Homework Answers
Add Answer to:
2. Determine the error associated with the following ah)e-be calculation: (c-e a 8.5 0.5, b 5.008...
The sales tax rate in San Francisco, USA is 8.5%. For a given purchase, the amount of taxes paid is rounded to the nearest cent. Denote the rounding error by interval-0.5 to 0.5, where the rounding e...
The sales tax rate in San Francisco, USA is 8.5%. For a given purchase, the amount of taxes paid is rounded to the nearest cent. Denote the rounding error by interval-0.5 to 0.5, where the rounding error is the difference between the rounded value and the actual value. a. What is the probability that the rounding error is less than 0.2? OA. 0.7 O B. 0.3 O C. 0.2 O D. 0.5 OE. 0.8 and assume that it is uniform...
34. The phase changes B-C and D - E are not associated with temperature increases because...
34. The phase changes B-C and D - E are not associated with temperature increases because the heat energy (q) is consumed to A) increase distances between molecules B) break intramolecular bonds C) rearrange atoms within molecules D) increase the density of the sample gas liquid and gas TOC solid and liquid liquid B solid Heat added (1) 35. Which of these is a weak base? A) NaOH B) HCI E) CH3CH2OH C) Naci D) NH 36. When discussing energy...
a. b. Consider the follow equations: A+B →D AH° = -70.0 kJ E +2 F →...
a.
b.
Consider the follow equations: A+B →D AH° = -70.0 kJ E +2 F → A AH° = -20.0 kJ C + E +2D AH° = -300.0 kJ Calculate the AHⓇ for the reaction: C+2 F → 3 A +2 B Calculate the enthalpy of reaction for the process: D+FG+M A + B + C +G AH° = 100.0 kJ AC+F AH° = -300.0 kJ D+M+B AH° = -150.0 kJ
Find the absolute error D for the calculation if A + B/C=D A= 9.4 +/- 0.4...
Find the absolute error D for the calculation if A + B/C=D A= 9.4 +/- 0.4 B= 30 +/- 6 C= 13.97 +/- 0.02 All errors are absolute errors.
7 Consider the following reaction at 298 K: NH3(g) +HCI(g)NH4CI(s) Using the thermochemical data at 298 K given below (a) Determine the AH for the reaction. (2 marks) (b) Determine the AG for the...
7 Consider the following reaction at 298 K: NH3(g) +HCI(g)NH4CI(s) Using the thermochemical data at 298 K given below (a) Determine the AH for the reaction. (2 marks) (b) Determine the AG for the reaction and comment on its value. (3 marks) (c) Determine the maximum work done available in the reaction. (3 marks) An equilibrium mixture, consisting of 0.5 atm of NHy(), 0.5 atm of HCKg) and excessive of NH Cl(s), is enclosed in a container at 298 K...
How many milliliters is 0.005 L? A. 0.5 mL B. 5 mL C. 0.50 mL E....
How many milliliters is 0.005 L? A. 0.5 mL B. 5 mL C. 0.50 mL E. 200 mL Iron has a density of 7.86 g/cm^3. The volume occupied by 55.85 g of iron is A. 0.141 cm^3 B. 7.11 cm^3 C. 2.8 cm^3 D. 439 cm^3 E. None of the above Express the number 0.000053 in scientific notation. A. 5.3 times 10^-2 B. 5.3 times 10^-3 C. 5.3 times 10^-4 D. 5.3 times 10^-5 E. 5.3 times 10^-6 The number...
Problem 2. For the following system, (a) compute the eigenvalues, (b) compute the associated eigenvectors, (c)...
Problem 2. For the following system, (a) compute the eigenvalues, (b) compute the associated eigenvectors, (c) if the eigenvalues are complex, determine if the origin is a spiral sink, a spiral source, or a center; determine the natural period and natural frequency of the oscillations, and determine the direction of the oscillations in the phase plane, (d) sketch the phase portrait for the system; and (e) compute the general solution dY (1 -2
1. (3pts) Use the following data to determine the AH.. of 2 C Hig) + 13...
1. (3pts) Use the following data to determine the AH.. of 2 C Hig) + 13 0_(g) ---> 8 CO(g) + 5 H2O(1) 12-15 -11053 -28583 Data: Substance AH”(kJ/mol Substance AH (kJ/mol) CH.(g) CH,OH(1) C.Hog) C.H () H2O(g) CO(g) O(g) 20.9 -239.0 -126.15 -156.4 -241.82 -110.53 CH:(9) CH,OH() CsH (8) CH(1) H2O(1) CO2 N:(9) -104.0 -201.0 -146.44 + 12.0 -285.83 -393.51 -24 2.(2pts) If you are given 88.0 g 0 (g) and a sufficient amount of the other reactant, calculate...
2. Determine 2. Determine AH for the reaction C3H4(g) + 2H2(g) -> information; (3 Hy+aha a)...
2. Determine 2. Determine AH for the reaction C3H4(g) + 2H2(g) -> information; (3 Hy+aha a) H2(g) +H202()→ H2O() b) C3H4(e) + 4028) 3C029) + 2H2O c) C3H8(g) + 502(8)> 3CO2(g) + 4H20m) for derestin. Selain has siven the fi C3H8(e) given the following (z Hg AH = -285.8 kJ AH = -1941 kJ AH = -2219.9 kJ
(9) A spontaneous process has the change of free energy (a) AG > 0 (b) AG <0 (c) AG = 0 (d) AH >0 and AS &...
(9) A spontaneous process has the change of free energy (a) AG > 0 (b) AG <0 (c) AG = 0 (d) AH >0 and AS <0 (10) A chemical reaction has AH = 10 kJ, AS = 50 J/K at temperature T = 300 K, the reaction AG = (a) 5000 (b)-5000 (c) 10000 (d) 50 (11) For reaction : Ag (s) + 1/2 Cl2 (g) = Agt (aq) + CI+ (aq), the standard free energy of formation: AGE"...
The sales tax rate in San Francisco, USA is 8.5%. For a given purchase, the amount of taxes paid is rounded to the nearest cent. Denote the rounding error by interval-0.5 to 0.5, where the rounding error is the difference between the rounded value and the actual value. a. What is the probability that the rounding error is less than 0.2? OA. 0.7 O B. 0.3 O C. 0.2 O D. 0.5 OE. 0.8 and assume that it is uniform...
34. The phase changes B-C and D - E are not associated with temperature increases because the heat energy (q) is consumed to A) increase distances between molecules B) break intramolecular bonds C) rearrange atoms within molecules D) increase the density of the sample gas liquid and gas TOC solid and liquid liquid B solid Heat added (1) 35. Which of these is a weak base? A) NaOH B) HCI E) CH3CH2OH C) Naci D) NH 36. When discussing energy...
a.
b.
Consider the follow equations: A+B →D AH° = -70.0 kJ E +2 F → A AH° = -20.0 kJ C + E +2D AH° = -300.0 kJ Calculate the AHⓇ for the reaction: C+2 F → 3 A +2 B Calculate the enthalpy of reaction for the process: D+FG+M A + B + C +G AH° = 100.0 kJ AC+F AH° = -300.0 kJ D+M+B AH° = -150.0 kJ
7 Consider the following reaction at 298 K: NH3(g) +HCI(g)NH4CI(s) Using the thermochemical data at 298 K given below (a) Determine the AH for the reaction. (2 marks) (b) Determine the AG for the reaction and comment on its value. (3 marks) (c) Determine the maximum work done available in the reaction. (3 marks) An equilibrium mixture, consisting of 0.5 atm of NHy(), 0.5 atm of HCKg) and excessive of NH Cl(s), is enclosed in a container at 298 K...
How many milliliters is 0.005 L? A. 0.5 mL B. 5 mL C. 0.50 mL E. 200 mL Iron has a density of 7.86 g/cm^3. The volume occupied by 55.85 g of iron is A. 0.141 cm^3 B. 7.11 cm^3 C. 2.8 cm^3 D. 439 cm^3 E. None of the above Express the number 0.000053 in scientific notation. A. 5.3 times 10^-2 B. 5.3 times 10^-3 C. 5.3 times 10^-4 D. 5.3 times 10^-5 E. 5.3 times 10^-6 The number...
Problem 2. For the following system, (a) compute the eigenvalues, (b) compute the associated eigenvectors, (c) if the eigenvalues are complex, determine if the origin is a spiral sink, a spiral source, or a center; determine the natural period and natural frequency of the oscillations, and determine the direction of the oscillations in the phase plane, (d) sketch the phase portrait for the system; and (e) compute the general solution dY (1 -2
1. (3pts) Use the following data to determine the AH.. of 2 C Hig) + 13 0_(g) ---> 8 CO(g) + 5 H2O(1) 12-15 -11053 -28583 Data: Substance AH”(kJ/mol Substance AH (kJ/mol) CH.(g) CH,OH(1) C.Hog) C.H () H2O(g) CO(g) O(g) 20.9 -239.0 -126.15 -156.4 -241.82 -110.53 CH:(9) CH,OH() CsH (8) CH(1) H2O(1) CO2 N:(9) -104.0 -201.0 -146.44 + 12.0 -285.83 -393.51 -24 2.(2pts) If you are given 88.0 g 0 (g) and a sufficient amount of the other reactant, calculate...
2. Determine 2. Determine AH for the reaction C3H4(g) + 2H2(g) -> information; (3 Hy+aha a) H2(g) +H202()→ H2O() b) C3H4(e) + 4028) 3C029) + 2H2O c) C3H8(g) + 502(8)> 3CO2(g) + 4H20m) for derestin. Selain has siven the fi C3H8(e) given the following (z Hg AH = -285.8 kJ AH = -1941 kJ AH = -2219.9 kJ
(9) A spontaneous process has the change of free energy (a) AG > 0 (b) AG <0 (c) AG = 0 (d) AH >0 and AS <0 (10) A chemical reaction has AH = 10 kJ, AS = 50 J/K at temperature T = 300 K, the reaction AG = (a) 5000 (b)-5000 (c) 10000 (d) 50 (11) For reaction : Ag (s) + 1/2 Cl2 (g) = Agt (aq) + CI+ (aq), the standard free energy of formation: AGE"...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 27 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 58 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago