Homework Answers
Add Answer to:
4. continued: 0) 1) Mg /anhydrous Eto Br 2bubble in dry CO, 1) NaCN/NaHSO (excess)/ Δ 1) NaCN/NaH...
K2Cr207 (excess) H2SO4, H2O HO OH u. 1. PhLi, Et20 2. HCI, H2O 3. SOCl2, Etz 4. NaOAC 1. Mg (1 eq), Et20 Br 2. i (1 eq)...
K2Cr207 (excess) H2SO4, H2O HO OH u. 1. PhLi, Et20 2. HCI, H2O 3. SOCl2, Etz 4. NaOAC 1. Mg (1 eq), Et20 Br 2. i (1 eq) -CHO 3. HCI, H20 1. NaBH4, MeOH, 0°C 2. PBr3, THE 3. LiAID4, THE 4. HCI, H2O x. 1. SOCI, NEtz, THE CHO 2. 2 eq Li, hexane 3. HCI, H2O hint: multiple steps 1. LiAIHA, THE 2. HCI, H20 3. PBrz, THE a1. 1. PCC, DCM OH 2. Mg, Et20 3....
18. Draw the structures of Compound 18a. and 18b. (18 pts), clearly indicate your assignments of...
18. Draw the structures of Compound 18a. and 18b. (18 pts), clearly indicate your assignments of all proton resonances (8 pts). Calculate the Unsaturation Index of each compound (4 pts) (30 points total) 30 Unsat. Index = (2C+2-H-X+NY2 = 200 25 e = 2.00 ppm, 4.90 f = 1.27 ppm, 20 720 Compound 18a: C,H,O, singlet, 2H triplet, 3H 127 15 d = 2.66 ppm, a = 7.21 ppm, b = 7.18 ppm, doublet, 2H doublet, 2H C = 4.90...
thanks! For compound 18a the signal "e" is not 2H it is 3H, this was a...
thanks! For compound 18a the signal "e" is not 2H it is 3H, this
was a typo
18. Draw the structures of Compound 18a. and 18b. (18 pts), clearly indicate your assignments of all proton resonances (8 pts). Calculate the Unsaturation Index of each compound (4 pts) (30 points total) Unsat. Index = (2C+2-H-X +N)/2 = 3.0 2.00 25 490 2.0 e = 2.00 ppm. singlet, 2H d = 2.66 ppm, quartet, 2H f = 1.27 ppm, triplet, 3H 720...
17 18 12 13 15 16 5 14 2 3 4 6 7 10 11 1 He 1 H 2 N O F Ne Li Be Na Mg $3 Si CI Ar Al Cr Mn Fe Co Ca Sc Ni Cu Zn 4...
17 18 12 13 15 16 5 14 2 3 4 6 7 10 11 1 He 1 H 2 N O F Ne Li Be Na Mg $3 Si CI Ar Al Cr Mn Fe Co Ca Sc Ni Cu Zn 4 K Ti V Ga Ge As Se Br Kr Sr Y Zr Nb Mo Tc Ru Rh Pd Ag Cd In Sn Sb Te 5 Rb Xe 6 Cs Ba La WRe Os Ir Au Hg TI...
Thanks! On each the following IR spectra, circle and indicate the most important stretching signal from...
Thanks!
On each the following IR spectra, circle and indicate the most important stretching signal from the following choices:N-H, O-H, CEN, CEO, C-O, Top, IR spectrum of Compound 18a: C14H1402 Bottom, IR Spectrum of Compound 18b: C3H120. write your answer on the corresponding square provided (2.5 pts each, 5 pts total) mar 2000 6 18. Draw the structures of Compound 18a. and 18b. (18 pts), clearly indicate your assignments of all proton resonances (8 pts). Calculate the Unsaturation Index of...
practice questions ③ show the product on products Expected for the reactions below a) + CH₃OH...
practice questions
③ show the product on products Expected for the reactions below a) + CH₃OH alcohol c-c-c aldehyde c-c-c acid C b) 014 + CH3 CH alcohol ÖH c) -10 kmnog LOH heat (Excess) cox - Bonus! 0: CEN: d) -10- H₂ Pd/c. (Excess H2) (Red) H -Bones! e) ÖH ć. + -10 alcohol он acid croch Grid x + CH₃ CH₂ 0 4 (drohol) -10 NH₂ 3 continued - show prodoct (s) رخ دن 2) 15 PH:10 NaOH...
thanks!! There is a mistake on this, e on compound 18a is 3 hydrogens not 2!!!!...
thanks!! There is a mistake on this, e on compound 18a is 3
hydrogens not 2!!!! thanks again :)
On each the following IR spectra, circle and indicate the most important stretching signal from the following choices:N-H, O-H, CEN, CEO, C-O, Top, IR spectrum of Compound 18a: C14H1402 Bottom, IR Spectrum of Compound 18b: C3H120. write your answer on the corresponding square provided (2.5 pts each, 5 pts total) mar 2000 6 18. Draw the structures of Compound 18a. and...
What is the equilibrium constant for each of the following reactions? Use the standard reduction potentials in these Re...
What is the equilibrium constant for each of the following
reactions? Use the standard reduction potentials in these Reference
Tables.
(a) 2 Cu1+(aq) → Cu(s) + Cu2+(aq)
(b) 3 Tl1+(aq) + Al(s) → 3 Tl(s) + Al3+(aq)
(c) 2 H1+(aq) + Sn(s) → H2(g) + Sn2+(aq)
13 1.49 F2 +2e-2F Age - Ag Coco H.0 +2 2e -2 .0 PO, + 4H+So, +2-PSO2H0 MnO' + 4H+3c-MO, 2 H,0 CA 2H+10 +26-10, 2 H 0 B.0, 6He r +3H-0...
practice complely the follow, + NaOH following (Fill in the Blanks (ose wnds carboxylic Acid +...
practice
complely the follow, + NaOH following (Fill in the Blanks (ose wnds carboxylic Acid + Amine water carboxylic Aad & Alcohol Carboxylic Acid water Esten + H₂O + tre hydrolysis? Amide + H₂O titre hydedlysis Show the reagent / reagents needed to make the following molecolar conversions. Show reagent (s) to the right. Seach=40 HC=CH₂ HC-CH₃ 4 ة= SH please note: the is an aromated ring. It does not atlect the chemistry Hocao 0 ÖzçēH (oxidation? bacco in there...
4. Only ideal processes can be thermodynamically "reversible." Why can rear proce y can real process...
4. Only ideal processes can be thermodynamically "reversible." Why can rear proce y can real processes not be? 5. Consider the following reactions. (Note: if this were an exam we would give you an excerpt on tabular data from Appendix 4 (Table A4.3). 2Fe(s) + 3Cla(s) 2FeCl(s) N2H4(8) + H2(g) + 2NH3(g) (a) Would you expect the entropy change for the above reaction to be >0, <0, or no (small)? Justify your answer. (d) Would you expect the entropy change...
K2Cr207 (excess) H2SO4, H2O HO OH u. 1. PhLi, Et20 2. HCI, H2O 3. SOCl2, Etz 4. NaOAC 1. Mg (1 eq), Et20 Br 2. i (1 eq) -CHO 3. HCI, H20 1. NaBH4, MeOH, 0°C 2. PBr3, THE 3. LiAID4, THE 4. HCI, H2O x. 1. SOCI, NEtz, THE CHO 2. 2 eq Li, hexane 3. HCI, H2O hint: multiple steps 1. LiAIHA, THE 2. HCI, H20 3. PBrz, THE a1. 1. PCC, DCM OH 2. Mg, Et20 3....
18. Draw the structures of Compound 18a. and 18b. (18 pts), clearly indicate your assignments of all proton resonances (8 pts). Calculate the Unsaturation Index of each compound (4 pts) (30 points total) 30 Unsat. Index = (2C+2-H-X+NY2 = 200 25 e = 2.00 ppm, 4.90 f = 1.27 ppm, 20 720 Compound 18a: C,H,O, singlet, 2H triplet, 3H 127 15 d = 2.66 ppm, a = 7.21 ppm, b = 7.18 ppm, doublet, 2H doublet, 2H C = 4.90...
thanks! For compound 18a the signal "e" is not 2H it is 3H, this
was a typo
18. Draw the structures of Compound 18a. and 18b. (18 pts), clearly indicate your assignments of all proton resonances (8 pts). Calculate the Unsaturation Index of each compound (4 pts) (30 points total) Unsat. Index = (2C+2-H-X +N)/2 = 3.0 2.00 25 490 2.0 e = 2.00 ppm. singlet, 2H d = 2.66 ppm, quartet, 2H f = 1.27 ppm, triplet, 3H 720...
17 18 12 13 15 16 5 14 2 3 4 6 7 10 11 1 He 1 H 2 N O F Ne Li Be Na Mg $3 Si CI Ar Al Cr Mn Fe Co Ca Sc Ni Cu Zn 4 K Ti V Ga Ge As Se Br Kr Sr Y Zr Nb Mo Tc Ru Rh Pd Ag Cd In Sn Sb Te 5 Rb Xe 6 Cs Ba La WRe Os Ir Au Hg TI...
Thanks!
On each the following IR spectra, circle and indicate the most important stretching signal from the following choices:N-H, O-H, CEN, CEO, C-O, Top, IR spectrum of Compound 18a: C14H1402 Bottom, IR Spectrum of Compound 18b: C3H120. write your answer on the corresponding square provided (2.5 pts each, 5 pts total) mar 2000 6 18. Draw the structures of Compound 18a. and 18b. (18 pts), clearly indicate your assignments of all proton resonances (8 pts). Calculate the Unsaturation Index of...
practice questions
③ show the product on products Expected for the reactions below a) + CH₃OH alcohol c-c-c aldehyde c-c-c acid C b) 014 + CH3 CH alcohol ÖH c) -10 kmnog LOH heat (Excess) cox - Bonus! 0: CEN: d) -10- H₂ Pd/c. (Excess H2) (Red) H -Bones! e) ÖH ć. + -10 alcohol он acid croch Grid x + CH₃ CH₂ 0 4 (drohol) -10 NH₂ 3 continued - show prodoct (s) رخ دن 2) 15 PH:10 NaOH...
thanks!! There is a mistake on this, e on compound 18a is 3
hydrogens not 2!!!! thanks again :)
On each the following IR spectra, circle and indicate the most important stretching signal from the following choices:N-H, O-H, CEN, CEO, C-O, Top, IR spectrum of Compound 18a: C14H1402 Bottom, IR Spectrum of Compound 18b: C3H120. write your answer on the corresponding square provided (2.5 pts each, 5 pts total) mar 2000 6 18. Draw the structures of Compound 18a. and...
What is the equilibrium constant for each of the following
reactions? Use the standard reduction potentials in these Reference
Tables.
(a) 2 Cu1+(aq) → Cu(s) + Cu2+(aq)
(b) 3 Tl1+(aq) + Al(s) → 3 Tl(s) + Al3+(aq)
(c) 2 H1+(aq) + Sn(s) → H2(g) + Sn2+(aq)
13 1.49 F2 +2e-2F Age - Ag Coco H.0 +2 2e -2 .0 PO, + 4H+So, +2-PSO2H0 MnO' + 4H+3c-MO, 2 H,0 CA 2H+10 +26-10, 2 H 0 B.0, 6He r +3H-0...
practice
complely the follow, + NaOH following (Fill in the Blanks (ose wnds carboxylic Acid + Amine water carboxylic Aad & Alcohol Carboxylic Acid water Esten + H₂O + tre hydrolysis? Amide + H₂O titre hydedlysis Show the reagent / reagents needed to make the following molecolar conversions. Show reagent (s) to the right. Seach=40 HC=CH₂ HC-CH₃ 4 ة= SH please note: the is an aromated ring. It does not atlect the chemistry Hocao 0 ÖzçēH (oxidation? bacco in there...
4. Only ideal processes can be thermodynamically "reversible." Why can rear proce y can real processes not be? 5. Consider the following reactions. (Note: if this were an exam we would give you an excerpt on tabular data from Appendix 4 (Table A4.3). 2Fe(s) + 3Cla(s) 2FeCl(s) N2H4(8) + H2(g) + 2NH3(g) (a) Would you expect the entropy change for the above reaction to be >0, <0, or no (small)? Justify your answer. (d) Would you expect the entropy change...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 26 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 7 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago