28. Write the balanced chemical equation, the equilibrium constant expression, and give numerical values for the...
28. Write the balanced chemical equation, the equilibrium constant expression, and give numerical values for the equilibrium constant for each of the following:
(a) the acid dissociation of hydrogen cyanide ( HCN )
(b) the solubility of lanthanum(III) oxalate ( La2(C2O4)3)
(c) the base dissociation of methyl amine (CH3NH2)
(d) the complexation of oxalate ion with Fe3+to form Fe(C2O4)33-(K = 1.0 x 1020)
(e) the reaction of acetic acid with NH3to produce water and ammonium acetate
(Kaof acetic acid is 1.75 x 10-5 and the Kbof ammonia is 1.75 x 10-5)
Homework Answers
Add Answer to:
28. Write the balanced chemical equation, the equilibrium
constant expression, and give numerical values for the...
15. What is the closest numerical value of the equilibrium constant K for the acid-base equilibrium...
15. What is the closest numerical value of the equilibrium constant K for the acid-base equilibrium between acetic acid and ammonia (left hand side of the equilibrium) and ammonium acetate ions (on the right hand side of the equilibrium arrows)? Lot Mo — Lorik Kollo (sins] H + NH3 + NH3 K = = K= a) 100,000 b) 10 c) -10 d) -100,000 16. What are the best reagents and reaction conditions to accomplish the kinetic allylation of 2- methylcyclopentanone?...
Calculate the equilibrium concentrations of all chemical species present in a 0.10 M H2CO3(aq) solution. What...
Calculate the equilibrium concentrations of all chemical species
present in a 0.10 M H2CO3(aq)
solution. What is the percent ionization of the acid and resulting
pH?
[H2CO3] =
[HCO3-] =
[CO32-] =
[H3O+] =
% ionization =
pH =
Acid Acetic Ammonium Formula CH:COOH NH4+ H2BO: Boric Carbonic H2CO3 HC1O2 HCOOH Chlorous Formic Hydrocyanic Perchloric 1.8 x 105 5.6 x 10-10 5.4 x 10-10 4.5 x 10-7 4.7 x 10-11 1.1 x 10-2 1.8 x 10-4 5.2 x 10-10 Very...
1. Write the equilibrium expression for the autoionization of water. Using this expression define the terms...
1. Write the equilibrium expression for the autoionization of water. Using this expression define the terms acid and base and pH. 2. Calculate the pH, pOH, Ka, Kb, pKa, and pKb for a 0.082M solution of triethylamine. 3. Calculate the pH, pOH, Ka, Kb, pKa, and pKb for a 1.570 M solution of hydrogen cyanide. 4. The acid-dissociation constant for hypochlorus acid is 3.0 X 10-8. Calculate the concentrations of H3O+, CIO-, and HCIO at equilibrium if the initial concentration...
Calculate the equilibrium concentrations of all chemical species present in a 0.10 M H CO.(aq) solution....
Calculate the equilibrium concentrations of all chemical species present in a 0.10 M H CO.(aq) solution. What is the percent ionization of the acid and resulting pH? Units Units [H2CO3) = Number [HCO3) = Number [CO32) = Number [H30+) = Number Units Units % ionization = Number pH = Number Ka Acid Acetic Ammonium Formula CH3COOH NH4+ H3B03 1.8 x 10-5 5.6 x 10-10 5.4 x 10-10 Boric Carbonic H2CO3 Chlorous Formic Hydrocyanic Perchloric HCIO2 HCOOH HCN HC104 4.5 x...
1- Write the equilibrium constant expression for this reaction: NH3(aq)+H+(aq)→NH+4(aq) 2- A chemist prepares a solution...
1- Write the equilibrium constant expression for this
reaction:
NH3(aq)+H+(aq)→NH+4(aq)
2- A chemist prepares a solution of zinc oxalate ZnC2O4
by measuring out 1.6mg of zinc oxalate into a 500.mL volumetric
flask and filling the flask to the mark with water. Calculate the
concentration in mol/L of the chemist's zinc oxalate
solution. Round your answer to 2 significant digits.
3- Wine goes bad soon after opening because the ethanol
CH3CH2OH dissolved in it reacts with oxygen
O2 gas to form water and aqueous...
RUVILUULI Q. #1. The equilibrium constant for the auto-ionization of water 2H30 (I) = H3O'(aq) +...
RUVILUULI Q. #1. The equilibrium constant for the auto-ionization of water 2H30 (I) = H3O'(aq) + OH(aq) is 1.0 x 10-4 at 25°C and 3.8 x 10-14 at 40°C. Is the forward process endothermic or exothermic? Need to show your calculation. Ans: exothermic Q. #2. If you have 0.040 M solution two strong acids like HCI and H2SO, which one do you think would have behaves as stronger acids? Explain your answer with ICE table and relevant calculation. K for...
need ALL FOUR PLEASE! having a hard time! please do all!! pKa values A1 liter solution...
need ALL FOUR PLEASE! having a hard time! please do
all!!
pKa values
A1 liter solution contains 0.526 M hydrofluoric acid and 0.395 M potassium fluoride. Addition of 0.434 moles of hydrochloric acid will: (Assume that the volume does not change upon the addition of hydrochloric acid.) Raise the pH slightly Lower the pH slightly Raise the pH by several units Lower the pH by several units Not change the pH Exceed the buffer capacity Submit Answer Retry Entire Group...
Please I need help on this. I'm so lost 1. Acetic acid (H)CO2H) has k, =...
Please I need help on this. I'm so lost
1. Acetic acid (H)CO2H) has k, = 1.8 x 10- and acetate (H:C:01") has ks = 5.6 x 10-10. (a) Write balanced chemical equilibrium equations (with physical states) for acid dissociation of acetic acid and base hydrolysis of acetate ion. (b) Write K, and equilibrium constant expressions for the above reactions. (c) Use your expressions from part b to show that Kx. = 1.0 x 10-* = [H,O'][OH). 2. For each...
I didn't know which one so I posted all of what I was provided Acid/Base Ionization...
I didn't know which one so I
posted all of what I was provided
Acid/Base Ionization Constants at 25 °C Acid Formula Kal Ka2 Каз Acetic acid CH3COOH 1.8x10-5 Acetylsalicylic acid (aspirin) HC,H-04 3.0x10-4 Aluminum ion Al(H20)43+ 1.2x10-5 Arsenic acid H3 AsO4 2.5x10-4 5.6x10-8 3.0x10-13 Ascorbic acid H2C6H606 7.9x10-5 1.6x10-12 Benzoic acid CH3COOH 6.3x10-5 Carbonic acid H2CO3 4.2x10-7 4.8x10-11 Ferric ion Fe(H20)63+ 4.0*10-3 Formic acid HCOOH 1.8x104 Hydrocyanic acid HCN 4.0*10-10 Hydrofluoric acid HF 7.2x104 Hydrogen peroxide H202 2.4x10-12 Hydrosulfuric...
17.6 Based on the information in Appendix D, calculate the pH and trimethylammonium ion concentration of...
17.6 Based on the information in Appendix D,
calculate the pH and trimethylammonium ion concentration of a
solution of trimethylamine, (CH3) 3N, 0.075 M, and
trimethylammonium chloride, (CH3) 3NHCl, 0.10 M.
CONSTANTS OF AQUEOUS BALANCE Кок LO X 107 3.0 X 10-12 X L6 X 10 12 Kat 18 X 105 5.6 X 10- 5.1 X 10-10 3 X 10 6.3 X 105 5.8 X 10 10 15 X Ls 43 X 10 14 X 1st 1 x 102 74...
15. What is the closest numerical value of the equilibrium constant K for the acid-base equilibrium between acetic acid and ammonia (left hand side of the equilibrium) and ammonium acetate ions (on the right hand side of the equilibrium arrows)? Lot Mo — Lorik Kollo (sins] H + NH3 + NH3 K = = K= a) 100,000 b) 10 c) -10 d) -100,000 16. What are the best reagents and reaction conditions to accomplish the kinetic allylation of 2- methylcyclopentanone?...
Calculate the equilibrium concentrations of all chemical species
present in a 0.10 M H2CO3(aq)
solution. What is the percent ionization of the acid and resulting
pH?
[H2CO3] =
[HCO3-] =
[CO32-] =
[H3O+] =
% ionization =
pH =
Acid Acetic Ammonium Formula CH:COOH NH4+ H2BO: Boric Carbonic H2CO3 HC1O2 HCOOH Chlorous Formic Hydrocyanic Perchloric 1.8 x 105 5.6 x 10-10 5.4 x 10-10 4.5 x 10-7 4.7 x 10-11 1.1 x 10-2 1.8 x 10-4 5.2 x 10-10 Very...
1. Write the equilibrium expression for the autoionization of water. Using this expression define the terms acid and base and pH. 2. Calculate the pH, pOH, Ka, Kb, pKa, and pKb for a 0.082M solution of triethylamine. 3. Calculate the pH, pOH, Ka, Kb, pKa, and pKb for a 1.570 M solution of hydrogen cyanide. 4. The acid-dissociation constant for hypochlorus acid is 3.0 X 10-8. Calculate the concentrations of H3O+, CIO-, and HCIO at equilibrium if the initial concentration...
Calculate the equilibrium concentrations of all chemical species present in a 0.10 M H CO.(aq) solution. What is the percent ionization of the acid and resulting pH? Units Units [H2CO3) = Number [HCO3) = Number [CO32) = Number [H30+) = Number Units Units % ionization = Number pH = Number Ka Acid Acetic Ammonium Formula CH3COOH NH4+ H3B03 1.8 x 10-5 5.6 x 10-10 5.4 x 10-10 Boric Carbonic H2CO3 Chlorous Formic Hydrocyanic Perchloric HCIO2 HCOOH HCN HC104 4.5 x...
1- Write the equilibrium constant expression for this
reaction:
NH3(aq)+H+(aq)→NH+4(aq)
2- A chemist prepares a solution of zinc oxalate ZnC2O4
by measuring out 1.6mg of zinc oxalate into a 500.mL volumetric
flask and filling the flask to the mark with water. Calculate the
concentration in mol/L of the chemist's zinc oxalate
solution. Round your answer to 2 significant digits.
3- Wine goes bad soon after opening because the ethanol
CH3CH2OH dissolved in it reacts with oxygen
O2 gas to form water and aqueous...
RUVILUULI Q. #1. The equilibrium constant for the auto-ionization of water 2H30 (I) = H3O'(aq) + OH(aq) is 1.0 x 10-4 at 25°C and 3.8 x 10-14 at 40°C. Is the forward process endothermic or exothermic? Need to show your calculation. Ans: exothermic Q. #2. If you have 0.040 M solution two strong acids like HCI and H2SO, which one do you think would have behaves as stronger acids? Explain your answer with ICE table and relevant calculation. K for...
need ALL FOUR PLEASE! having a hard time! please do
all!!
pKa values
A1 liter solution contains 0.526 M hydrofluoric acid and 0.395 M potassium fluoride. Addition of 0.434 moles of hydrochloric acid will: (Assume that the volume does not change upon the addition of hydrochloric acid.) Raise the pH slightly Lower the pH slightly Raise the pH by several units Lower the pH by several units Not change the pH Exceed the buffer capacity Submit Answer Retry Entire Group...
Please I need help on this. I'm so lost
1. Acetic acid (H)CO2H) has k, = 1.8 x 10- and acetate (H:C:01") has ks = 5.6 x 10-10. (a) Write balanced chemical equilibrium equations (with physical states) for acid dissociation of acetic acid and base hydrolysis of acetate ion. (b) Write K, and equilibrium constant expressions for the above reactions. (c) Use your expressions from part b to show that Kx. = 1.0 x 10-* = [H,O'][OH). 2. For each...
I didn't know which one so I
posted all of what I was provided
Acid/Base Ionization Constants at 25 °C Acid Formula Kal Ka2 Каз Acetic acid CH3COOH 1.8x10-5 Acetylsalicylic acid (aspirin) HC,H-04 3.0x10-4 Aluminum ion Al(H20)43+ 1.2x10-5 Arsenic acid H3 AsO4 2.5x10-4 5.6x10-8 3.0x10-13 Ascorbic acid H2C6H606 7.9x10-5 1.6x10-12 Benzoic acid CH3COOH 6.3x10-5 Carbonic acid H2CO3 4.2x10-7 4.8x10-11 Ferric ion Fe(H20)63+ 4.0*10-3 Formic acid HCOOH 1.8x104 Hydrocyanic acid HCN 4.0*10-10 Hydrofluoric acid HF 7.2x104 Hydrogen peroxide H202 2.4x10-12 Hydrosulfuric...
17.6 Based on the information in Appendix D,
calculate the pH and trimethylammonium ion concentration of a
solution of trimethylamine, (CH3) 3N, 0.075 M, and
trimethylammonium chloride, (CH3) 3NHCl, 0.10 M.
CONSTANTS OF AQUEOUS BALANCE Кок LO X 107 3.0 X 10-12 X L6 X 10 12 Kat 18 X 105 5.6 X 10- 5.1 X 10-10 3 X 10 6.3 X 105 5.8 X 10 10 15 X Ls 43 X 10 14 X 1st 1 x 102 74...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 13 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 44 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago