1. What is the mass of 0.78 × 1022 Mg-atoms in grams? A. 2.36 × 10-5...
1. What is the mass of 0.78 × 1022 Mg-atoms in grams?
| A. |
2.36 × 10-5 |
|
| B. |
7.1 |
|
| C. |
0.315 |
|
| D. |
5.35 × 10-4 |
|
| E. |
None of these choices is correct |
2.
Which of the following is a molecular compound?
| A. |
Sodium nitride |
|
| B. |
Calcium oxide |
|
| C. |
Carbon dioxide |
|
| D. |
None of these choices is correct |
|
| E. |
Barium hydroxide |
Homework Answers
6.022 * 1023 (Avogadro) number of magnesium atoms have a mass of 24.31 gm
So 0.78 * 1022 number of molecules of magnesium have the mass of (0.78 * 1023 * 24.31)/(6.022 * 1023)
= 0.315 gm ( option C is correct)
Only carbon dioxide forms molecular compound as it has carbon-oxygen (double) bond .
In other cases they have only ionic solids, so they do not form molecules. (option C is correct)
Add Answer to:
1. What is the mass of 0.78 × 1022 Mg-atoms in grams?
A.
2.36 × 10-5...
* 10 What is the mass in grams of a sample of Mg(CIO3)2 that contains 6.0 x 1020 atoms of oxygen? (A) 31717. grams...
* 10 What is the mass in grams of a sample of Mg(CIO3)2 that contains 6.0 x 1020 atoms of oxygen? (A) 31717. grams (B) 3. 1529 x 1047 grams (C) 1. 1502 grams (D) 31. 299 grams 11 Name the compound Pb(NO3)4. (A) lead (II) nitrite (B) lead (II) nitrate (C) lead (IV) nitrate (D) lead (III) nitride 12 What is the mass % of carbon in (C2H SO)? (A) 7.74% (B) 60.0 % (C) 20.6% (D) 30.7% (E)...
1. What is the mass of 1.55x1024 atoms of calcium? grams 2. How many calcium atoms...
1. What is the mass of 1.55x1024 atoms of calcium? grams 2. How many calcium atoms are there in 33.4 grams of calcium? atoms 1. How many MOLECULES of nitrogen dioxide are present in 1.57 grams of this compound? molecules. 2. How many GRAMS of nitrogen dioxide are present in 2.77x1022 molecules of this compound? grams. 1. How many GRAMS of chromium(III) bromide are present in 2.83x1022 formula units of this compound? grams 2. How many formula units of chromium(III)...
a. How many moles are there in 36 grams of carbon? b. How many grams are...
a. How many moles are there in 36 grams of carbon? b. How many grams are there in 3 moles of sodium c. how many grams are there in 2 moles of water? d. How many moles in: 6.22 grams of aluminum e. How many moles in 1.26 mg of gold? f. how many moles in 5.2 kg of carbon? 3. Calculate the molar mass of sodium nitride 4. Calculate the molar mass of sulfuric acid 5. Give the percent...
19) How many of each type of atom are there in the formula Ca3(PO4)2? A) Ca...
19) How many of each type of atom are there in the formula Ca3(PO4)2? A) Ca = 3, P = 1,0 = 4 B) Ca 3, P = 2, O = 4 C) Ca = 3, P = 2,0=8 D) Ca = 3, P = 1,0 = 8 E) none of the above le Ol be 20) What is the correct formula of a compound that has ten oxygen atoms and four phosphorus atoms? A) O10P4 B) 100P4 C) 4P010...
41-60 CSa 21 Carbon disultide 22 Dinitrogen monoxide cC l4 SaBrs 23 Carbon tetrachloride 24 Trisulfur...
41-60
CSa 21 Carbon disultide 22 Dinitrogen monoxide cC l4 SaBrs 23 Carbon tetrachloride 24 Trisulfur pentabromide 25 Hydroarsenic acid 26 CaBrz ZnsDu Cr(NDSe AUCH COD BasDs KCI Fo (Mn Dua HF HDF (NHa aN Co.(CIDYa Bacla Ph(CH CD Calcium bromide 27 Zinc sulfate 28 Chromium (I) nitrate 29 Aluminum acetate 30 Barium sulfite 31 Potassium chloride 32 Iron () permanganate 33 Hydrofluoric acid 34 Fluorous acid 35 Ammonium nitride 36 Cobalt () hypochlorite 37 Barium chloride 38 Lead ()...
18. Translate the following sentences to chemical equations. Be sure to write correct chemical formulas for...
18. Translate the following sentences to chemical equations. Be sure to write correct chemical formulas for all products and reactants before balancing the equation. (a) Solutions of hydrosulfuric acid and sodium hydroxide are mixed together to form sodium sulfide and water. (b) A solid piece of calcium carbonate is added to a solution of sulfuric acid to form a precipitate of calcium sulfate, carbon dioxide gas and water. (c) Magnesium metal combusts to form magnesium oxide. (d) Ethane, CyHg, combusts...
9) What is the total number of atoms in 0.139 mol of Fe(OH263-? A) 19.0 B)...
9) What is the total number of atoms in 0.139 mol of Fe(OH263-? A) 19.0 B) 2.64 98.37. 1022 D) 1.59. 1024 E) 184. 1024 10) How many carbon atoms are there in 52.06 g of carbon dioxide? A) 8.648.10-23 B) 3.134 x 1025 C) 7.122 1023 D) 5.206 X 1024 E) 1.424 . 1024 11) A nitrogen oxide is 63.65% by mass nitrogen. The molecular formula could be A) NO B) NO2 CN204 D) N20 E) either NO2 or...
22) Calculate the number of atoms in 22.45 grams of barium. A) 1.856 x 107 atoms...
22) Calculate the number of atoms in 22.45 grams of barium. A) 1.856 x 107 atoms B) 9.841 atoms C) 1.351 x 1025 atoms D) 2.716 x 10-2 atoms E) 9.841 x 10 atoms I 23) Calculate the percent composition of carbon dioxide. A) 33.33% C, 66.67% 0 B) 27.29% C, 72.71% O C) 72.71% 0.27.29% 0 D) 66.67% C, 33.33% 0 E) 20.00% C, 80.00% O 24) Classify the following reaction: CaCl(aq) + 2 KF(aq) CaF,(s) + 2 KCl(aq)...
(D) nitrogen oxide 28 What is the mass in grams of a sample of Mg(ClO3)2 that...
(D) nitrogen oxide 28 What is the mass in grams of a sample of Mg(ClO3)2 that contains 6.0 x 1026 atoms of oxygen? (A) 31. 299 grams (B) 1. 1502 grams (C)31717. grams (D) 3. 1529 x 10"7 grams
3. 495 grams is a typical mass for a glass of water. Calculate the number of...
3. 495 grams is a typical mass for a glass of water. Calculate the number of water molecules you drink when quenching your thirst with this quantity of our most common liquid. 4. How many moles are in 150 grams of each of the compounds in problem #1? 5. How many grams are need to give .250 moles of each of the compounds in problem #1? 6. What is the percent weight of oxygen in barium chlorate? Da Cloz) 2...
* 10 What is the mass in grams of a sample of Mg(CIO3)2 that contains 6.0 x 1020 atoms of oxygen? (A) 31717. grams (B) 3. 1529 x 1047 grams (C) 1. 1502 grams (D) 31. 299 grams 11 Name the compound Pb(NO3)4. (A) lead (II) nitrite (B) lead (II) nitrate (C) lead (IV) nitrate (D) lead (III) nitride 12 What is the mass % of carbon in (C2H SO)? (A) 7.74% (B) 60.0 % (C) 20.6% (D) 30.7% (E)...
1. What is the mass of 1.55x1024 atoms of calcium? grams 2. How many calcium atoms are there in 33.4 grams of calcium? atoms 1. How many MOLECULES of nitrogen dioxide are present in 1.57 grams of this compound? molecules. 2. How many GRAMS of nitrogen dioxide are present in 2.77x1022 molecules of this compound? grams. 1. How many GRAMS of chromium(III) bromide are present in 2.83x1022 formula units of this compound? grams 2. How many formula units of chromium(III)...
19) How many of each type of atom are there in the formula Ca3(PO4)2? A) Ca = 3, P = 1,0 = 4 B) Ca 3, P = 2, O = 4 C) Ca = 3, P = 2,0=8 D) Ca = 3, P = 1,0 = 8 E) none of the above le Ol be 20) What is the correct formula of a compound that has ten oxygen atoms and four phosphorus atoms? A) O10P4 B) 100P4 C) 4P010...
41-60
CSa 21 Carbon disultide 22 Dinitrogen monoxide cC l4 SaBrs 23 Carbon tetrachloride 24 Trisulfur pentabromide 25 Hydroarsenic acid 26 CaBrz ZnsDu Cr(NDSe AUCH COD BasDs KCI Fo (Mn Dua HF HDF (NHa aN Co.(CIDYa Bacla Ph(CH CD Calcium bromide 27 Zinc sulfate 28 Chromium (I) nitrate 29 Aluminum acetate 30 Barium sulfite 31 Potassium chloride 32 Iron () permanganate 33 Hydrofluoric acid 34 Fluorous acid 35 Ammonium nitride 36 Cobalt () hypochlorite 37 Barium chloride 38 Lead ()...
18. Translate the following sentences to chemical equations. Be sure to write correct chemical formulas for all products and reactants before balancing the equation. (a) Solutions of hydrosulfuric acid and sodium hydroxide are mixed together to form sodium sulfide and water. (b) A solid piece of calcium carbonate is added to a solution of sulfuric acid to form a precipitate of calcium sulfate, carbon dioxide gas and water. (c) Magnesium metal combusts to form magnesium oxide. (d) Ethane, CyHg, combusts...
9) What is the total number of atoms in 0.139 mol of Fe(OH263-? A) 19.0 B) 2.64 98.37. 1022 D) 1.59. 1024 E) 184. 1024 10) How many carbon atoms are there in 52.06 g of carbon dioxide? A) 8.648.10-23 B) 3.134 x 1025 C) 7.122 1023 D) 5.206 X 1024 E) 1.424 . 1024 11) A nitrogen oxide is 63.65% by mass nitrogen. The molecular formula could be A) NO B) NO2 CN204 D) N20 E) either NO2 or...
22) Calculate the number of atoms in 22.45 grams of barium. A) 1.856 x 107 atoms B) 9.841 atoms C) 1.351 x 1025 atoms D) 2.716 x 10-2 atoms E) 9.841 x 10 atoms I 23) Calculate the percent composition of carbon dioxide. A) 33.33% C, 66.67% 0 B) 27.29% C, 72.71% O C) 72.71% 0.27.29% 0 D) 66.67% C, 33.33% 0 E) 20.00% C, 80.00% O 24) Classify the following reaction: CaCl(aq) + 2 KF(aq) CaF,(s) + 2 KCl(aq)...
(D) nitrogen oxide 28 What is the mass in grams of a sample of Mg(ClO3)2 that contains 6.0 x 1026 atoms of oxygen? (A) 31. 299 grams (B) 1. 1502 grams (C)31717. grams (D) 3. 1529 x 10"7 grams
3. 495 grams is a typical mass for a glass of water. Calculate the number of water molecules you drink when quenching your thirst with this quantity of our most common liquid. 4. How many moles are in 150 grams of each of the compounds in problem #1? 5. How many grams are need to give .250 moles of each of the compounds in problem #1? 6. What is the percent weight of oxygen in barium chlorate? Da Cloz) 2...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 50 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago