Reaction: 3H2(g)+N2(g) ---> 2NH3(g) If the reaction above is first order with respect to N2 and...
Reaction: 3H2(g)+N2(g) ---> 2NH3(g)
If the reaction above is first order with respect to N2 and the reaction rate is 0.040 mol/L*s when the concentration of N2 is 0.10 mol/L what is the reaction rate if the concentration is increased to .20 mols/L? Assume [H2] remains constant.
Homework Answers
Add Answer to:
Reaction: 3H2(g)+N2(g) ---> 2NH3(g)
If the reaction above is first order with respect to N2 and...
Please answer as many questions as you can Thanks 1. For the reaction, N2(g) 3H2(g)2NH3(g). if...
Please answer as many questions as you can
Thanks
1. For the reaction, N2(g) 3H2(g)2NH3(g). if the rate of formation of ammonia is 0.04 mol/L min, find the rate of disappearance of H2 and N2 during that same time period. 2. For the following reaction, 5Br BrO3 6H3Br2 3H20, the rate of consumption of bromide ion at some time was found to be 0.20 mo/L s. What is the rate of formation of water over the same time period? 3....
The equilibrium constant, Kc, for the following reaction is 6.30 at 723K. 2NH3(g) N2(g) + 3H2(g)...
The equilibrium constant, Kc, for the following reaction is 6.30 at 723K. 2NH3(g) N2(g) + 3H2(g) If an equilibrium mixture of the three gases in a 15.7 L container at 723K contains 0.284 mol of NH3(g) and 0.437 mol of N2, the equilibrium concentration of H2 is__________ M.
Calculate KC in terms of molar concentration for the reaction N2(g) + 3H2(g) 2NH3(g) when the...
Calculate KC in terms of molar concentration for the reaction N2(g) + 3H2(g) 2NH3(g) when the equilibrium concentration moles per liter are: N2 = 0.02, H2 = 0.01, NH3 = 0.10.
An industrial chemist is studying the rate of the Haber synthesis: N2 + 3H2 → 2NH3....
An industrial chemist is studying the rate of the Haber synthesis: N2 + 3H2 → 2NH3. Starting with a closed reactor containing 1.25 mol/L of N2 and 0.35 mol/L of H2, she finds that the H2 concentration has fallen to 0.14 mol/L after 20. seconds. What is the average rate of reaction of H2 over this time? (Enter in mol/liter/sec). What is the average rate of NH3 production for this example? (Enter in mol/liter/sec). Estimate the N2 concentration after 20...
The equilibrium constant, K, for the following reaction is 6.30 at 723K. 2NH3(g) N2(g) + 3H2(g)...
The equilibrium constant, K, for the following reaction is 6.30 at 723K. 2NH3(g) N2(g) + 3H2(g) If an equilibrium mixture of the three gases in a 10.1 L container at 723K contains 0.410 mol of NH3(g) and 0.250 mol of N2, the equilibrium concentration of Hy is M.
An industrial chemist is studying the rate of the Haber synthesis: N2 + 3H2 ? 2NH3....
An industrial chemist is studying the rate of the Haber synthesis: N2 + 3H2 ? 2NH3. Starting with a closed reactor containing 1.00 mol/L of N2 and 0.30 mol/L of H2, she finds that the H2 concentration has fallen to 0.16 mol/L after 30. seconds. What is the average rate of reaction of H2 over this time? (Enter in mol/liter/sec). What is the average rate of NH3 production for this example? (Enter in mol/liter/sec). Estimate the N2 concentration after 25...
A student ran the following reaction in the laboratory at 691 K: N2(g) + 3H2(g) 2NH3(g)...
A student ran the following reaction in the laboratory at 691 K: N2(g) + 3H2(g) 2NH3(g) When she introduced 3.69x10-2 moles of N2(g) and 6.11x10-2 moles of H2(g) into a 1.00 liter container, she found the equilibrium concentration of H2(8) to be 5.87*10-2 M. Calculate the equilibrium constant, Kc, she obtained for this reaction. Ko
A student ran the following reaction in the laboratory at 745 K: N2(g) + 3H2(g) 2NH3(g)...
A student ran the following reaction in the laboratory at 745 K: N2(g) + 3H2(g) 2NH3(g) When she introduced 3.44x10-2 moles of N2(g) and 5.80x10-2 moles of H2(g) into a 1.00 liter container, she found the equilibrium concentration of NH3(g) to be 7.82x10-4M. Calculate the equilibrium constant, K., she obtained for this reaction. K=
Consider this reaction: 3H2(g) + N2(g) --> 2NH3(g) First, if 5.00 g of H2 is reacted...
Consider this reaction: 3H2(g) + N2(g) --> 2NH3(g) First, if 5.00 g of H2 is reacted with 21.0 g of N2 determine the identity of the limiting reactant. Second, what theoretical mass of product NH3 would be produced?
1. An industrial chemist is studying the rate of the Haber synthesis: N2 + 3H2 →...
1. An industrial chemist is studying the rate of the Haber synthesis: N2 + 3H2 → 2NH3. Starting with a closed reactor containing 1.15 mol/L of N2 and 0.20 mol/L of H2, she finds that the H2 concentration has fallen to 0.10 mol/L after 20. seconds. What is the average rate of reaction of H2 over this time? (Enter in mol/liter/sec). 2. What is the average rate of NH3 production for this example? (Enter in mol/liter/sec). 3. Estimate the N2...
Please answer as many questions as you can
Thanks
1. For the reaction, N2(g) 3H2(g)2NH3(g). if the rate of formation of ammonia is 0.04 mol/L min, find the rate of disappearance of H2 and N2 during that same time period. 2. For the following reaction, 5Br BrO3 6H3Br2 3H20, the rate of consumption of bromide ion at some time was found to be 0.20 mo/L s. What is the rate of formation of water over the same time period? 3....
The equilibrium constant, K, for the following reaction is 6.30 at 723K. 2NH3(g) N2(g) + 3H2(g) If an equilibrium mixture of the three gases in a 10.1 L container at 723K contains 0.410 mol of NH3(g) and 0.250 mol of N2, the equilibrium concentration of Hy is M.
A student ran the following reaction in the laboratory at 691 K: N2(g) + 3H2(g) 2NH3(g) When she introduced 3.69x10-2 moles of N2(g) and 6.11x10-2 moles of H2(g) into a 1.00 liter container, she found the equilibrium concentration of H2(8) to be 5.87*10-2 M. Calculate the equilibrium constant, Kc, she obtained for this reaction. Ko
A student ran the following reaction in the laboratory at 745 K: N2(g) + 3H2(g) 2NH3(g) When she introduced 3.44x10-2 moles of N2(g) and 5.80x10-2 moles of H2(g) into a 1.00 liter container, she found the equilibrium concentration of NH3(g) to be 7.82x10-4M. Calculate the equilibrium constant, K., she obtained for this reaction. K=
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 29 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago