A hypothetical alpha-helix is formed from a polypeptide that contains 30 residues. A. Residue #12 in...
A hypothetical alpha-helix is formed from a polypeptide that contains 30 residues.
A. Residue #12 in the helix forms H bonds with atoms from which other residues?
B. Which residues would the R-groups be in the same position around the helix as the Rgroup of residue #12?
Homework Answers
Add Answer to:
A hypothetical alpha-helix is formed from a polypeptide that
contains 30 residues.
A. Residue #12 in...
6. The following polypeptide (30 amino acids) contains a great deal of regular secondary structure. (10)...
6. The following polypeptide (30 amino acids) contains a great deal of regular secondary structure. (10) (15) (20) lys Lys Ala-Phe-Trp-Met-His- GIh-Thr-lle-Arg-Ser-Gly-Ala-Gly-Ser-Gly-Ala-Trp-Tyr-Pro-Val-Ala (30) Phe-Met-Leu-Val-Pro-Glu-Glu There are at least two regions where alpha helical structure is found. Indicate the beginning and ending residues of these regions. Any group or groups which break the alpha helical structure should not be considered part of the helix. Remember that it take four residues to give a turn of an alpha helix, so that is...
22. Consider an alpha helix with sequence VLADWMAVELA, and consider the hydrogen bonds that are required in order to fo...
22. Consider an alpha helix with sequence VLADWMAVELA, and consider the hydrogen bonds that are required in order to form the alpha helix. A. Fill in all of the hydrogen bonds that must form between a given residue's backbone N-H backbone C-O, or R group, indicating what the hydrogen bonding partner for each will be. For example, the C-O of V1 is a hydrogen bond acceptor of the W5 N-H hydrogen bond donor, reflected in the appropriate squares under V1...
22. Consider an alpha helix with sequence VLADWMAVELA, and consider the hydrogen bonds that are required in order to fo...
22. Consider an alpha helix with sequence VLADWMAVELA, and consider the hydrogen bonds that are required in order to form the alpha helix. A. Fill in all of the hydrogen bonds that must form between a given residue's backbone N-H backbone C-O, or R group, indicating what the hydrogen bonding partner for each will be. For example, the C-O of V1 is a hydrogen bond acceptor of the W5 N-H hydrogen bond donor, reflected in the appropriate squares under V1...
PRELAB ASSIGNMENT 1 Draw the structure of the amino acid son CH-OH Label the alpha carbon...
PRELAB ASSIGNMENT 1 Draw the structure of the amino acid son CH-OH Label the alpha carbon acid Sorine (en) which has R MO CHE OH CH2 OH 2. Draw the dipeptide that forms betw the peptide bond. s between serine and alanine The dipeptide sequence is Ser Ala Lace CH NCH H, A - — сH — с CH2 OH 3. How many amino aci arty amino acid residues are in a polypeptide containing 6 peptide bonos How many peptide...
ter 9. Hemoglobin and Myoglobin Which of these is not found in myoglobin? A) alpha helix...
ter 9. Hemoglobin and Myoglobin Which of these is not found in myoglobin? A) alpha helix b) beta sheetc) heme group, d) globular folding pattern • Which statement about hemoglobin is not true? A) it is globular b) it contains helix loop-helix c) it has three subunits d) it has heme groups · The molecule which binds in the central cavity of hemoglobin when it is deoxygenated is: a) CO2 b) heme c) BPG d) all of these - The...
Which of these is not found in myoglobin? A) alpha helix b) beta sheet c) heme...
Which of these is not found in myoglobin? A) alpha helix b) beta sheet c) heme group 1. d) globular folding pattern 2. Which statement about hemoglobin is not true? A) it is globular b) it contains helix- loop-helix c) it has three subunits d) it has heme groups 3. The molecule which binds in the central cavity of hemoglobin when it is deoxygenated is: a) CO2 b) heme c) BPG d) all of these 4. The transition of hemoglobin...
1. Which of these is not found in myoglobin? A) alpha helix b) beta sheet c)...
1. Which of these is not found in myoglobin? A) alpha helix b) beta sheet c) heme group d) globular folding pattern 2. Which statement about hemoglobin is not true? A) it is globular b) it contains helix- loop-helix c) it has three subunits d) it has heme groups 3. The molecule which binds in the central cavity of hemoglobin when it is deoxygenated is: a) CO2 b) heme c) BPG d) all of these 4. The transition of hemoglobin...
vols " statement about hemoglobin is not true? A) it is globular b) it contains helix-...
vols " statement about hemoglobin is not true? A) it is globular b) it contains helix- loop-helix c) it has three subunits d) it has heme groups 3. The molecule which binds in the central cavity of hemoglobin when it is deoxygenated is: a) CO2 b) heme c) BPG d) all of these 4. The transition of hemoglobin from its T-form to its R-form results in: a) Loss of BPG b) Does not result in release of CO2 c) cooperative...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an al...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an alpha-helical structure? Why? 26. A beta strand is a stretch of residues in the extended conformation that can participate in a beta sheet. (In the figure at right, beta strands A and B participate in a two-strand sheet.) What sorts of hydrogen bonds are required for the formation of single beta strands and for the formation of beta sheets? backbone- backbone sidechain...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an al...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an alpha-helical structure? Why? 26. A beta strand is a stretch of residues in the extended conformation that can participate in a beta sheet. (In the figure at right, beta strands A and B participate in a two-strand sheet.) What sorts of hydrogen bonds are required for the formation of single beta strands and for the formation of beta sheets? backbone- backbone sidechain...
6. The following polypeptide (30 amino acids) contains a great deal of regular secondary structure. (10) (15) (20) lys Lys Ala-Phe-Trp-Met-His- GIh-Thr-lle-Arg-Ser-Gly-Ala-Gly-Ser-Gly-Ala-Trp-Tyr-Pro-Val-Ala (30) Phe-Met-Leu-Val-Pro-Glu-Glu There are at least two regions where alpha helical structure is found. Indicate the beginning and ending residues of these regions. Any group or groups which break the alpha helical structure should not be considered part of the helix. Remember that it take four residues to give a turn of an alpha helix, so that is...
22. Consider an alpha helix with sequence VLADWMAVELA, and consider the hydrogen bonds that are required in order to form the alpha helix. A. Fill in all of the hydrogen bonds that must form between a given residue's backbone N-H backbone C-O, or R group, indicating what the hydrogen bonding partner for each will be. For example, the C-O of V1 is a hydrogen bond acceptor of the W5 N-H hydrogen bond donor, reflected in the appropriate squares under V1...
22. Consider an alpha helix with sequence VLADWMAVELA, and consider the hydrogen bonds that are required in order to form the alpha helix. A. Fill in all of the hydrogen bonds that must form between a given residue's backbone N-H backbone C-O, or R group, indicating what the hydrogen bonding partner for each will be. For example, the C-O of V1 is a hydrogen bond acceptor of the W5 N-H hydrogen bond donor, reflected in the appropriate squares under V1...
PRELAB ASSIGNMENT 1 Draw the structure of the amino acid son CH-OH Label the alpha carbon acid Sorine (en) which has R MO CHE OH CH2 OH 2. Draw the dipeptide that forms betw the peptide bond. s between serine and alanine The dipeptide sequence is Ser Ala Lace CH NCH H, A - — сH — с CH2 OH 3. How many amino aci arty amino acid residues are in a polypeptide containing 6 peptide bonos How many peptide...
ter 9. Hemoglobin and Myoglobin Which of these is not found in myoglobin? A) alpha helix b) beta sheetc) heme group, d) globular folding pattern • Which statement about hemoglobin is not true? A) it is globular b) it contains helix loop-helix c) it has three subunits d) it has heme groups · The molecule which binds in the central cavity of hemoglobin when it is deoxygenated is: a) CO2 b) heme c) BPG d) all of these - The...
Which of these is not found in myoglobin? A) alpha helix b) beta sheet c) heme group 1. d) globular folding pattern 2. Which statement about hemoglobin is not true? A) it is globular b) it contains helix- loop-helix c) it has three subunits d) it has heme groups 3. The molecule which binds in the central cavity of hemoglobin when it is deoxygenated is: a) CO2 b) heme c) BPG d) all of these 4. The transition of hemoglobin...
1. Which of these is not found in myoglobin? A) alpha helix b) beta sheet c) heme group d) globular folding pattern 2. Which statement about hemoglobin is not true? A) it is globular b) it contains helix- loop-helix c) it has three subunits d) it has heme groups 3. The molecule which binds in the central cavity of hemoglobin when it is deoxygenated is: a) CO2 b) heme c) BPG d) all of these 4. The transition of hemoglobin...
vols " statement about hemoglobin is not true? A) it is globular b) it contains helix- loop-helix c) it has three subunits d) it has heme groups 3. The molecule which binds in the central cavity of hemoglobin when it is deoxygenated is: a) CO2 b) heme c) BPG d) all of these 4. The transition of hemoglobin from its T-form to its R-form results in: a) Loss of BPG b) Does not result in release of CO2 c) cooperative...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an alpha-helical structure? Why? 26. A beta strand is a stretch of residues in the extended conformation that can participate in a beta sheet. (In the figure at right, beta strands A and B participate in a two-strand sheet.) What sorts of hydrogen bonds are required for the formation of single beta strands and for the formation of beta sheets? backbone- backbone sidechain...
25. Consider two peptide sequences: LKAENDEAARAMSEA and CRAGGFPWDQPGTSN. Which of the two is more likely to adopt an alpha-helical structure? Why? 26. A beta strand is a stretch of residues in the extended conformation that can participate in a beta sheet. (In the figure at right, beta strands A and B participate in a two-strand sheet.) What sorts of hydrogen bonds are required for the formation of single beta strands and for the formation of beta sheets? backbone- backbone sidechain...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 54 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago