Lewis Structure of CH3C(CH3)CH(OH)CO2CH3

Question

Question

Answer 1

Answer #1

The Lewis structure will be

Note - Post any doubts/queries in comments section for any additional help. Rate the answer positive if found helpful

Answer 2

Similar Homework Help Questions

1. Write Lewis structures of methanol, CH,OH and ethane, CH3 CH3. What intermolecular forces exist in...

1. Write Lewis structures of methanol, CH,OH and ethane, CH3 CH3. What intermolecular forces exist in each? Which compound do you expect to have higher boiling point and why? H,OH and ethane, CH, CH What in
QUESTION 6 Which of the following compounds will be considered as a secondary alcohol? OH CH3...

QUESTION 6 Which of the following compounds will be considered as a secondary alcohol? OH CH3 CH3CHCH,CH,OH Structure L CH3 CH3C-CH3 OH -CH2OH Structure K Structure N Structure M Structure Structure N Structure K Structure M
mechanism CH3 CH3 (d) CH3-C-CH2-CH3 Heat CH3-C=CH-CH3 CH3C + H20 (10 pts)

mechanism CH3 CH3 (d) CH3-C-CH2-CH3 Heat CH3-C=CH-CH3 CH3C + H20 (10 pts)

2) Uncharged Lewis Structures. Draw stable Lewis structures for: NH3, CH3NHCH2CH3, C2H6, CH3CH(OH)CH3, HCN, HONO, HCO2H,...

2) Uncharged Lewis Structures. Draw stable Lewis structures for: NH3, CH3NHCH2CH3, C2H6, CH3CH(OH)CH3, HCN, HONO, HCO2H, C3H4 (one triple bond), C3H4 (two double bonds), CH3NCO, CH3C(NH)CH3 please explain
QUESTION 8 What is the length of the longest carbon chain? CH3 CH2 CH3 CH2 CH3C-CH2-CH,...

QUESTION 8 What is the length of the longest carbon chain? CH3 CH2 CH3 CH2 CH3C-CH2-CH, CH-CH2 CH2 CH3 CH2 CH3 . 00 10
1. a. Draw the Lewis dot structure for (CH3)2N (5 pts) b. Between CH,CH SH and...

1. a. Draw the Lewis dot structure for (CH3)2N (5 pts) b. Between CH,CH SH and CH, CH3NH2, which is a stronger Bronsted-Lowry acid? Account for the difference in acidity? (5 pts) 2. You have learned about the active ingredient in NutraSweet, aspartame, which is made from two amino acids; aspartic acid and phenylalanine. A related sweetener, alitame, is shown below: + oH NH2O N. OH a. Label all stereocenters with the appropriate (R) or (S) configuration. (6 pts) b....

17) What are the products of the following reaction? CH3OH + CH3C=C--- ? A) CH3C=CH+CH30- B)...

17) What are the products of the following reaction? CH3OH + CH3C=C--- ? A) CH3C=CH+CH30- B) CH3C=COCH3 + HO- C) CH3OC=CH+ -CH3 D) CH3C=CCH3 + HO- E) no reaction
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3...

Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
complete the following reaction equations. explain product formation and conditions. OH CH3 14. CH3C=C -C5-CH3 THF,...

complete the following reaction equations. explain product formation and conditions. OH CH3 14. CH3C=C -C5-CH3 THF, -78 °c 15. H3PO4 70 °C, 3h OH

26- Using the following Lewis structure and 3-dimensional structure of CH, OH answer the following questions?...

26- Using the following Lewis structure and 3-dimensional structure of CH, OH answer the following questions? H H -H H a- Hybridization of Oxygen b. Hybridization of Carbon CH-C-O bond angle d- H-O-C bond angle