During reaction between calcium and oxygen valence electrons: A. are shared between atoms of calcium and...
During reaction between calcium and oxygen valence electrons:
|
A. are shared between atoms of calcium and atoms of oxygen |
||
| B |
are transferred from atoms of calcium to atoms of oxygen to form Ca+ and O- ions |
|
| C |
are transferred from atoms of calcium to atoms of oxygen to form Ca+2 and O-2 ions |
|
| D |
are transferred from atoms of oxygen to atoms of calcium to form Ca-and O+ions |
Homework Answers
Answer:-
C). are transferred from atoms of calcium to atoms of oxygen to form Ca2+and O-2 ions.
It is correct answer because Ca donate t 2 electrons to attain stable electronic configuration and O gains 2 electrons to attain stable electronic configuration.
Add Answer to:
During reaction between calcium and oxygen valence
electrons:
A. are shared between atoms of calcium and...
Covalent bonds form between hydrogen, carbon, and oxygen atoms when valence electrons are shared between the...
Covalent bonds form between hydrogen, carbon, and oxygen atoms when valence electrons are shared between the atoms valence electrons are subsituted between the atoms electrons are attracted to the nucleus protons are shared between the atoms
In a covalent bond, the valence electrons from atoms are: a. shared b. transferred to the...
In a covalent bond, the valence electrons from atoms are: a. shared b. transferred to the less metallic element c. transferred to the more metallic element d. gained by the anion e. gained by the cation
Answer true or false. 1. Atoms that lose electrons to achieve a filled valence shell become...
Answer true or false. 1. Atoms that lose electrons to achieve a filled valence shell become cations and form ionic bonds with anions. 2. Ionic bonds tend to form between elements on the left side of the Periodic Table, and covalent bonds tend to form between elements on the right side of the Periodic Table. 3. Electronegativity is a measure of an atom's attraction for the electrons it shares in a chemical bond with another atom. 4. Fluorine, in the...
E. electrons are shared between two atoms. 49. Molecules that form when electrons are shared unequally...
E. electrons are shared between two atoms. 49. Molecules that form when electrons are shared unequally between atoms are called A. salt molecules. B. polar molecules. C. nonpolar molecules. D. lopsided molecules. 50. An atom has an atomic number of 19 and a mass number of 39. This atom will have A. 19 neutrons. B. 20 neutrons. C. 39 neutrons. D. 58 neutrons. E. 20 electrons.
8. How many valence electrons are needed to form a double bond? 9. Why calcium oxide...
8. How many valence electrons are needed to form a double bond? 9. Why calcium oxide is Cao, not CaO2? (any compound, ionic or molecular compound, the total charge is zero. Ca loses 2 valence electrons to become Ca+2 while o gains two valence electrons to become 02, the total charge is zero. CaO2, is not zero charge, it is -2 net charge.
8. How many valence electrons are needed to form a double bond? 9. Why calcium oxide...
8. How many valence electrons are needed to form a double bond? 9. Why calcium oxide is Cao, not CaO2? (any compound, ionic or molecular compound, the total charge is zero. Ca loses 2 valence electrons to become Ca+2 while o gains two valence electrons to become 02, the total charge is zero. CaO2, is not zero charge, it is -2 net charge.
What is true about a pure covalent bond? a. The electrons are shared equally between the...
What is true about a pure covalent bond? a. The electrons are shared equally between the atoms in the bond. b. The electrons are transferred from one atom to the other in the bond. c.The electrons are shared unequally between atoms in the covalent bond. d. The electrons are absorbed into the nucleus of one atom in the bond. Which is NOT a property of covalent compounds? a. Poor conductor of electricity in any state b. Often liquid or gas...
Question 2 A covalent bond results when electrons are transferred from one atom to another atom...
Question 2 A covalent bond results when electrons are transferred from one atom to another atom atoms pool their electrons to form a sea" of electrons electrons are shared between a pair of atoms. an atom has eight valence electrons. (e)
Problem 6. (6 points) Regarding a covalent bond between carbon and oxygen atoms in a carbon...
Problem 6. (6 points) Regarding a covalent bond between carbon and oxygen atoms in a carbon monoxide, CO, molecule, determine in each of the following statements if they are either true or false. Justify your answer.? (a) Valence electrons are transferred from carbon to oxygen atoms. (b)Bonding electrons are distributed over the entire CO molecule. (c) The bond length is less than the sum of the two atomic radii. (d) Energy is released when a covalent bond is broken. Problem...
Report: Periodic Properties Valence Electrons +Electron Configurations 1. Give the condensed electron configuratio...
Report: Periodic Properties Valence Electrons +Electron Configurations 1. Give the condensed electron configuration for the following elements. Rb d. I a. b. С e. Ca c. Si f. Pb Give the number of valence electrons for each element. 2. d. Br a. Al b. Rb c. Ar 3. Across a period of the periodic table (left to right), valence electrons... Circle the correct choice: (increase / remain the same / decrease) Down a family of the periodic table (top to...
E. electrons are shared between two atoms. 49. Molecules that form when electrons are shared unequally between atoms are called A. salt molecules. B. polar molecules. C. nonpolar molecules. D. lopsided molecules. 50. An atom has an atomic number of 19 and a mass number of 39. This atom will have A. 19 neutrons. B. 20 neutrons. C. 39 neutrons. D. 58 neutrons. E. 20 electrons.
8. How many valence electrons are needed to form a double bond? 9. Why calcium oxide is Cao, not CaO2? (any compound, ionic or molecular compound, the total charge is zero. Ca loses 2 valence electrons to become Ca+2 while o gains two valence electrons to become 02, the total charge is zero. CaO2, is not zero charge, it is -2 net charge.
8. How many valence electrons are needed to form a double bond? 9. Why calcium oxide is Cao, not CaO2? (any compound, ionic or molecular compound, the total charge is zero. Ca loses 2 valence electrons to become Ca+2 while o gains two valence electrons to become 02, the total charge is zero. CaO2, is not zero charge, it is -2 net charge.
Question 2 A covalent bond results when electrons are transferred from one atom to another atom atoms pool their electrons to form a sea" of electrons electrons are shared between a pair of atoms. an atom has eight valence electrons. (e)
Problem 6. (6 points) Regarding a covalent bond between carbon and oxygen atoms in a carbon monoxide, CO, molecule, determine in each of the following statements if they are either true or false. Justify your answer.? (a) Valence electrons are transferred from carbon to oxygen atoms. (b)Bonding electrons are distributed over the entire CO molecule. (c) The bond length is less than the sum of the two atomic radii. (d) Energy is released when a covalent bond is broken. Problem...
Report: Periodic Properties Valence Electrons +Electron Configurations 1. Give the condensed electron configuration for the following elements. Rb d. I a. b. С e. Ca c. Si f. Pb Give the number of valence electrons for each element. 2. d. Br a. Al b. Rb c. Ar 3. Across a period of the periodic table (left to right), valence electrons... Circle the correct choice: (increase / remain the same / decrease) Down a family of the periodic table (top to...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 3 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago