The dissolution of ammonium nitrate (NH4NO3) in water is a classic example of a solute that...
The dissolution of ammonium nitrate (NH4NO3) in water is a classic example of a solute that has an endothermic enthalphy of solution (ΔHsolution). What is (are) the "driving force" (driving forces) for the dissolution of NH4NO3?
| Formation of ion-dipole interactions only. |
| Increasing entropy only. |
| Formation of ion-dipole interactions and decreasing entropy. |
| Formation of dispersion interactions and increasing entropy. |
| Formation of dispersion interactions only |
Homework Answers
Add Answer to:
The dissolution of ammonium nitrate (NH4NO3) in water is a
classic example of a solute that...
How Do I solve question 8, 10 and 13? Activity #1: Dissolution of ammonium nitrate in...
How Do I solve question 8, 10 and 13?
Activity #1: Dissolution of ammonium nitrate in water Fill a 100 ml beaker half-full with water. Place your hand on the outside of the beaker to gauge the temperature Add a large scoop of ammonium nitrate to the beaker and stir. Feel the temperature of the beaker as the ammonium nitrate dissolves. 1. Write the molecular and total ionic equations for the dissolution of ammonium nitrate. MOLECULAR EQUATION: NH4NO3 +H20) NH4OH...
Calculating A Gº NH4NO3(s) + heat → NH4NO3(aq) Is the dissolution of ammonium nitrate product- favored?...
Calculating A Gº NH4NO3(s) + heat → NH4NO3(aq) Is the dissolution of ammonium nitrate product- favored? If so, is it enthalpy- or entropy-driven?
When ammonium nitrate (NH4NO3) dissolves in water, the solution feels cool. Which statements are true? Select...
When ammonium nitrate (NH4NO3) dissolves in water, the solution feels cool. Which statements are true? Select all that apply. The process is endothermic. The attractive forces between solvent and solute particles are weaker than between the particles in the pure substances. The process is exothermic. The attractive forces between solvent and solute particles are stronger than between the particles in the pure substances.
There are a smallpackage of ammonium nitrate (NH4NO3) in water. When the inside bag is broken,...
There are a smallpackage of ammonium nitrate (NH4NO3) in water. When the inside bag is broken, the solute dissolves in the water. This dissolution requires energy and the water cools and freezes. I have done many experiments to find the best packs, and the market leader uses 300 g of the solute and 300 mL of water. It reaches a final temperature of -2 C. If I assume the dissolution processis so fast that it can be modelled as adiabatic,...
The predominant intermolecualr forces that cause the dissolution of sodium chloride in water are?
The predominant intermolecualr forces that cause the dissolution of sodium chloride in water are?London Dispersion ForcesDipole-dipole interactionsHydrogen bondIon-dipole interactions
The dissolution of ammonium nitrate is given by the reaction: NH4NO3 (s) ----> NH4+ (aq) +...
The dissolution of ammonium nitrate is given by the reaction: NH4NO3 (s) ----> NH4+ (aq) + NO3- (aq) Assuming that the values of ΔH° and ΔS° do not change appreciably with temperature, calculate the ΔG° value for the reaction from the polyatomic ion data in standard thermodynamic property tables. ΔG°: -4.1 kJ Predict the lowest temperature at which the reaction is spontaneous. T= _____ degrees Celsius
If the temperature of a solution after the dissolution of ammonium nitrate in 60 mL water...
If the temperature of a solution after the dissolution of ammonium nitrate in 60 mL water drops to 0 oC inside a calorimeter, would the solution freeze? Why or why not?
2019 Fall CHM 111 400 apter 13: Solutions ion-Dissolution of NaCl in water Hint 2. Identify...
2019 Fall CHM 111 400 apter 13: Solutions ion-Dissolution of NaCl in water Hint 2. Identify the different interactions involved Hint 3. Identify the intermolecular force involved between the species Reset Help interactions formed between the sodium ions and the oxygen atoms of water molecules interactions between the ions of sodium chloride Interactions between the water molecules Interactions formed between the chloride ions and the hydrogen atoms of water molecules interactions involving ion-lon attractions interactions involving dipole-dipole attractions Solvent-solvent interactions...
Consider the acid-base nature of ammonium nitrate, NH4NO3, when it is dissolved in water. (1) What...
Consider the acid-base nature of ammonium nitrate, NH4NO3, when it is dissolved in water. (1) What are the acid-base properties of the cation? _________acidic, basic, or neutral (2) What are the acid-base properties of the anion? _________acidic, basic, or neutral (3) Would an aqueous solution of ammonium nitrate be acidic, basic or neutral? _________
5. Calculate the enthalpy of dissolution for ammonium nitrate in water in kJ/mol. Lattice energy the...
5. Calculate the enthalpy of dissolution for ammonium nitrate in water in kJ/mol. Lattice energy the At step, + Alt step, + A H stepe + AH" step, + AH steps a = mx CS AT =110.07(4.184 1(-6.80 9 242,672 J 1 2 86.2 KT ! Data Collection Record your data in an organized manner. See the Data Sheet for Lab 7 as an example. 'he better your ex mass of H2O=139.5lg 40.9sq = 98.56 an ass NHU O: 10g...
How Do I solve question 8, 10 and 13?
Activity #1: Dissolution of ammonium nitrate in water Fill a 100 ml beaker half-full with water. Place your hand on the outside of the beaker to gauge the temperature Add a large scoop of ammonium nitrate to the beaker and stir. Feel the temperature of the beaker as the ammonium nitrate dissolves. 1. Write the molecular and total ionic equations for the dissolution of ammonium nitrate. MOLECULAR EQUATION: NH4NO3 +H20) NH4OH...
Calculating A Gº NH4NO3(s) + heat → NH4NO3(aq) Is the dissolution of ammonium nitrate product- favored? If so, is it enthalpy- or entropy-driven?
2019 Fall CHM 111 400 apter 13: Solutions ion-Dissolution of NaCl in water Hint 2. Identify the different interactions involved Hint 3. Identify the intermolecular force involved between the species Reset Help interactions formed between the sodium ions and the oxygen atoms of water molecules interactions between the ions of sodium chloride Interactions between the water molecules Interactions formed between the chloride ions and the hydrogen atoms of water molecules interactions involving ion-lon attractions interactions involving dipole-dipole attractions Solvent-solvent interactions...
5. Calculate the enthalpy of dissolution for ammonium nitrate in water in kJ/mol. Lattice energy the At step, + Alt step, + A H stepe + AH" step, + AH steps a = mx CS AT =110.07(4.184 1(-6.80 9 242,672 J 1 2 86.2 KT ! Data Collection Record your data in an organized manner. See the Data Sheet for Lab 7 as an example. 'he better your ex mass of H2O=139.5lg 40.9sq = 98.56 an ass NHU O: 10g...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 23 seconds ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 50 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago