Write the expressions for K and Kp for the following reactions: A) CaCO3<------->CaO + CO2 B)...
Write the expressions for K and Kp for the following
reactions:
A) CaCO3<------->CaO + CO2
B) C6H12O6
+6O2<------->6CO2 + 6H2O
Homework Answers
The physical states are mentioned in bracket at reactants and
products chemical formulae. Based on these physical states we can
write expressions for K and Kp
Add Answer to:
Write the expressions for K and Kp for the following
reactions:
A) CaCO3<------->CaO + CO2
B)...
Calculate Kp at 25C for the following reaction: CaCO3(s) - --> CaO + CO2 AG° =...
Calculate Kp at 25C for the following reaction: CaCO3(s) - --> CaO + CO2 AG° = 131.4 k) 53.0 9.3 x 10^-24 0.99 2.5 x 10^-7
16. Given the following reactions CaCO3 (s) → CaO (s) + CO2 (g) ΔH°=178.1 kJ
16. Given the following reactions CaCO3 (s) → CaO (s) + CO2 (g) ΔH°=178.1 kJ C(s, graphite) + O2 (g) → CO2 (g) ΔH°=-393.5 k According to Hess's Law, what is the enthalpy of the reaction (k) for CaCO3(s) → CaO (s)+C(s. graphite) +O2(g)? -571.6 -215.4 5716 215.4 701.2 Question 17 According to the definition of standard enthalpy of formation, ΔH°, which of the following's ΔH° is zero? Question 18Given the data in the table below, calculate the ΔH°rxn (kJ) for the reaction 4NH3(g)+5O2 (g) → 4NO (g)+6H2O (I)
Which of the following reactions is a nonredox reaction? | a) CaCO3 --> CaO + CO2...
Which of the following reactions is a nonredox reaction? | a) CaCO3 --> CaO + CO2 b) 2 KCIO3 ----> 2 KCI + 3 02 c) CaS + H2O --> CaO + 2 H2S d) Zn + CuCl2 ---> ZnCl2 + Cu e) HNO3 + KOH ----> KNO3 + H20 ) ) a) and b) g) b) and c) h) a) and d) i) d) and e) 0 ) a) and c) and e) 4 k) no correct response (i.e....
2) Write the equilibrium constant expressions for each of the following reactions. (For gas-phase reactions, write...
2) Write the equilibrium constant expressions for each of the following reactions. (For gas-phase reactions, write the Ke expression.) a) 2 NO(g) + O2(g) = 2 NO2(g) b) 4 Ag(s) + O2(g) + 2 Ag2O(S) c) CaCO3(s) + CO2(aq) + H2O(l) = Ca2+(aq) + 2 HCO3(aq) 3) a) Write the K, expressions for reactions a and b in problem 2. b) If the value of K for reaction a in problem 2 is 2.8 x 1011 at 200°C, what is...
At what temperature is the following reaction feasible: CaCO3 -> CaO + CO2? Enthalpy data: CaCO3:...
At what temperature is the following reaction feasible: CaCO3 -> CaO + CO2? Enthalpy data: CaCO3: -1207 kJ/mol CaO: -635 kJ/mol CO2: -394 kJ/mol Entropy data: CaCO3: +93 J/K mol CaO: +40 J/K mol CO2:+214 J/K mol
3. Given Koor Kp for the following reactions, what is the value of Koor K? (a)...
3. Given Koor Kp for the following reactions, what is the value of Koor K? (a) 12 (g) + Cl2 (g) = 2ICI (9) Kc = 2.0 x105 at 25°C (b) N204 () = 2NO2(g) ; K = 0.90 at 120 °C (c) CaCO3 (s) : CaO (s) + CO2 (g) Kp = 1.67 x 102 at 740 °C
At 900 °C, K = 0.0108 for the reaction CaCO3(8) F CaO(s) + CO2(g) A mixture...
At 900 °C, K = 0.0108 for the reaction CaCO3(8) F CaO(s) + CO2(g) A mixture of CaCO3, CaO, and CO2 is placed in a 10.0-L vessel at 900 °C. For the following mixtures, will the amount of CaCO3 increase, decrease, or remain the same as the system approaches equilibrium? Part A 15.0 g CaCO3, 15.0 g CaO, and 4.25g CO2 increases decreases O remains the same Submit Request Answer Part B 2.50g CaCO3, 25.0 g CaO, and 5.66 g...
e. -1135 Given the following reactions: CaCO3 (s)-> Cao (s) + CO2 (g) C (s, graphite)...
e. -1135 Given the following reactions: CaCO3 (s)-> Cao (s) + CO2 (g) C (s, graphite) + O2 (g)-> Co2 (g) AH-393.5 kJ the enthalpy of the reaction CaCO3 (s) -> CaO (s) + C (s, graphite) + O2 (g) ΔH = 178.1 kJ is kJ Select one: 4 a. 7.01 x 10 b. 571.6 ) c. 215.4 d. -215.4 ie. -571.6 Check Given the data in the table below, AH for the reaction
solid CaCo3 is heated and decomposes into solid CaO and CO2 gas. suppose a limekiln of...
solid CaCo3 is heated and decomposes into solid CaO and CO2 gas. suppose a limekiln of volume 600 L is pressurized with CO2 to 4.4 atm and is heated 580.0 degrees celsius. When the amount of CO2 has stopped changing, it is found that 1.72 kg of CaCO3 have appeared. Calculate the pressure equilibrium constant Kp this experiment suggests for the equilibrium between CaCO3 and CaO at 580.0 degrees celsius. thanks!
What temperature must the reaction be above in order to become spontaneous? CaCO3(s)CaO(s)+CO2(9) AHor (CaCO3)-1207.6 k]/mol...
What temperature must the reaction be above in order to become spontaneous? CaCO3(s)CaO(s)+CO2(9) AHor (CaCO3)-1207.6 k]/mol So (CaCO3) 91.7 J/mol K AHof (CaO)-35.09 kJ/mol S° (CaO) 38.2 J/mol K AHor (CO2)-393.51 kJ/mol So (CO2)213.74 J/mol K
Calculate Kp at 25C for the following reaction: CaCO3(s) - --> CaO + CO2 AG° = 131.4 k) 53.0 9.3 x 10^-24 0.99 2.5 x 10^-7
Which of the following reactions is a nonredox reaction? | a) CaCO3 --> CaO + CO2 b) 2 KCIO3 ----> 2 KCI + 3 02 c) CaS + H2O --> CaO + 2 H2S d) Zn + CuCl2 ---> ZnCl2 + Cu e) HNO3 + KOH ----> KNO3 + H20 ) ) a) and b) g) b) and c) h) a) and d) i) d) and e) 0 ) a) and c) and e) 4 k) no correct response (i.e....
2) Write the equilibrium constant expressions for each of the following reactions. (For gas-phase reactions, write the Ke expression.) a) 2 NO(g) + O2(g) = 2 NO2(g) b) 4 Ag(s) + O2(g) + 2 Ag2O(S) c) CaCO3(s) + CO2(aq) + H2O(l) = Ca2+(aq) + 2 HCO3(aq) 3) a) Write the K, expressions for reactions a and b in problem 2. b) If the value of K for reaction a in problem 2 is 2.8 x 1011 at 200°C, what is...
3. Given Koor Kp for the following reactions, what is the value of Koor K? (a) 12 (g) + Cl2 (g) = 2ICI (9) Kc = 2.0 x105 at 25°C (b) N204 () = 2NO2(g) ; K = 0.90 at 120 °C (c) CaCO3 (s) : CaO (s) + CO2 (g) Kp = 1.67 x 102 at 740 °C
At 900 °C, K = 0.0108 for the reaction CaCO3(8) F CaO(s) + CO2(g) A mixture of CaCO3, CaO, and CO2 is placed in a 10.0-L vessel at 900 °C. For the following mixtures, will the amount of CaCO3 increase, decrease, or remain the same as the system approaches equilibrium? Part A 15.0 g CaCO3, 15.0 g CaO, and 4.25g CO2 increases decreases O remains the same Submit Request Answer Part B 2.50g CaCO3, 25.0 g CaO, and 5.66 g...
e. -1135 Given the following reactions: CaCO3 (s)-> Cao (s) + CO2 (g) C (s, graphite) + O2 (g)-> Co2 (g) AH-393.5 kJ the enthalpy of the reaction CaCO3 (s) -> CaO (s) + C (s, graphite) + O2 (g) ΔH = 178.1 kJ is kJ Select one: 4 a. 7.01 x 10 b. 571.6 ) c. 215.4 d. -215.4 ie. -571.6 Check Given the data in the table below, AH for the reaction
What temperature must the reaction be above in order to become spontaneous? CaCO3(s)CaO(s)+CO2(9) AHor (CaCO3)-1207.6 k]/mol So (CaCO3) 91.7 J/mol K AHof (CaO)-35.09 kJ/mol S° (CaO) 38.2 J/mol K AHor (CO2)-393.51 kJ/mol So (CO2)213.74 J/mol K
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago