2Au + Fe(NO3)2 = 2AuNO3 +Fe What would this reaction be considered? I assume Single Replacement,...
2Au + Fe(NO3)2 = 2AuNO3 +Fe
What would this reaction be considered? I assume Single Replacement, but with the reactivity series, the gold is not as reactive and the zinc, so would any reaction occur at all? Also, is there any difference in a single replacement reaction and a REDOX reaction?
Homework Answers
You are right. This reaction won't happen. Fe has higher reduction potential than Au. So, Au can't replace Fe.
Say hypothetically that this reaction happens, then Au is getting oxidised and Fe is getting reduced. So, it's a Redox reaction. As Au replaces Fe from the salt, so it's also a single replacement reaction
The difference between Redox and single replacement reaction is-
Every single replacement reaction is necessarily a Redox reaction.
But not every Redox reaction is a single replacement reaction.
Consider the following reaction
2Mg + O2 ----------> 2MgO
This is a Redox reaction but not a single replacement reaction.
Comment if any problem
Add Answer to:
2Au + Fe(NO3)2 = 2AuNO3 +Fe
What would this reaction be considered? I assume Single
Replacement,...
Set Double Replacement Reaction Will precipitate form? Observations Prediction Correct? 1 2 Ni(NO3)2 + NaOH Ni(NO)...
Set Double Replacement Reaction Will precipitate form? Observations Prediction Correct? 1 2 Ni(NO3)2 + NaOH Ni(NO) + NaCl Ni(NO3)2 + Na PO, Ni(NO), + Na.co Ni(NO) + Na SO Fe(NO3)2 + NaOH Fe(NO) Naci Fe(NO.), + Na,PO Fe(NO) + Na.co Fe(NO) Na SO Cu(NO), NaOH Cu(NO3)2 + Cu(NO) Na PO, Cu(NO)2 + Na.co, Cu(NO) Na,so Nac! Set Double Replacement Reaction Will precipitate form? Observations Prediction Correct? 4 5 + + Co(NO3)2 + NaOH Co(NO3)2 + Naci CO(NO)2 + Na PO,...
2. Complete and balance this single replacement reaction (assume Zn goes to Zn") Zn + H2SO4...
2. Complete and balance this single replacement reaction (assume Zn goes to Zn") Zn + H2SO4 → 3. Complete and balance this decomposition reaction: HgO → 4. Name three ways you can verify that a chemical reaction has taken place. 5. Balance the following equation: _ Fe(s) + _ _O2(g) → __ _ Fe2O3(s)
FOR OUESTIONS 25- 34. For all single replacement reactions below predict whether or not the reaction...
FOR OUESTIONS 25- 34. For all single replacement reactions below predict whether or not the reaction will occur using your activity series of metals. For all double replacement reactions predict the products and predict solubility for the reactants and products. Then, balance all reactions that occur. 25. Zn + Cuso, AB Yes, a reaction will occur. 26. KOH + H,SO, K_250_4+H_20. 2KOH + H_250_4-K_250_4-2H_20 27. Nal + B, AB No reaction 28. Bry + NaCl AB Yes, a reaction will...
i think i understand how to get the molecular equation and also the net ionic equation...
i
think i understand how to get the molecular equation and also the
net ionic equation maybe, but i dont know how to get the total
ionic equation. thanks so much!
total for each single replacement reaction that did occur. If the metal was not oxidized, indicate that by a molecular equation like Equation (7) in the DISCUSSION section and skip writing the ionic equations 1. Magnesium mactal: zinc sulfate solution (a) Molecular equation: (b) Total ionic equation: (c) Net...
13. b) Suppose only 4.02 grams of Fe(NO3), are recovered in the above reaction. What is...
13. b) Suppose only 4.02 grams of Fe(NO3), are recovered in the above reaction. What is the percent yield of Fe(NO), will form? 14. For the equation Pb(NO3)2 +K SO, à 2KNO, + PbSO, 22.9 grams of Pb(NO), is reached with an excess of K, SO, and 2.41 grams of KNO, are recovered. What is the percent yield? 15. Let's say the reaction H,SO, + 2 KOH à K.SO. + 2H,0, is known to proceed by a 20.85% yield via...
Are mr observations correct ? Im not sure about Fe + CuCl2 ? I thought there...
Are mr observations correct ? Im not sure about Fe + CuCl2 ? I
thought there would be a reaction sin Fe is more active then
Cu
appearance of 0.5M FOSQ: Felly description of reaction mixture 5 min after mixing with 0.5M Fasen FeCl3 metal did reaction occur? (Y or N.R.) ZO A] yes. hanter 11: Observing Single Replacement Reactions Bubbles, gas, slight colorChansa Cu lorcactost same color, sore shope appearance of 0.5M CUDO, CUC2 description of reaction mixture 5...
Question 1 (1 point) What is the classification for this unbalanced reaction? 2 Fe + 6...
Question 1 (1 point) What is the classification for this unbalanced reaction? 2 Fe + 6 HCI - 2 FeCl3 + 3 H2 single replacement decomposition double replacement combustion combination
how to balance redox reaction equation i need to know what the oxidizibg agent and reducing...
how
to balance redox reaction equation
i
need to know what the oxidizibg agent and reducing agent are for
these
Reactants Products Observations Fe sou Mg So, e CuSO4 Zn FeSO4 | ZnSO4 | Zn soy No reaction Slow Bubbles light yellow I color charge (c | Fizzing No reaction 114 504 MgSO4 it sou Fe Feso 4 Hb so Fizzing Zn soy No reaction Fizzing Ibubbi No reaction ZnSO4 Mg Sot O Naso Cu Na Sou Mg uso4 Fe...
For each reaction write a balanced chemical equation and then below the chemical formula of each...
For each reaction write a balanced chemical equation and then below the chemical formula of each reactant and product write a brief description of the substance (color and cal state). Also, indicate whether the reaction is exothermic, endothermic, or cannot tell. 3. Single Replacement Reaction Equation: Cu + 2AgNO3 + 2Ag + Cu(NO3)2 Cannot tell Exothermic Endothermic Evidence of Chemical Change: 4. Double Displacement Reaction-Milk from water: Equation: CaCl2 + Na2CO3 → CaCO3 + 2NaCi Endothermic Cannot tell Exothermic Evidence...
2. Complete and balance this single replacement reaction (assume Zn goes to Zn) Zn+H2SO4 3. Complete and bal...
2. Complete and balance this single replacement reaction (assume Zn goes to Zn) Zn+H2SO4 3. Complete and balance this decomposition reaction: HgO 4. Name three ways you can verify that a chemical reaction has taken place. 5. Balance the following equation: Fe2O3(s) O2(g) Fe(s)+ 090ewContent40616590/View 1) At 25 C, a sample of gas occupies 2.50 L of volume. What temperature would be required to triple the volume? 2) If a 8.0 L. container of oxygen gas has a pressure of...
Set Double Replacement Reaction Will precipitate form? Observations Prediction Correct? 1 2 Ni(NO3)2 + NaOH Ni(NO) + NaCl Ni(NO3)2 + Na PO, Ni(NO), + Na.co Ni(NO) + Na SO Fe(NO3)2 + NaOH Fe(NO) Naci Fe(NO.), + Na,PO Fe(NO) + Na.co Fe(NO) Na SO Cu(NO), NaOH Cu(NO3)2 + Cu(NO) Na PO, Cu(NO)2 + Na.co, Cu(NO) Na,so Nac! Set Double Replacement Reaction Will precipitate form? Observations Prediction Correct? 4 5 + + Co(NO3)2 + NaOH Co(NO3)2 + Naci CO(NO)2 + Na PO,...
2. Complete and balance this single replacement reaction (assume Zn goes to Zn") Zn + H2SO4 → 3. Complete and balance this decomposition reaction: HgO → 4. Name three ways you can verify that a chemical reaction has taken place. 5. Balance the following equation: _ Fe(s) + _ _O2(g) → __ _ Fe2O3(s)
FOR OUESTIONS 25- 34. For all single replacement reactions below predict whether or not the reaction will occur using your activity series of metals. For all double replacement reactions predict the products and predict solubility for the reactants and products. Then, balance all reactions that occur. 25. Zn + Cuso, AB Yes, a reaction will occur. 26. KOH + H,SO, K_250_4+H_20. 2KOH + H_250_4-K_250_4-2H_20 27. Nal + B, AB No reaction 28. Bry + NaCl AB Yes, a reaction will...
i
think i understand how to get the molecular equation and also the
net ionic equation maybe, but i dont know how to get the total
ionic equation. thanks so much!
total for each single replacement reaction that did occur. If the metal was not oxidized, indicate that by a molecular equation like Equation (7) in the DISCUSSION section and skip writing the ionic equations 1. Magnesium mactal: zinc sulfate solution (a) Molecular equation: (b) Total ionic equation: (c) Net...
13. b) Suppose only 4.02 grams of Fe(NO3), are recovered in the above reaction. What is the percent yield of Fe(NO), will form? 14. For the equation Pb(NO3)2 +K SO, à 2KNO, + PbSO, 22.9 grams of Pb(NO), is reached with an excess of K, SO, and 2.41 grams of KNO, are recovered. What is the percent yield? 15. Let's say the reaction H,SO, + 2 KOH à K.SO. + 2H,0, is known to proceed by a 20.85% yield via...
Are mr observations correct ? Im not sure about Fe + CuCl2 ? I
thought there would be a reaction sin Fe is more active then
Cu
appearance of 0.5M FOSQ: Felly description of reaction mixture 5 min after mixing with 0.5M Fasen FeCl3 metal did reaction occur? (Y or N.R.) ZO A] yes. hanter 11: Observing Single Replacement Reactions Bubbles, gas, slight colorChansa Cu lorcactost same color, sore shope appearance of 0.5M CUDO, CUC2 description of reaction mixture 5...
Question 1 (1 point) What is the classification for this unbalanced reaction? 2 Fe + 6 HCI - 2 FeCl3 + 3 H2 single replacement decomposition double replacement combustion combination
how
to balance redox reaction equation
i
need to know what the oxidizibg agent and reducing agent are for
these
Reactants Products Observations Fe sou Mg So, e CuSO4 Zn FeSO4 | ZnSO4 | Zn soy No reaction Slow Bubbles light yellow I color charge (c | Fizzing No reaction 114 504 MgSO4 it sou Fe Feso 4 Hb so Fizzing Zn soy No reaction Fizzing Ibubbi No reaction ZnSO4 Mg Sot O Naso Cu Na Sou Mg uso4 Fe...
For each reaction write a balanced chemical equation and then below the chemical formula of each reactant and product write a brief description of the substance (color and cal state). Also, indicate whether the reaction is exothermic, endothermic, or cannot tell. 3. Single Replacement Reaction Equation: Cu + 2AgNO3 + 2Ag + Cu(NO3)2 Cannot tell Exothermic Endothermic Evidence of Chemical Change: 4. Double Displacement Reaction-Milk from water: Equation: CaCl2 + Na2CO3 → CaCO3 + 2NaCi Endothermic Cannot tell Exothermic Evidence...
2. Complete and balance this single replacement reaction (assume Zn goes to Zn) Zn+H2SO4 3. Complete and balance this decomposition reaction: HgO 4. Name three ways you can verify that a chemical reaction has taken place. 5. Balance the following equation: Fe2O3(s) O2(g) Fe(s)+ 090ewContent40616590/View 1) At 25 C, a sample of gas occupies 2.50 L of volume. What temperature would be required to triple the volume? 2) If a 8.0 L. container of oxygen gas has a pressure of...
Most questions answered within 3 hours.
-
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 14 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 15 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 29 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago