of the following is true for all exergonic reactions? A) The reaction proceeds with a net release of free energy B) The products have more total energy than the reactants. C) A net input of energy from the surroundings is required for the reactions to proceed. D) The reactions are nonspontaneous 29) When ATP releases some energy, it also releases Inorganic phosphate. What purpose does this serve (if any) in the cell? A) It...
Can someone please help with questions ii-vi?
6. Many types of cancerous tumors have cells with a high dependence on glycolysis for generating the ATP needed for growth. Even in the presence of oxygen, these cells use glycolysis and lactate fermentation as their main source of ATP. i.) Give a balanced reaction for the reaction catalyzed by the enzyme lactate dehydrogenase (LDH). Give the structures of pyruvate and lactate, and add the names of any additional reactants or products needed...
(13 points) A. Below is data collected for the reaction when metabolite Y is synthesized from metabolite X under two different conditions Plot the data na single graph and label all axes. (pts) Condition 1 reaction progress (beginning to end) free energy Condition 2 reaction progress (beginning to end) free energy 1 3 8.25 8.5 .75 4 8 6 8.25 9 3 10 4 10.5 5 6 8.25 7 4 8 1.5 91 10 1 8 1.5 91 10 11...
17. At temperatures higher than the maximum growth temperature for an organism, A proteins are permanently denatured B membranes become too fuld for proper function Chydrogen bonds within molecules are broken DA and B E. A B and C 18 Some obligately anaerobic archaea are used in sewage treatment, and produce a fuel that can be used to produce electricity A thermophilic B. halophilic C. barophilic D. methanogenic E. psychrophilic 19. You open a jar that has been in the...
Which of the diagrams illustrates the way in which the rate of an enzyme-controlled reaction depends on substrate concentration? * А B Rate of reaction MÚN Substrate concentration A B D When starch and amylase are mixed in the presence of iodine solution, the blue-black colour rapidly disappears. This is due to the formation of which molecule? * glucose O glycogen sucrose O maltose Which of the following enzyme groups can catalyse oxidation reactions? * O phosphorylases isomerases hydrolases dehydrogenases...
Please answer all!! Thank you :)
6.) To establish a link between a specie bacterium is present in affected individuals researchers need to perform to be absolutels 1. Isolate the bacterium in a pure cu also show similar symptoms. 2. Demonstrate that the bacterium is 3. Isolate the bacterium from an inte one that initially caused the infection 4. Infect another human patient to se A) I and 2 B) 1 and 3 um and intestinal disease, researchers have shown...
QUESTION 1 Which of the following options lists the stages in cellular respiration in the correct order? A. glycolysis, oxidative phosphorylation, pyruvate oxidation, and the citric acid cycle B glycolysis, pyruvate oxidation, the citric acid cycle, and oxidative phosphorylation C. pyruvate oxidation, oxidative phosphorylation, glycolysis, and the citric acid cycle D. the citric acid cycle, oxidative phosphorylation, pyruvate oxidation, and glycolysis QUESTION 2 When a glucose molecule loses a hydrogen atom as the result of an oxidation-reduction reaction, the glucose...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 29 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago