Homework Answers
Add Answer to:
Post-Lab Questions: Pottn your rankings in Data Analysis Table 4, predict whether the following reactions will be ontaneous. Write the balanced net ionic equations for those which will occur. a)...
7. Predict the products and write a balanced net ionic equation for the following reactions: Tin(II)...
7. Predict the products and write a balanced net ionic equation for the following reactions: Tin(II) chloride is added to potassium permanganate solution in acidic conditions. a. b. Zinc dust is treated with dilute nitric acid, forming ammonium ions. Potassium permanganate oxidizes the oxalate ions in calcium oxalate to carbon dioxide C. in an acidic solution. 6-72 Chemistry 141 Grossmont College
Writing Balanced Molecular, Ionic, And Net Ionic Equations Write Balanced Net-Ionic Equations for the following Reactions...
Writing Balanced Molecular, Ionic, And Net Ionic Equations Write Balanced Net-Ionic Equations for the following Reactions in Aqueous Solution: 1. Copper metal (Cu(s)) is immersed in an aqueous solution of silver nitrate (AgNO3). The solution turns light blue and a silver coating appears on the copper. 2. Dilute solutions of antimony(III) chloride and sodium sulfide are mixed to give a precipitate. 3. Dilute solutions of silver nitrate and potassium iodide are combined and give a yellow precipitate. 4. Dilute solutions...
Write correct balanced molecular, total ionic, and net ionic equations for the reactions that occur when...
Write correct balanced molecular, total ionic, and net ionic equations for the reactions that occur when the following substances are mixed. All are in aqueous solution except as noted. 1) magnesium chloride and sodium carbonate 2) aqueous ammonia and acetic acid
Write balanced molecular, total ionic, and net ionic equations for the following aqueous single-displacement reactions....
Write balanced molecular, total ionic, and net ionic equations
for the following aqueous single-displacement reactions.
(5 points) Write balanced molecular, total ionic, and net ionic equations for the following aqueous single- 3. displacement reactions. Also tell what is oxidized and what is reduced in each. aluminum + iron(l) nitrate a. Molecular: Total lonic Net lonic Reduced: Oxidized: acetic acid+ tin, which forms the tin(ll) ion in these reactions b. Molecular: Total lonic: Net lonic: Reduced: Oxidized: zinc+ gold(iIlI) chloride C....
4.96 Predict the product(s) and write a balanced equation for each of the following redox reactions:...
4.96 Predict the product(s) and write a balanced equation for each of the following redox reactions: (a) Pentane (C-H12) + oxygen – (b) Phosphorus trichloride + chlorine → (c) Zinc + hydrobromic acid (d) Aqueous potassium iodide + bromine (e) Write a balanced net ionic equation for (d). Solid aluminum metal reacts with chlorine gas to produce solid aluminum chloride crystals. Assuming 100% yield, how many grams of aluminum chloride crystals will be produced if there are 61.5 grams of...
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions...
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions are mixed. Include the physical states. A. silver nitrate, AgNO3, and magnesium bromide, MgBr, net ionic equation: B. perchloric acid, HCIO , and potassium hydroxide, KOH net ionic equation: C. ammonium sulfide, (NH),S, and cobalt(II) chloride, COCI, net ionic equation:
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions...
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions are mixed. Include the physical states. A. silver nitrate, AgNO3 , and magnesium bromide, MgBr2 net ionic equation: B. perchloric acid, HClO4 , and potassium hydroxide, KOH net ionic equation: C. ammonium sulfide, (NH4)2S , and cobalt(II) chloride, CoCl2 net ionic equation:
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions...
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions are mixed. Include the physical states. A. silver nitrate, AgNO, and magnesium bromide, MgBr net ionic equation: B. perchloric acid, HCIO, and potassium hydroxide, KOH net ionic equation: C. ammonium sulfide, (NH),S, and cobalt(II) chloride, CoCl, net ionic equation:
Write the balanced equations (all three types) for the reactions that occur when the following aqueous...
Write the balanced equations (all three types) for the reactions that occur when the following aqueous solutions are mixed. (Use the lowest possible coefficients. Include states-of-matter under the given conditions in your answer.) molecular equation: complete ionic equation: net ionic equation: (a)perchloric acid [HClO4(aq)] and iron(III) hydroxide. (b) ammonia (aqueous) and hydroiodic acid. (c) calcium hydroxide (aqueous) and hydrochloric acid. (d) solid silver hydroxide and hydrochloric acid
4.4 Post-Lab Write balanced net ionic equations for the reactions, if any, that occur between the...
4.4 Post-Lab Write balanced net ionic equations for the reactions, if any, that occur between the following: Part A Fe, S3 (8) and H Br(aq) If no reaction occurs, write NONE in the box. -- ALQ R O a ? Fe, S, (s) + 6HBr(aq) →2FeBrz (aq) + 3H, S(g) Submit Previous Answers Request Answer X Incorrect; Try Again; 5 attempts remaining Part B Complete previous part(s) How many grams of each of the following substances will dissolve in 4.55x10mL...
7. Predict the products and write a balanced net ionic equation for the following reactions: Tin(II) chloride is added to potassium permanganate solution in acidic conditions. a. b. Zinc dust is treated with dilute nitric acid, forming ammonium ions. Potassium permanganate oxidizes the oxalate ions in calcium oxalate to carbon dioxide C. in an acidic solution. 6-72 Chemistry 141 Grossmont College
Write balanced molecular, total ionic, and net ionic equations
for the following aqueous single-displacement reactions.
(5 points) Write balanced molecular, total ionic, and net ionic equations for the following aqueous single- 3. displacement reactions. Also tell what is oxidized and what is reduced in each. aluminum + iron(l) nitrate a. Molecular: Total lonic Net lonic Reduced: Oxidized: acetic acid+ tin, which forms the tin(ll) ion in these reactions b. Molecular: Total lonic: Net lonic: Reduced: Oxidized: zinc+ gold(iIlI) chloride C....
4.96 Predict the product(s) and write a balanced equation for each of the following redox reactions: (a) Pentane (C-H12) + oxygen – (b) Phosphorus trichloride + chlorine → (c) Zinc + hydrobromic acid (d) Aqueous potassium iodide + bromine (e) Write a balanced net ionic equation for (d). Solid aluminum metal reacts with chlorine gas to produce solid aluminum chloride crystals. Assuming 100% yield, how many grams of aluminum chloride crystals will be produced if there are 61.5 grams of...
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions are mixed. Include the physical states. A. silver nitrate, AgNO3, and magnesium bromide, MgBr, net ionic equation: B. perchloric acid, HCIO , and potassium hydroxide, KOH net ionic equation: C. ammonium sulfide, (NH),S, and cobalt(II) chloride, COCI, net ionic equation:
Write the balanced net ionic equation for the reactions that occur when the given aqueous solutions are mixed. Include the physical states. A. silver nitrate, AgNO, and magnesium bromide, MgBr net ionic equation: B. perchloric acid, HCIO, and potassium hydroxide, KOH net ionic equation: C. ammonium sulfide, (NH),S, and cobalt(II) chloride, CoCl, net ionic equation:
4.4 Post-Lab Write balanced net ionic equations for the reactions, if any, that occur between the following: Part A Fe, S3 (8) and H Br(aq) If no reaction occurs, write NONE in the box. -- ALQ R O a ? Fe, S, (s) + 6HBr(aq) →2FeBrz (aq) + 3H, S(g) Submit Previous Answers Request Answer X Incorrect; Try Again; 5 attempts remaining Part B Complete previous part(s) How many grams of each of the following substances will dissolve in 4.55x10mL...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 14 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago