Show the polymer that would form from propylene oxide (methyl oxirane or 1,2-epoxypropane) using ...
Show the polymer that would form from propylene oxide (methyl oxirane or 1,2-epoxypropane) using an base catalyst (or base initiator). Give the mechanism for three rounds of each using NaNH2as the initiator. Pay attention to regioselectivity.
Homework Answers
Add Answer to:
Show the polymer that would form from propylene oxide (methyl oxirane or 1,2-epoxypropane) using ...
can you explain this Propylene oxide (2-methyloxirane or 1,2-epoxypropane) can be converted to 1,2-propanediol by the...
can you explain this
Propylene oxide (2-methyloxirane or 1,2-epoxypropane) can be converted to 1,2-propanediol by the action of either dilute acid or base in water. When optically active (R)-(+)-propylene oxide is used, the 1,2-propanediol obtained from the acid hydrolysis (HO) has an optical rotation opposite from the alkaline hydrolysis (OH, H2O). Write the stepwise mechanism of each hydrolysis that is likely to explain these facts. Use curved arrows to show the flow of electrons. OH Enantiomers но opposite optical rotation...
need help with 7and8 dont know how to do Propylene oxide (2-methyloxirane or 1,2-epoxypropane) can be...
need help with 7and8 dont know how to do
Propylene oxide (2-methyloxirane or 1,2-epoxypropane) can be converted to 1,2-propanediol by the 7. action of either dilute acid or base in water. When optically active (R)-(+)-propylene oxide is used, the 1,2-propanediol obtained from the acid hydrolysis (HsO) has an optical rotation opposite from the alkaline hydrolysis (OH, H20). Write the stepwise mechanism of each hydrolysis that is likely to explain these facts. Use curved arrows to show the flow of electrons....
Give the polymer notation for the polymer that would form from the monomer: 2-methyl-2-butene.
Give the polymer notation for the polymer that would form from the monomer: 2-methyl-2-butene.
Hc VCH Draw the organic product formed when CH3CH2CH2OH is treated with each reagent. a H2S04 (180°C) d SOC12, pyri...
Hc VCH Draw the organic product formed when CH3CH2CH2OH is treated with each reagent. a H2S04 (180°C) d SOC12, pyridine Ig 1) NaH; 2) CH3CH2Br b NaH e PBr3 h 1) TSCI, pyridine; 2) NaSH c HBr f TsCl, pyridine 3. Draw the organic product formed when l-methylcyclohexanol is treaded with each reagent. In some cases, no reaction occurs. a KH c HBr Te NaHCO3 b Nacid HCI f 1) KH; 2) CH3CH2Br Draw two different routes to each of...
Regioselectivity of E1 and E2 Reactions 3. The reaction between a 1,2-dimethylcyclohexanol and concentrated strong acid...
Regioselectivity of E1 and E2 Reactions 3. The reaction between a 1,2-dimethylcyclohexanol and concentrated strong acid results in an E1 reaction. Show the first step in this reaction (consider that the acid catalyst can protonate the OH group which eventually can form H2O that can act as a good leaving group). а. сн, OH conc.H2SO4 CH3 b. What is the geometry at the reaction center of the intermediate? Show the final step and all possible alkene products с. State the...
How many products would you expect from the reaction of (S)-2-methylcyclohexanone with methyl magnesium bromide (include...
How many products would you expect from the reaction of (S)-2-methylcyclohexanone with methyl magnesium bromide (include the stereoisomers)? Draw the stereoisomers of the product and specify the relationship between them. Following is a cyclic acetal formed from cyclohexanone. What are the reagents required for this reaction? Also write a stepwise mechanism for the formation of this acetal from cyclohexanone. Show how to synthesize the following compounds using a Wittig reaction. Design the synthesis of compound A (5-(1-hydroxycyclohexyl)pentan-2-one) starting from cyclohexanone...
Show how you would synthesize each compound from benzene, toluene, or phenol using the following reactions:...
Show how you would synthesize each compound from benzene, toluene, or phenol using the following reactions: Reactions 1. Halogenation 2. Nitration 3. Sulfonation 4. Friedel-Crafts acylation 5. Friedel-Crafts alkylation 6. Oxidation of methyl group 7. Reduction of nitro group • Choose the starting material from the drop-down list • Enter the number(s) of the desired reactions in the order that you wish to use them without commas between • If a reaction is used more than once, enter its number...
Evaluate log5625 using the following methods. By switching from logarithmic to exponential form By cancelling the...
Evaluate log5625 using the following methods. By switching from logarithmic to exponential form By cancelling the base with the log base By using the "change of base" rule Simplify and evaluate each of the following expressions using the laws of logarithms. log62+log618 log4256+log42−log48 log2128−3log24 Solve each of the following equations. logx81=2 log12x=3 log7(2x−5)=3 Task 2: Thinking questions Use systematic trial and error to evaluate log35. A culture of bacteria doubles every three hours. The initial culture contains 500 bacteria. How...
[01] Give all three termination steps (using structures) for a radical chain reaction monochlorination (Clh/hv) of...
[01] Give all three termination steps (using structures) for a radical chain reaction monochlorination (Clh/hv) of cyclopropane to give chlorocyclopropane 1. 2. [01] a. Give the resulting structure from the following electron flow. b. Give the curved arrows on structure at left to indicate the electron flow in going to the resonance structure on the right. Be precise. 3. [O1] Give the structure of the major product for the following reaction as well as the two allylic resonance structures from...
2. Draw the structure of the byproduct that would be formed if the reaction mixture were...
2. Draw the structure of the byproduct that would be formed if the reaction mixture were not kept in an ice bath during the azo coupling reaction. [2 pts) Methyl orange can be synthesized using an azo coupling reaction, which is an example of an electrophilic aromatic substitution (EAS). In an azo coupling, the electrophile is an aryldiazonium salt, and the nucleophile is another electron-rich aromatic compound (typically an aniline or phenol). In this experiment, sulfanilic acid will be converted...
can you explain this
Propylene oxide (2-methyloxirane or 1,2-epoxypropane) can be converted to 1,2-propanediol by the action of either dilute acid or base in water. When optically active (R)-(+)-propylene oxide is used, the 1,2-propanediol obtained from the acid hydrolysis (HO) has an optical rotation opposite from the alkaline hydrolysis (OH, H2O). Write the stepwise mechanism of each hydrolysis that is likely to explain these facts. Use curved arrows to show the flow of electrons. OH Enantiomers но opposite optical rotation...
need help with 7and8 dont know how to do
Propylene oxide (2-methyloxirane or 1,2-epoxypropane) can be converted to 1,2-propanediol by the 7. action of either dilute acid or base in water. When optically active (R)-(+)-propylene oxide is used, the 1,2-propanediol obtained from the acid hydrolysis (HsO) has an optical rotation opposite from the alkaline hydrolysis (OH, H20). Write the stepwise mechanism of each hydrolysis that is likely to explain these facts. Use curved arrows to show the flow of electrons....
Hc VCH Draw the organic product formed when CH3CH2CH2OH is treated with each reagent. a H2S04 (180°C) d SOC12, pyridine Ig 1) NaH; 2) CH3CH2Br b NaH e PBr3 h 1) TSCI, pyridine; 2) NaSH c HBr f TsCl, pyridine 3. Draw the organic product formed when l-methylcyclohexanol is treaded with each reagent. In some cases, no reaction occurs. a KH c HBr Te NaHCO3 b Nacid HCI f 1) KH; 2) CH3CH2Br Draw two different routes to each of...
Regioselectivity of E1 and E2 Reactions 3. The reaction between a 1,2-dimethylcyclohexanol and concentrated strong acid results in an E1 reaction. Show the first step in this reaction (consider that the acid catalyst can protonate the OH group which eventually can form H2O that can act as a good leaving group). а. сн, OH conc.H2SO4 CH3 b. What is the geometry at the reaction center of the intermediate? Show the final step and all possible alkene products с. State the...
How many products would you expect from the reaction of (S)-2-methylcyclohexanone with methyl magnesium bromide (include the stereoisomers)? Draw the stereoisomers of the product and specify the relationship between them. Following is a cyclic acetal formed from cyclohexanone. What are the reagents required for this reaction? Also write a stepwise mechanism for the formation of this acetal from cyclohexanone. Show how to synthesize the following compounds using a Wittig reaction. Design the synthesis of compound A (5-(1-hydroxycyclohexyl)pentan-2-one) starting from cyclohexanone...
Show how you would synthesize each compound from benzene, toluene, or phenol using the following reactions: Reactions 1. Halogenation 2. Nitration 3. Sulfonation 4. Friedel-Crafts acylation 5. Friedel-Crafts alkylation 6. Oxidation of methyl group 7. Reduction of nitro group • Choose the starting material from the drop-down list • Enter the number(s) of the desired reactions in the order that you wish to use them without commas between • If a reaction is used more than once, enter its number...
[01] Give all three termination steps (using structures) for a radical chain reaction monochlorination (Clh/hv) of cyclopropane to give chlorocyclopropane 1. 2. [01] a. Give the resulting structure from the following electron flow. b. Give the curved arrows on structure at left to indicate the electron flow in going to the resonance structure on the right. Be precise. 3. [O1] Give the structure of the major product for the following reaction as well as the two allylic resonance structures from...
2. Draw the structure of the byproduct that would be formed if the reaction mixture were not kept in an ice bath during the azo coupling reaction. [2 pts) Methyl orange can be synthesized using an azo coupling reaction, which is an example of an electrophilic aromatic substitution (EAS). In an azo coupling, the electrophile is an aryldiazonium salt, and the nucleophile is another electron-rich aromatic compound (typically an aniline or phenol). In this experiment, sulfanilic acid will be converted...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 16 seconds ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 49 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago