If someone from a sea level area goes to Cuzco, Peru, why would this person be...
If someone from a sea level area goes to Cuzco, Peru, why would this person be gasping for air? Explain what is happening in terms of respiration and how is that an example of Le Chetaliers principle? Please explain in details and chemical equation. Thanks.
Homework Answers
- The city of cuzco is located more than 3000 meters over the sea level.
- At 5260 meters the atmosphere holds 53% as much oxygen as the air sea level .
- if we will go above the concentration of oxygen in air will be less.
- the chemical reaction for respiration-: oxygen+glucose - water+carbon dioxide+energy
- according to LE CHATELIERS PRINCEPLE if we raise the concentration of reactant the equilibrium shift towards right.and if we decrease the concentration of reactant the equilibrium shift towards left.
- in this case the concentration of oxygen is decreasing so the less energy produced and less will be the respiration process.
Add Answer to:
If someone from a sea level area goes to Cuzco, Peru, why would
this person be...
When a person who lives at sea level travels to a high altitude, they are moving...
When a person who lives at sea level travels to a high altitude, they are moving to an area with a lower atmospheric pressure. The number of oxygen molecules in a breath is the same, but there is lower partial pressure of oxygen; thus the lower air pressure results in less diffusion of oxygen into the blood for each breath compared to a breath at sea level. How would this change in oxygen availability affect the person’s heart rate and...
Could someone please explain the logistic growth equation. and how you would include a second species...
Could someone please explain the logistic growth equation. and how you would include a second species to it. Please provide an example of it. Thanks in advance!
Cite a theory that would explain why you helped or walked away from someone in need....
Cite a theory that would explain why you helped or walked away from someone in need. why did you walk away or why did you help that person?
4. Using your knowledge of Le Chatelier's principle and the given equation, explain why an excess of acetic a...
4. Using your knowledge of Le Chatelier's principle and the given equation, explain why an excess of acetic acid is used in this experiment. 5. If water was added as the solvent in this reaction would this shift the equilibrium in the desired direction to form more of the product (the ester)? Explain using the given equation and LaChatelier's principle. Alcoho 6. In the two chemical structures below, identify each of the following functional groups as either carboxylic ester, carboxylic...
Learning Goal: Develop problem-solving skills wing chemical equilibria and oplying Le Chatter's principle Solving problems with...
Learning Goal: Develop problem-solving skills wing chemical equilibria and oplying Le Chatter's principle Solving problems with chemical equilibrium If you know the basic principles of chemical equilibrium, you can analyze and predict reversible reactions. To analyze any reversible reaction, follow these problem-solving steps: 1. Identify the reactants and products for the given chemical reaction. 2. Draw a diagram of the reaction to better understand what is happening 3. Identify how increasing or decreasing a product or reactant stresses the equilibrium...
Q: Would like to clearly understand and solve this example from Modern Algebra II with the...
Q: Would like to clearly understand and solve this example from Modern Algebra II with the steps of the solution to better understand, thanks. **Please explain and give the step by step with details to completely see how the solution came about, plenty of thanks. 1) Determine which of the polynomials below is or are irreducible over Q. a) x^4 + 3x^2 + 3. b) x^5 + 5x^2 + 1.
Can someone please help with these questions, thanks... Chapter 14 1. Define heat. 2. (T/F) Heat...
Can someone please help with these questions, thanks...
Chapter 14 1. Define heat. 2. (T/F) Heat is fundamentally different from 3. Define mechanical equivalent of heat 4. What is the difference between temperature and heat? 5. Why doe 6. Does the temperature of a substance change during a phase chang 7. Sketch Fig. 14.7 8. Can energy, explain. s a phase change require energy transfer? e? substance? evaporation and condensation happen below the boiling point of a What limitations does...
PSY278: Week 7 Assignment Page 1 Course Project: Lifespan Development Project Deliverable #2: The Person and...
PSY278: Week 7 Assignment Page 1 Course Project: Lifespan Development Project Deliverable #2: The Person and the Theory Assignment Overview This week, you will look for a news story on an individual and describe the lifespan developmental stage/age the individual is experiencing. Thinking like a developmentalist, you will apply concepts from the book and describe what may have contributed to this person's situation. Please note: You have this week and next to complete this project deliverable. It is due at...
There was a car accident. Someone stopped and the person behind them rear ended them. The...
There was a car accident. Someone stopped and the person
behind them rear ended them. The car that stopped slid away about
30 feet and the car that did the rear ending stopped right about
where the collision happened. Was this a perfectly inelastic
collision? Why or why not?
A perfectly elastic collision is one in which kinetic
energy is conserved. How exactly is kinetic energy not conserved
though? Sometime KE can be used up compressing/bending things and
making heat,...
4. Using your knowledge of Le Chatelier's principle and the given equation, explain why an excess of acetic acid is used in this experiment. 5. If water was added as the solvent in this reaction would this shift the equilibrium in the desired direction to form more of the product (the ester)? Explain using the given equation and LaChatelier's principle. Alcoho 6. In the two chemical structures below, identify each of the following functional groups as either carboxylic ester, carboxylic...
Learning Goal: Develop problem-solving skills wing chemical equilibria and oplying Le Chatter's principle Solving problems with chemical equilibrium If you know the basic principles of chemical equilibrium, you can analyze and predict reversible reactions. To analyze any reversible reaction, follow these problem-solving steps: 1. Identify the reactants and products for the given chemical reaction. 2. Draw a diagram of the reaction to better understand what is happening 3. Identify how increasing or decreasing a product or reactant stresses the equilibrium...
Can someone please help with these questions, thanks...
Chapter 14 1. Define heat. 2. (T/F) Heat is fundamentally different from 3. Define mechanical equivalent of heat 4. What is the difference between temperature and heat? 5. Why doe 6. Does the temperature of a substance change during a phase chang 7. Sketch Fig. 14.7 8. Can energy, explain. s a phase change require energy transfer? e? substance? evaporation and condensation happen below the boiling point of a What limitations does...
PSY278: Week 7 Assignment Page 1 Course Project: Lifespan Development Project Deliverable #2: The Person and the Theory Assignment Overview This week, you will look for a news story on an individual and describe the lifespan developmental stage/age the individual is experiencing. Thinking like a developmentalist, you will apply concepts from the book and describe what may have contributed to this person's situation. Please note: You have this week and next to complete this project deliverable. It is due at...
There was a car accident. Someone stopped and the person
behind them rear ended them. The car that stopped slid away about
30 feet and the car that did the rear ending stopped right about
where the collision happened. Was this a perfectly inelastic
collision? Why or why not?
A perfectly elastic collision is one in which kinetic
energy is conserved. How exactly is kinetic energy not conserved
though? Sometime KE can be used up compressing/bending things and
making heat,...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 47 seconds ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 23 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago