The following equilibrium exists between molecular and atomic oxygen: O2 <-> 2O Kp=1.2x10^-10 at 1800k If...
The following equilibrium exists between molecular and atomic oxygen:
O2 <-> 2O Kp=1.2x10^-10 at 1800k
If 2 moles of O2 is placed in a 10L flask and heated to 1800k, how many O atoms would be present in the flask at equilibrium
answer 2..4x10^18 atoms. Thank you
Homework Answers
Add Answer to:
The following equilibrium exists between molecular and atomic
oxygen:
O2 <-> 2O Kp=1.2x10^-10 at 1800k
If...
2C +02 2Pb + O2 → 2CO) → 2P50) Eqs. 7.1 reactants products CH, + 2O...
2C +02 2Pb + O2 → 2CO) → 2P50) Eqs. 7.1 reactants products CH, + 2O + co, + 2H2O methane oxygen water C: carbon dioxide C: H: 2 x 2 O: 2 + 2 H: 4 4 1 = 4 = 4 O: 2 x 2 = Figure 7.4. A balanced chemical reaction with stoichiometric conventions noted. Question 7.4. Balance the following chemical reactions: a) CH4 +_2_02 _CO2 + 2 H20 b) CH-OH + 02 → CO2 + H2O...
Chem 101 Sec 14 Summer 2019 10. What coefficient is placed in front of O, to...
Chem 101 Sec 14 Summer 2019 10. What coefficient is placed in front of O, to balance the following equation for the combustion of propane? 6CO, + 8H:O O 2C3Hg + a. 6 b. 8 c. 10 d. 20 True or False? Any molecule with polar bonds will be a polar molecule... 11. 12. When writing the Lewis Dot structure for O2 (oxygen gas), how many valence electrons should you start with? a. 2 b. 6 c. 8 d. 12...
A. Classify each of the following reactions as decomposition, combination, combustion, 2CH3OH(l)+3O2(g)→2CO2(g)+4H2O(g) 2KClO3(s)→2KCl(s)+3O2(g) S(s)+3F2(g)→SF6(g) CaO(s)+H2O(l)→Ca(OH)2(aq) 2Cu(NO3)2(s)→2CuO(s)+4NO2(g)+O2(g)...
A. Classify each of the following reactions as decomposition, combination, combustion, 2CH3OH(l)+3O2(g)→2CO2(g)+4H2O(g) 2KClO3(s)→2KCl(s)+3O2(g) S(s)+3F2(g)→SF6(g) CaO(s)+H2O(l)→Ca(OH)2(aq) 2Cu(NO3)2(s)→2CuO(s)+4NO2(g)+O2(g) B. Solid aluminum metal and diatomic chlorine gas react spontaneously to form a solid product. Give the balanced chemical equation (including phases) that describes this reaction. Indicate the phases using abbreviation (s), (l), or (g) for solid, liquid, or gas, respectively. Express your answer as a chemical equation. C. When heated, solid copper(II) carbonate decomposes to solid copper(II) oxide and carbon dioxide gas. Give...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has its own characteristic atom in which a. the atomic mass is constant. b. the atomic number is constant. c. the mass number is constant. d. Two of the above are correct. e. All of the above are correct. 2. Which of the following is not a trace element in the human body? a. iodine b. zinc c. iron d. calcium e. fluorine 3. A...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the question. 1) 1) One mole of any substance contains Avogadro's number of particles of that substance. What is the numerical value of Avogadro's number? A) 12.01 23 Avagrans t Male aton 6022 x1o atums B) 6.022 x 1023 C) 6.022 x 10-23 D) 1.661 x10-24 E) 1.00 x10-14 2) What is the mass of 4.00 moles of helium, the gas commonly used to fill...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
1. Which of the following are the sites within the human body where carbon dioxide and...
1. Which of the following are the sites within the human body where carbon dioxide and oxygen are exchanged? A. Alveoli B. Arteries C. Synapses D. Venules 2. Which of the following describes the most important reason for repeating an experimental investigation? A. To verify the validity of the original findings B. To expand upon the original investigation C. To manipulate the independent variable D. To attempt to disprove the hypothesis 3. Lithium has an atomic number of 3 and...
It's a weak acid strong base titration Experiment 4: Identification of an unknown acid by titration...
It's a weak acid strong base titration
Experiment 4: Identification of an unknown acid by titration Page 2 of 15 Background In this experiment, you will use both qualitative and quantitative properties to determine an unknown acid's identity and concentration. To do this analysis, you will perform a titration of your unknown acid sample-specifically a potentiometric titration where you use a pH meter and record pH values during the titration, combined with a visual titration using a color indi- cator...
1. According to the paper, what does lactate dehydrogenase (LDH) do and what does it allow...
1. According to the paper, what does lactate dehydrogenase
(LDH) do and what does it allow to happen within the myofiber? (5
points)
2. According to the paper, what is the major disadvantage of
relying on glycolysis during high-intensity exercise? (5
points)
3. Using Figure 1 in the paper, briefly describe the different
sources of ATP production at 50% versus 90% AND explain whether you
believe this depiction of ATP production applies to a Type IIX
myofiber in a human....
2C +02 2Pb + O2 → 2CO) → 2P50) Eqs. 7.1 reactants products CH, + 2O + co, + 2H2O methane oxygen water C: carbon dioxide C: H: 2 x 2 O: 2 + 2 H: 4 4 1 = 4 = 4 O: 2 x 2 = Figure 7.4. A balanced chemical reaction with stoichiometric conventions noted. Question 7.4. Balance the following chemical reactions: a) CH4 +_2_02 _CO2 + 2 H20 b) CH-OH + 02 → CO2 + H2O...
Chem 101 Sec 14 Summer 2019 10. What coefficient is placed in front of O, to balance the following equation for the combustion of propane? 6CO, + 8H:O O 2C3Hg + a. 6 b. 8 c. 10 d. 20 True or False? Any molecule with polar bonds will be a polar molecule... 11. 12. When writing the Lewis Dot structure for O2 (oxygen gas), how many valence electrons should you start with? a. 2 b. 6 c. 8 d. 12...
e. 18 Test Your Knowledge MULTIPLE CHOICE: Choose the one best answer. 1. Each element has its own characteristic atom in which a. the atomic mass is constant. b. the atomic number is constant. c. the mass number is constant. d. Two of the above are correct. e. All of the above are correct. 2. Which of the following is not a trace element in the human body? a. iodine b. zinc c. iron d. calcium e. fluorine 3. A...
Exam Name MULTIPLE CHOICE. Choose the one alternative that best completes the statement or answers the question. 1) 1) One mole of any substance contains Avogadro's number of particles of that substance. What is the numerical value of Avogadro's number? A) 12.01 23 Avagrans t Male aton 6022 x1o atums B) 6.022 x 1023 C) 6.022 x 10-23 D) 1.661 x10-24 E) 1.00 x10-14 2) What is the mass of 4.00 moles of helium, the gas commonly used to fill...
4.30. Using solubility rules, predict the solubility in water of the following ionic compounds. a. AI(OH) b. CaN C. NH4CI d. KOH 4.32. Using solubility rules, decide whether the following ionic solids are soluble or insoluble in water. If they are soluble, write the chemical equation for dissolving in water and indicate what ions you would expect to be present in solution. (NE SO b. BaCO c. Pb(NOs)2 d. Ca(OH) 4.34. Write net ionic equations for the following molecular equations....
It's a weak acid strong base titration
Experiment 4: Identification of an unknown acid by titration Page 2 of 15 Background In this experiment, you will use both qualitative and quantitative properties to determine an unknown acid's identity and concentration. To do this analysis, you will perform a titration of your unknown acid sample-specifically a potentiometric titration where you use a pH meter and record pH values during the titration, combined with a visual titration using a color indi- cator...
1. According to the paper, what does lactate dehydrogenase
(LDH) do and what does it allow to happen within the myofiber? (5
points)
2. According to the paper, what is the major disadvantage of
relying on glycolysis during high-intensity exercise? (5
points)
3. Using Figure 1 in the paper, briefly describe the different
sources of ATP production at 50% versus 90% AND explain whether you
believe this depiction of ATP production applies to a Type IIX
myofiber in a human....
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago