what does sugar become through reduction? give an example
explain the terminology of omega-6 fatty acid
What happens to the melting point of the fat when cis fatty acid are converted to trans isomers?
Sugar or glucose is an aldehyde in open chain form which on reduction produces alcohol.
D-glucose forms D-glucitol on reduction.
CH2OH-(CHOH)4-CHO=---------CH2OH-(CHOH)4-CH2OH
Omega-6- fatty acids are group of polyunsaturated fatty acids which posses double bond at n=6 position counting from the methyl end.
Example:Linoleic acid
Trans fatty acids have higher melting point due to more closely packed structure which is not present in the cid isomer.
what does sugar become through reduction? give an example explain the terminology of omega-6 fatty acid...
please help me! :)
16. What is the name of the palmitoleate fatty acid above in omega, o notation? C) -9 A) -7 B) -8 D) -10 Page 3 of 10 First Name Dec 10, 2018 17.Which of the following is NOT a difference between the two fatty acids above, palmitoleate and vaccenate? A) they have a different total number of carbons B) they have a different omega, w notation C) one is cis and the other is trans double...
4.81,4.82
Chapter Review 177 481 Are the following compounds structural isomers, cis-trans isomers, or enantiomers? 4.82 Draw the enantiomer of each of the following com- pounds. If the compound is not chiral, state that fact. a. H Η and b. HO Find Br" CH, MF HC Br b. Br но Br. OH w and b. H H-C-H HH H-C-C-C- H C H,CH(CH), c. Che Problems 4.83 Cartat omega-3 fatty acids can be found only in animal sources, such as fatty...
Explain what synchronous rotation is. What is it caused by? Give an example. Answer: Synchronous rotation is when the rotational period of an object is the same as its orbital period around another object. As an object orbits another, it is stretched by the varying force of gravity across it. The resulting tidal bulges lag behind the rotational period becomes the same as the orbital period, at which point there is no longer any tidal friction and the rotational and...
Please explain answers if
possible. Thanks!
6. (4 pts) in the fumaric acid titration, at what volume of NaOH should the missing equivalence point show up? Explain. 7. (4 pts) Explain how the difference in cis and trans arrangements allow the single-deprotonated form of maleic acid to form a hydrogen bond with itself but fumaric acid cannot form a similar hydrogen bond. Volume I'm (dirol) 3.02] তার c.ca d. ০ত্র ||||ভাঙামািিিি িিস্থহিহি pHvo) | pP3 _g g 009 | 0...
Please complete for Tuesday, we will go through the questions and mark them in class. pg 156 - 4.23, 4.24, 4.26 pg 170 - 4.29, 4.31, pg 171-4.36 pg 175 - 4.59 pg 176- 4.74, 4.75, 4.80 pg 177-4.81, 4.82 pg 188- 5.1, 5.4, 5.5, 5.6, 5.11 - Using Table 5.1 pg 198-5.22, 5.25 pg 203 - 5.29 pg 206 - 5.37 pg 209 - 5.39 pg 2.14 5.61 pg 235-6.11, 6.14, 6.16 156 CHAPTER 4 Introduction to Organic Compounds...
Page Chemistry 107 Midterm II Review Problems Draw a Lewis structure for CaHN (think over the bonding preferences of each atom when you lay out the skeleton of this molecule!) 1. CC Determine the geometry at each "central atom" (a) Does this molecule have any polar bonds? Is the entire molecule polar? (b) What will be the dominant intermolecular force in a sample of this compound? (c) (c) If you had 100.0 g of this compound, how many moles would...
please answer what ever you can
3. Name 2 important cations, and state their functions in humans. 4. How many mEq are in 2L of 0.5M NaCl ? 5. How many ml of 2M NaOH would it take to neutralize 20ml of 0.5M HCI ? 6. Draw the structural formula for 3-methyl-1-butanal. 7. Name the following molecule: CH3 - CH2 - CH2 - CH2 - CH2 - CH-OH 8. For the molecular composition, C6H120 draw 2 different isomers. 9. Name...
What are the properties of energy? Give example of electrical, mechanical, chemical, thermal and electromagnetic energies. Explain Faraday’s law of electromagnetic induction. Does the transformer draw any current when its secondary is open? Can 50-Hz Transformers Be Operated at 60 Hz & Vice versa? Suppose that cost of electrical energy is $0.32 per kilowatt hour and that your electrical bill for 30 days is $180. Assume that the power delivered is constant over the entire 30 days. (a) What is...
Postlab Questions Answer the following questions on a separate sheet or in your lab notebook. Make sure that the copy page is readable! D) Calculate the percentage yield for both reactions. Show all calculations. 2) What is the color of the reaction at the beginning of reaction? What causes the color? 3) Why do you dissolve maleic acid in diethyl ether and fumaric acid in water? 4) Give the complete reaction mechanisms for the formation of meso and racemic 2,3-...
1. Which of the following is not considered a nutrient a Vitamin B. Water c.Carbohydrate (d) Alcohol e Mineral 2. For which of the following causes of death does a person's diet play a part? a. Lung disease (6) Cancer Chronic lower respiratory diseases d. Infections of the blood e AIDS 3. Researchers repeatedly report that people who consume a variety of foods such as fruits, vegetables, legumes, nuts, and whole grains have reduced risks of which of the following...