The oxidation number of the Mn atom in the MnO4-1 ion is _____. a) +1 b)...
The oxidation number of the Mn atom in the MnO4-1 ion is _____.
a) +1
b) +3
c) +5
d) +7
46. The oxidation number of _____.
a) Any atom in its elementary state is 1
b) Any simple ion is the charge on the ion
c) Oxygen is always -1
d) Hydrogen is always -1
Homework Answers
Add Answer to:
The oxidation number of the Mn atom in the MnO4-1 ion is
_____.
a) +1
b)...
Write the complete electronic configurations for the neutral manganese atom, Mn ion and the manganese ion...
Write the complete electronic configurations for the neutral manganese atom, Mn ion and the manganese ion in MnO. Comment on the relationship between the colors of the MnO. and Mn2 and the electronic configurations. 4. The following reaction was performed for the determination of oxalate in the green salt: 5. 5 CO (aq)+ 2 MnO (ag) + 16 H"(ag)-10 CO:) + 2 Mn (ag) + 8 H:O Determine the oxidation states of all atoms. a. b. Identify the oxidizing and...
Oxidation States 12 of 14 > Neutral compounds In a neutral compound, the sum of the...
Oxidation States 12 of 14 > Neutral compounds In a neutral compound, the sum of the oxidation states is zero. Note that the sign of the oxidation states and the number of atoms associated with each oxidation state must be considered. In H20, for example, each hydrogen atom has an oxidation state of +1 and each oxygen atom has an oxidation state of -2 for a total nstant Oxidation states are important for keeping track of electrons in oxidation-reduction reactions....
Sudent Name: EXP #6: PRE-LAB EXERCISE 1. Find the charge (also called oxidation number) of the...
Sudent Name: EXP #6: PRE-LAB EXERCISE 1. Find the charge (also called oxidation number) of the metal atom in each of the following nstructor Name: polyatomie ions or compounds (hint! Oxygen is always-2). a) dichromate ion, CrO b) chromate ion, Cro c) arsenate ion, AsO 2. Balance the following redox reactions. The second one is broken up into separate oxidation and reduction "half reactions in order to assist you (hinr See page I) Orxidation Reduction 3. In the question above,...
1&2 1) Identify the oxidation state of each element in the following. (a) Na2SO4 (b) MnO4...
1&2
1) Identify the oxidation state of each element in the following. (a) Na2SO4 (b) MnO4 (c) KClO3 (d) CH OH 2) Identify the oxidation state of nitrogen in each of the following (a) NO:- (b) NO2 (c) NO2 (d) HNO2 (e) NO (1) N20 (g) N2 (h) NH2OH () N2H4
1.) In each part, assign the oxidation state (oxidation number) of each atom in the following...
1.) In each part, assign the oxidation state (oxidation number) of each atom in the following molecul ons: a. i.) Na:SO ) NaNO k.) KCIO 1.) SOCI: (S is central atom) m.) CIF -Z b.) C2H2 c.) C2H d.) CCl e.) HO f.) HCO, g.) PO,3 h.) LiBr n.) B2H o.) HS p.) CN
1. [Mn(H2O)6]2* Draw the possible stereoisomers. Give the oxidation state of the metal. Identify the donor...
1. [Mn(H2O)6]2* Draw the possible stereoisomers. Give the oxidation state of the metal. Identify the donor atoms. Draw the structure of the transition metal complex ion. Show the charge on the complex. Determine if its paramagnetic. State whether the complex is high-spin or low-spin. Draw the ground state arrangement of the d-electrons. Calculate the LFSE (in units of A or AT) for each complex.
C. N2O4 (1) Oxidation number of Nitrogen (2) Oxidation number of Oxygen D. NaH (1) Oxidation...
C. N2O4 (1) Oxidation number of Nitrogen (2) Oxidation number of Oxygen D. NaH (1) Oxidation number of Sodium (2) Oxidation number of Hydrogen
The oxidation number of an element is the "charge" the element would have if all of...
The oxidation number of an element is the "charge" the element would have if all of its bonds were completely ionic; that is, if the electron pairs of each bond were transferred to the more electronegative atom. For monatomic ions the oxidation number is simply the charge of the ion. For covalently bonded elements the oxidation number is a bookkeeping device and does not mean that the element carries an actual charge. Determine the oxidation state for each of the...
Identify the atom or ion corresponding to each of the following descriptions (a) An atom with gro...
Identify the atom or ion corresponding to each of the following descriptions (a) An atom with ground-state electron configuration [Xej4f145d1°6s'6p1 Atom symbol b) An ion with charge 12 and ground-state elctron configuration Kr (b) An ion with charge +2 and ground-state electron c d10s2 Ion symbol- (c) An ion with charge -1 and ground-state electron configuration [Ne]3s23p6 Ion symbol-
Identify the atom or ion corresponding to each of the following descriptions (a) An atom with ground-state electron configuration [Xej4f145d1°6s'6p1 Atom...
what is the oxidation state for the carbon atom (a) and the carbon atom (b) labelled...
what is the
oxidation state for the carbon atom (a) and the carbon atom (b)
labelled in the structure of the caffeine molecule shown
below?
What is the oxidation state for the carbon atom (a) and the carbon atom (b) A36. labelled in structure of the caffeine molecule shown below? a. N b. N a. +3 and b. +2 (A) (B) a. +2 and b. = 0 (C) a. =-3 and b. = -2 a. +1 and b. = -2...
Write the complete electronic configurations for the neutral manganese atom, Mn ion and the manganese ion in MnO. Comment on the relationship between the colors of the MnO. and Mn2 and the electronic configurations. 4. The following reaction was performed for the determination of oxalate in the green salt: 5. 5 CO (aq)+ 2 MnO (ag) + 16 H"(ag)-10 CO:) + 2 Mn (ag) + 8 H:O Determine the oxidation states of all atoms. a. b. Identify the oxidizing and...
Oxidation States 12 of 14 > Neutral compounds In a neutral compound, the sum of the oxidation states is zero. Note that the sign of the oxidation states and the number of atoms associated with each oxidation state must be considered. In H20, for example, each hydrogen atom has an oxidation state of +1 and each oxygen atom has an oxidation state of -2 for a total nstant Oxidation states are important for keeping track of electrons in oxidation-reduction reactions....
Sudent Name: EXP #6: PRE-LAB EXERCISE 1. Find the charge (also called oxidation number) of the metal atom in each of the following nstructor Name: polyatomie ions or compounds (hint! Oxygen is always-2). a) dichromate ion, CrO b) chromate ion, Cro c) arsenate ion, AsO 2. Balance the following redox reactions. The second one is broken up into separate oxidation and reduction "half reactions in order to assist you (hinr See page I) Orxidation Reduction 3. In the question above,...
1&2
1) Identify the oxidation state of each element in the following. (a) Na2SO4 (b) MnO4 (c) KClO3 (d) CH OH 2) Identify the oxidation state of nitrogen in each of the following (a) NO:- (b) NO2 (c) NO2 (d) HNO2 (e) NO (1) N20 (g) N2 (h) NH2OH () N2H4
1.) In each part, assign the oxidation state (oxidation number) of each atom in the following molecul ons: a. i.) Na:SO ) NaNO k.) KCIO 1.) SOCI: (S is central atom) m.) CIF -Z b.) C2H2 c.) C2H d.) CCl e.) HO f.) HCO, g.) PO,3 h.) LiBr n.) B2H o.) HS p.) CN
1. [Mn(H2O)6]2* Draw the possible stereoisomers. Give the oxidation state of the metal. Identify the donor atoms. Draw the structure of the transition metal complex ion. Show the charge on the complex. Determine if its paramagnetic. State whether the complex is high-spin or low-spin. Draw the ground state arrangement of the d-electrons. Calculate the LFSE (in units of A or AT) for each complex.
Identify the atom or ion corresponding to each of the following descriptions (a) An atom with ground-state electron configuration [Xej4f145d1°6s'6p1 Atom symbol b) An ion with charge 12 and ground-state elctron configuration Kr (b) An ion with charge +2 and ground-state electron c d10s2 Ion symbol- (c) An ion with charge -1 and ground-state electron configuration [Ne]3s23p6 Ion symbol-
Identify the atom or ion corresponding to each of the following descriptions (a) An atom with ground-state electron configuration [Xej4f145d1°6s'6p1 Atom...
what is the
oxidation state for the carbon atom (a) and the carbon atom (b)
labelled in the structure of the caffeine molecule shown
below?
What is the oxidation state for the carbon atom (a) and the carbon atom (b) A36. labelled in structure of the caffeine molecule shown below? a. N b. N a. +3 and b. +2 (A) (B) a. +2 and b. = 0 (C) a. =-3 and b. = -2 a. +1 and b. = -2...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 35 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago