1) By volume, the atmosphere consists of 78% N2, 21% O2, 1%40Ar and about 400 ppm...
1) By volume, the atmosphere consists of 78% N2, 21% O2, 1%40Ar and about 400 ppm CO2
a) What is the mean molecular weight of air? Round the answer to three significant figures.
b) The total mass of the atmosphere is about 5·1018Kg. How many moles of air does it contain?
c) How many moles of O2 and CO2 are present?
d) Forests and soils contain roughly 2160 Giga ton of Carbon in the form of wood, leaves, and hummus.
Suppose that all of the world’s forests were to burn down instantaneously and that all of the soil carbon
was oxidized as well. By how much would atmospheric CO2 increase? By how much would O2 decrease?
Assume that the burning equation is the same as that for respiration and decay: CH2O+O2→CO2+H2O.
Homework Answers
Add Answer to:
1) By volume, the atmosphere consists of 78% N2, 21% O2, 1%40Ar
and about 400 ppm...
Forests and soils contain roughly 2160 Gton of carbon in the form of wood, leaves, and...
Forests and soils contain roughly 2160 Gton of carbon in the form of wood, leaves, and humus. (The actual value is not known this accurately, but this choice makes the numbers work out well.) Suppose that all of the world’s forests were to burn down instantaneously and that all of the soil carbon was oxidized as well.By how much would atmospheric CO2 increase? By how much would O2 decrease? Express your answers in percentages. Assume that the burning equation is...
Background: Ancient lycophytes were the dominant plants on Earth during the Carboniferous Period, which is named...
Background: Ancient lycophytes were the dominant plants on Earth during the Carboniferous Period, which is named for the coal that formed from those ancient plants that lived 300 million years ago. As humans use fossil fuels such as coal and gas, we release carbon in the form of carbon dioxide (CO2) into the air. Because CO2 traps heat near the surface of the earth, it is known as a greenhouse gas and contributes to climate change. However, carbon is also...
Step 1: If CO2 in oceans were to rise from 300 ppm to 400 ppm (parts...
Step 1: If CO2 in oceans were to rise from 300 ppm to 400 ppm (parts per million - I get a conversion here of 6.8 mM to 9.1 mM) and oceans represent a volume of 1.335 X 1021 L, how many moles of CO2 is that in the ocean for 300ppm (6.8 mM) and for 400ppm (9.1mM)? Step 2: We often talk in "billions of barrels of oil" when we discuss yearly consumption rates. Assuming that a billion barrels...
I need help in these questions. Please answer with plagiriasm Introductory Questions 1. What is a...
I need help in these questions. Please answer with
plagiriasm
Introductory Questions 1. What is a footprint? Why do we need to think about the carbon footprints” we leave behind? 2. What is a fossil fuel? Problem How much CO2 do you produce every year from normal, everyday activities? Complete Versus Incomplete Combustion Combustion, like all chemical reactions, does not always proceed with 100% efficiency. It is prone to limiting reactants the same as other processes. So, there are two...
Classwork: Ch. 6 Thermodynamics 1. A sample of nitrogen expands in volume from 1.6 L to...
Classwork: Ch. 6 Thermodynamics 1. A sample of nitrogen expands in volume from 1.6 L to 5.4 L at constant temperature. What is the work in joules if the gas expands (a) against a vacuum and (b) against a constant pressure of 3.7 atm? 2. How much heat is evolved (given off) when 266 g of white phosphorus (P) burn in air? P, (s) + 50,0) - P.O.(s) AH--3013 kJ/mol 3. Benzene (CH) burns in oxygen to produce carbon dioxide...
1. Moles of Reactant to Mass of Reactant: Identify the iodide ions and ozone in the...
1. Moles of Reactant to Mass of Reactant: Identify the iodide ions and ozone in the balanced chemical equation. Use mole ratio, then convert to grams. A method used by the EPA for determining the ozone concentration in the air is to pass an air sample through a bubbler containing iodide ions. The iodide ions remove the ozone according to the following reaction: O3(g) + 2 I-(aq) + H2O(l) → O2(g) + I2(aq) + 2 OH-(aq) How many grams of ozone...
1. The reaction 6f propane with oxygen follows the reaction below: Equation1 ) Balance Equation 1...
1. The reaction 6f propane with oxygen follows the reaction below: Equation1 ) Balance Equation 1 above i) is the above reaction endothermic or exothermic? Enstem i) Classify the reaction above as combination, single displacement, double displacement, decomposition or combustion. comba How much heat was produced in Equation 1 if it can heat 100 g of water from 32 °C? to 40 Is the energy in propane potential or kinetic energy? P。hhi vi) Given that 1 mole of propane produces...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has its own characteristic atom in which a. the atomic mass is constant. b. the atomic number is constant. c. the mass number is constant. d. Two of the above are correct. e. All of the above are correct. 2. Which of the following is not a trace element in the human body? a. iodine b. zinc c. iron d. calcium e. fluorine 3. A...
I need help in these questions. Please answer with
plagiriasm
Introductory Questions 1. What is a footprint? Why do we need to think about the carbon footprints” we leave behind? 2. What is a fossil fuel? Problem How much CO2 do you produce every year from normal, everyday activities? Complete Versus Incomplete Combustion Combustion, like all chemical reactions, does not always proceed with 100% efficiency. It is prone to limiting reactants the same as other processes. So, there are two...
Classwork: Ch. 6 Thermodynamics 1. A sample of nitrogen expands in volume from 1.6 L to 5.4 L at constant temperature. What is the work in joules if the gas expands (a) against a vacuum and (b) against a constant pressure of 3.7 atm? 2. How much heat is evolved (given off) when 266 g of white phosphorus (P) burn in air? P, (s) + 50,0) - P.O.(s) AH--3013 kJ/mol 3. Benzene (CH) burns in oxygen to produce carbon dioxide...
1. The reaction 6f propane with oxygen follows the reaction below: Equation1 ) Balance Equation 1 above i) is the above reaction endothermic or exothermic? Enstem i) Classify the reaction above as combination, single displacement, double displacement, decomposition or combustion. comba How much heat was produced in Equation 1 if it can heat 100 g of water from 32 °C? to 40 Is the energy in propane potential or kinetic energy? P。hhi vi) Given that 1 mole of propane produces...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has its own characteristic atom in which a. the atomic mass is constant. b. the atomic number is constant. c. the mass number is constant. d. Two of the above are correct. e. All of the above are correct. 2. Which of the following is not a trace element in the human body? a. iodine b. zinc c. iron d. calcium e. fluorine 3. A...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 43 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago