the nucleus of a beryllium atom has a mass of 8.003111 u, where u is 1.66...
the nucleus of a beryllium atom has a mass of 8.003111 u, where u is 1.66 x 10^-27 kg. This nucleus is known to spontaneously fission into two identical pieces, each of mass 4.001506 u. Assuming the nucleus to be initially at rest,
a) at what speed will its fission fragment move, and
b) how much KE is released?
Homework Answers
Add Answer to:
the nucleus of a beryllium atom has a mass of 8.003111 u, where
u is 1.66...
An atom of beryllium (m 8.00 u) splits into two atoms of helium (m-4.00 u) with...
An atom of beryllium (m 8.00 u) splits into two atoms of helium (m-4.00 u) with the release of 92.2 keV of energy. Suppose the beryllium atom moves in the positive x direction and has kinetic energy 59.9 keV. One helium atom is found to move at an angle of 31° with respect to the x axis. Find the direction of motion of the second helium atom and find the velocity of each helium atom Work this problem in the...
A Uranium-235 atom undergoes fission in the following net reaction (induced fission involves an intermediate step...
A Uranium-235 atom undergoes fission in the following net reaction (induced fission involves an intermediate step as U-236 which we will ignore): U-235 --> X + Y + 2n U-235 is the 'parent', X and Y are 'daughters' (= fission products), n = free neutron. 1 u = atomic mass unit = 1.66 x 10-27 kg mn = mass of a neutron = 1.008665 u mp = mass of a proton = 1.007825 u 1 eV = 1.602 x 10-19...
10.9 A radioactive nucleus (mass = 1.70*10-26 kg) is at rest. It suddenly decays (explodes) into...
10.9 A radioactive nucleus (mass = 1.70*10-26 kg) is at rest. It suddenly decays (explodes) into three pieces. One piece has mass mi = 5.00*10-27 kg and is found to be moving along the +y axis with a speed of 6.00* 10 m/s. A second piece with mass m2 = 8.40*10-27 kg moves along the +x axis with a speed of 4.00* 10° m/s. Assuming the mass is held constant, find the velocity of the third and final piece that...
A U-238 atom (uranium-238) has a nucleus with 92 protons and an atomic mass of 238.0507882...
A U-238 atom (uranium-238) has a nucleus with 92 protons and an atomic mass of 238.0507882 u. What is the nuclear binding energy per nucleon in this atom? 1.93 MeV 7.57 MeV 12.3 MeV 19.6 MeV 1802 MeV A proton has a kinetic energy of 7.5 MeV. What is the speed of an alpha particle that has the same DeBroglie wavelength as the proton? The mass of the alpha particle is 6.65E-27 kg. 9517 m/s 9.53E6 m/s 1833 m/s 2.38E13...
A uranium-238 atom can break up into a thorium-234 atom and a particle called an alpha...
A uranium-238 atom can break up into a thorium-234 atom and a particle called an alpha particle, α-4. The numbers indicate the inertias of the atoms and the alpha particle in atomic mass units (1 amu = 1.66 × 10^−27 kg). When an uranium atom initially at rest breaks up, the thorium atom is observed to recoil with an x component of velocity of -2.6 × 10^5 m/s. How much of the uranium atom's internal energy is released in the...
In a nuclear reactor, neutrons released by nuclear fission must be slowed down before they can trigger additional reactions in other nuclei
In a nuclear reactor, neutrons released by nuclear fission must be slowed down before they can trigger additional reactions in other nuclei. To see what sort of material is most effective in slowing (or moderating) a neutron, calculate the ratio of a neutron's final kinetic energy to its initial kinetic energy, Kf/Ki , for a head-on elastic collision with each of the following stationary target particles. (Note: The mass of a neutron is , where the atomic mass unit, m=1.009u...
An unstable atomic nucleus with with a mass of 1.7x10^-26kg is at rest at the origin...
An unstable atomic nucleus with with a mass of 1.7x10^-26kg is at rest at the origin of a coordinate system. It spontaneously disintegrates into three particles: one moving in the positive y-direction with a mass of 5x10^-27 kg and a speed of 6x10^6 m/s, the second moves in the positive x-direction with a mass of 8.4x10^-27kg and a speed of 4x10^6m/s. Find the magnitude and direction of the velocity of the third particle.
A uranium nucleus (mass 238 u), initially at rest, undergoes a radioactive decay. After an alpha...
A uranium nucleus (mass 238 u), initially at rest, undergoes a radioactive decay. After an alpha particle ( mass 4.0 u) is emitted, the remaining nucleus is thorium (mass 234 u). If the alpha particle is moving at 0.050 times the speed of light, what is the recoil speed of the thorium nucleus?
A uranium-238 atom can break up into a thorium-234atom and a particle called an alpha particle,...
A uranium-238 atom can break up into a thorium-234atom and a particle called an alpha particle, α-4. The numbers indicate the inertias of the atoms and the alpha particle in atomic mass units (1 amu = 1.66 × 10−27 kg). When an uranium atom initially at rest breaks up, the thorium atom is observed to recoil with an x component of velocity of -2.1 × 105 m/s. How much of the uranium atom's internal energy is released in the breakup?...
An alpha particle (mass = 4 u) has a head-on, elastic collision with a nucleus (mass...
An alpha particle (mass = 4 u) has a head-on, elastic collision with a nucleus (mass = 158 u) that is initially at rest. What percentage of the kinetic energy of the alpha particle is transferred to the nucleus in the collision? %
An atom of beryllium (m 8.00 u) splits into two atoms of helium (m-4.00 u) with the release of 92.2 keV of energy. Suppose the beryllium atom moves in the positive x direction and has kinetic energy 59.9 keV. One helium atom is found to move at an angle of 31° with respect to the x axis. Find the direction of motion of the second helium atom and find the velocity of each helium atom Work this problem in the...
10.9 A radioactive nucleus (mass = 1.70*10-26 kg) is at rest. It suddenly decays (explodes) into three pieces. One piece has mass mi = 5.00*10-27 kg and is found to be moving along the +y axis with a speed of 6.00* 10 m/s. A second piece with mass m2 = 8.40*10-27 kg moves along the +x axis with a speed of 4.00* 10° m/s. Assuming the mass is held constant, find the velocity of the third and final piece that...
A U-238 atom (uranium-238) has a nucleus with 92 protons and an atomic mass of 238.0507882 u. What is the nuclear binding energy per nucleon in this atom? 1.93 MeV 7.57 MeV 12.3 MeV 19.6 MeV 1802 MeV A proton has a kinetic energy of 7.5 MeV. What is the speed of an alpha particle that has the same DeBroglie wavelength as the proton? The mass of the alpha particle is 6.65E-27 kg. 9517 m/s 9.53E6 m/s 1833 m/s 2.38E13...
An alpha particle (mass = 4 u) has a head-on, elastic collision with a nucleus (mass = 158 u) that is initially at rest. What percentage of the kinetic energy of the alpha particle is transferred to the nucleus in the collision? %
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 28 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago