Compare the reaction of the gas collected from Ca-HCl reaction with the reaction of hydrogen collected...
Homework Answers
The reaction between Calcium and HCl is highly exothermic and the heat is sufficient to ignite the hydrogen gas liberated. Thus this will lead to an explosion.
Zinc reacts with HCl to give bubbles of Hydrogen gas. This gas when collected and brought near a flame goes off with a popping sound.
See image below:
Add Answer to:
Compare the reaction of the gas collected from Ca-HCl reaction with
the reaction of hydrogen collected...
Hydrogen gas is produced by the reaction of hydrochloric acid, HCl, on zinc metal. 2HCl (aq)...
Hydrogen gas is produced by the reaction of hydrochloric acid, HCl, on zinc metal. 2HCl (aq) + Zn (s) --> ZnCl2 (aq) + H2 (g) The gas is collected over water. If 106 mL of gas is collected at 28C and 775 mmHg, what is the mass of hydrogen collected? (vapor pressure of water at 28C is 25.6 mmHg)
Jus Magnesium reacts with HCl(aq) to produce hydrogen gas. When a student collected the hydrogen from...
Jus Magnesium reacts with HCl(aq) to produce hydrogen gas. When a student collected the hydrogen from the reaction over water, he forgot to account for the vapor pressure of water. The calculated grams of magnesium in the experiment would be: Unnafected Too high Not enough information to tell Too Low
In the laboratory, hydrogen gas is usually made by the following reaction: Zn(s) + 2 HCl(aq)...
In the laboratory, hydrogen gas is usually made by the following reaction: Zn(s) + 2 HCl(aq) → H2(g) + ZnCl2(aq) How many liters of H2 gas, collected over water at an atmospheric pressure of 752 mm Hg and a temperature of 21.0°C, can be made from 1.566 g of Zn and excess HCl? The partial pressure of water vapor is 18.65 mm Hg at 21.0°C.
Hydrogen gas is prepared in the laboratory by reacting dilute HCl with granulated zinc. Following reaction...
Hydrogen gas is prepared in the laboratory by reacting dilute HCl with granulated zinc. Following reaction takes place. Zn + 2HCl → ZnCl2 + H2 Calculate the volume of hydrogen gas liberated at STP when 32.65 g of zinc reacts with HCl. 1 mol of a gas occupies 22.7 L volume at STP; atomic mass of Zn = 65.3 u.Read more on Sarthaks.com - https://www.sarthaks.com/117934/hydrogen-prepared-laboratory-reacting-dilute-granulated-following-reaction-takes-place
A-D A student performed an experiment in which they collected hydrogen gas from the reaction of...
A-D
A student performed an experiment in which they collected hydrogen gas from the reaction of magnesium with hydrochloric acid using the same apparatus that you will be using in today's lab. The reaction is: Mg(s) + 2 HCl(aq) → H2(g) + MgCl2 (aq) The data they collected are shown below: Mass of Mg Volume of HCI Volume of H2 collected Temperature of H2 collected Barometric pressure 0.100 g 10 mL 57.5 mL 22 °C 29.94 in Hg a. Barometric...
Zn + HCl ---> ZnCl2 + H2(g) The total volume of collected gas over water at...
Zn + HCl ---> ZnCl2 + H2(g) The total volume of collected gas over water at 65oC was 1728 ml at a total pressure of 845 torr. If you used 325 ml of HCl for the reaction, what molarity of HCl would be required to produce the correct amount of Hydrogen?
A-E Properties of Gases Exercise 1: Gas and Flame Tests Data Table 1. Gas Observations Step/Reaction...
A-E
Properties of Gases Exercise 1: Gas and Flame Tests Data Table 1. Gas Observations Step/Reaction Observations Zn+ 2HCl> ZnCl₂ + H₂(g) hydrochloric acid Hydrogen Gas + Flame H219)+flame -> catehe fire Reaction between manganese and H2OM n catalyst hydrogen peroxide Oxygen Gas + Smoldering toothpick Oz+s moldering toothpick -> - bursts into flame Gas Mixture + Flame |ZH₂(g) + O2(g) → 2H₂O (1) Questions: A) What gas was produced by the reaction of zinc and hydrochloric acid? How did...
Dennartine nf Genre Exercise 1: Gas and Flame Tests Data Table 1. Gas Observations Step/Reaction Observations...
Dennartine nf Genre Exercise 1: Gas and Flame Tests Data Table 1. Gas Observations Step/Reaction Observations Reaction between zinc and hydrochloric acid Hydrogen Gas + Flame Reaction between manganese and hydrogen peroxide Oxygen Gas + Smoldering toothpick Gas Mixture + Flame Questions: A) What gas was produced by the reaction of zinc and hydrochloric acid? How did this gas behave in the presence of flame? B) Write a balanced chemical equation describing the reaction of Zn and hydrochloric acid C)...
A student performed an experiment in which hydrogen gas was collected over water from the reaction...
A student performed an experiment in which hydrogen gas was collected over water from the reaction of magnesium and hydrochloric acid using the apparatus shown and accoridng to the reaction equation and the data collected shown below: Mass of Mg 0.100 g Volume of HCl 10 mL Volume of H2 collected 57.5 mL Temperature of H2 collected 22.0 oC Barometric pressure 29.94 inHg Mg(s) + 2 HCl(aq) → H2(g) + MgCl2(aq) a. Barometric pressure in atmospheres? b. Water vapor pressure...
Calcium metal reacts with acid to produce hydrogen gas: Ca(s) + 2 HCl(aq) + H2(g) +...
Calcium metal reacts with acid to produce hydrogen gas: Ca(s) + 2 HCl(aq) + H2(g) + CaCl2(aq) How many liters of hydrogen gas (at STP) would be produced in a reaction that consumed 3.6 g of HCI?
Jus Magnesium reacts with HCl(aq) to produce hydrogen gas. When a student collected the hydrogen from the reaction over water, he forgot to account for the vapor pressure of water. The calculated grams of magnesium in the experiment would be: Unnafected Too high Not enough information to tell Too Low
A-D
A student performed an experiment in which they collected hydrogen gas from the reaction of magnesium with hydrochloric acid using the same apparatus that you will be using in today's lab. The reaction is: Mg(s) + 2 HCl(aq) → H2(g) + MgCl2 (aq) The data they collected are shown below: Mass of Mg Volume of HCI Volume of H2 collected Temperature of H2 collected Barometric pressure 0.100 g 10 mL 57.5 mL 22 °C 29.94 in Hg a. Barometric...
A-E
Properties of Gases Exercise 1: Gas and Flame Tests Data Table 1. Gas Observations Step/Reaction Observations Zn+ 2HCl> ZnCl₂ + H₂(g) hydrochloric acid Hydrogen Gas + Flame H219)+flame -> catehe fire Reaction between manganese and H2OM n catalyst hydrogen peroxide Oxygen Gas + Smoldering toothpick Oz+s moldering toothpick -> - bursts into flame Gas Mixture + Flame |ZH₂(g) + O2(g) → 2H₂O (1) Questions: A) What gas was produced by the reaction of zinc and hydrochloric acid? How did...
Dennartine nf Genre Exercise 1: Gas and Flame Tests Data Table 1. Gas Observations Step/Reaction Observations Reaction between zinc and hydrochloric acid Hydrogen Gas + Flame Reaction between manganese and hydrogen peroxide Oxygen Gas + Smoldering toothpick Gas Mixture + Flame Questions: A) What gas was produced by the reaction of zinc and hydrochloric acid? How did this gas behave in the presence of flame? B) Write a balanced chemical equation describing the reaction of Zn and hydrochloric acid C)...
Calcium metal reacts with acid to produce hydrogen gas: Ca(s) + 2 HCl(aq) + H2(g) + CaCl2(aq) How many liters of hydrogen gas (at STP) would be produced in a reaction that consumed 3.6 g of HCI?
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 8 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 11 hours ago