1. How would using double the volume of hydrochloric acid have affected the empirical formula of zinc chloride? 2. Suppose that you had not driven off all the water from the zinc chloride. How would t...
1. How would using double the volume of hydrochloric acid have affected the empirical formula of zinc chloride?
2. Suppose that you had not driven off all the water from the zinc chloride. How would this error have affected the empirical formula for zinc chloride?
Homework Answers
Your tool of choice here will be the mole ratio that exists between zinc metal, Zn, and hydrochloric acid, :HCl, in the balanced chemical equation.
Zn(s]+2HCl(aq]→ZnCl2(aq]+H2(g]↑⏐
You're dealing with a single replacement reaction in which zinc displaces the hydrogen from hydrochloric acid. The products of the reaction are aqueous zinc chloride and hydrogen gas.
Now, as you can see from the balance chemical equation, a 1:2 mole ratio exists between the two reactants.
Add Answer to:
1. How would using double the volume of hydrochloric acid have affected the empirical formula of zinc chloride? 2. Suppose that you had not driven off all the water from the zinc chloride. How would t...
1. How would using double the volume of hydrochloric acid have affected the empirical formula of...
1. How would using double the volume of hydrochloric acid have affected the empirical formula of zinc chloride? 2. Suppose that you had not driven off all the water from the zinc chloride. How would this error have affected the empirical formula for zinc chloride?
1. How would you determine if you have heated the sample long enough to drive off...
1. How would you determine if you have heated the sample long enough to drive off all the water from the hydrate? 2. A compound is made of 30.9% of Cu, 13.6 % Si, and 55.5% F. a. What is the empirical formula of the anhydrous salt? b. 1.00 gram of this compound is subject to high moisture environment. The resulting hydrate weighs 1.53 grams. What is the formula of the hydrate?
()UESTIONS 1. If you had used a different mass of magnesium metal, would you expect the...
()UESTIONS 1. If you had used a different mass of magnesium metal, would you expect the empirical formula of the compound to be the same? Explain. 2. If you had omitted steps 12 and 13 from the experiment, how would this omission have affected your results in terms of the empirical formula of the magnesium oxide? In other words, would the ratio of the magnesium to the oxygen have been greater or less than the obtained ratio? 3. From the...
Post-Lab Questions: 1. If you had a solution which contained only chloride, bromide, or iodide ion,...
Post-Lab Questions: 1. If you had a solution which contained only chloride, bromide, or iodide ion, which of the three tests would most clearly tell you which anion was in the solution? Explain. 2.) Suppose that you were quite sure that your unknown centained only sulfate ion. Which test would most quickly 3. Consider each set of results below which were carried out on a solution containing either (1)one of the six anions studied in this experiment, or (2) none...
Determination of Ka and Identification of an Unknown Weak Acid Post-lab Question 1. Suppose that a student performi...
Determination of Ka and Identification of an Unknown Weak Acid Post-lab Question 1. Suppose that a student performing this experiment mistakenly calibrated the pH meter using pH 8 buffer instead of pH 7 buffer. As a result of this error, all of the student's pH readings were too low. a) Would this error have affected the calculated molar mass of the unknown acid? Briefly explain. b) Would this error have affected the experimentally determined pKa of the unknown acid? Briefly...
1 Ka Cr Oy MI-A 3x1 C4 - NO STOR : The Empirical Formula of an...
1
Ka Cr Oy MI-A 3x1 C4 - NO STOR : The Empirical Formula of an Oxide analysis it was found to 2. A sample of ampound containing Co, and silver (Ag) weighed 1.372 g. On analysis it was 28 Oand 0974 g Ag. The molar mass of the compound is 303.8 g mol and the masses of c and Ag are 12.01 g mol-16.00 g mol), and 107.9 g mol, respectively. Dete the empirical and molecular formulas of the...
E AFTER COMPLETING LAB. ANSWER IN SPACE PROVIDED. Suppose the heat of neutralization had been determined using a glass beaker instead of a polystyrene coffee cup How would the measured value have...
E AFTER COMPLETING LAB. ANSWER IN SPACE PROVIDED. Suppose the heat of neutralization had been determined using a glass beaker instead of a polystyrene coffee cup How would the measured value have been affected? The heat of combustion of octane, C,H,. can be measured in a way similar to the method youC used to measure the heat of neutralization. The bomb calorimeter is used instead of a coffee cup. The reaction is 2C,H,1)+ 25 O, (g) 16 CO, (g) +...
Can you pleass show the work and explain? (1) How many grams of potassium chloride must be dissolved in 2.50 x 10^(2) m...
Can you pleass show the work and explain? (1) How many grams of potassium chloride must be dissolved in 2.50 x 10^(2) mL of water to make a 0.400 m solution? (2) How many milliliters of commercial hydrochloric acid, which is 11.6 molar, should you use to prepare 5.50 L of 0.500 molar hydrochloric acid? (3) Calculate the molarity of a NaOH solution prepared by mixing 100. mL of 0.20 M NaOH with 150 mL of H2O. (4) Calculate the...
1-What solvent you use to determine the density of zinc chloride? 2-The density of a solid...
1-What solvent you use to determine the density of zinc chloride? 2-The density of a solid with a melting point of 42 to 44 C was determined to be 0.87+- 0.02 g\mL. what is the solid? 3-The density of a liquid whose boiling point is 55 to 57 C was determined to be 0.77+- 0.05 g\mL. what is the liquid? 4-Is diphenylmethane a solid or a liquid at room temperature? 5-What solvent would you use to measure the density of...
Post-Lab Questions: 1. If you had a solution which contained only chloride, bromide, or iodide ion,...
Post-Lab Questions: 1. If you had a solution which contained only chloride, bromide, or iodide ion, which of the three tests would most clearly tell you which anion was in the solution? Explain. 2.) Suppose that you were quite sure that your unknown contained only sulfate ion. Which test would most quickly (that is, in the fewest steps) confirm your hypothesis? Explain. Consider each set of results below which were carried out on a solution containing either (1)one of the...
1. How would you determine if you have heated the sample long enough to drive off all the water from the hydrate? 2. A compound is made of 30.9% of Cu, 13.6 % Si, and 55.5% F. a. What is the empirical formula of the anhydrous salt? b. 1.00 gram of this compound is subject to high moisture environment. The resulting hydrate weighs 1.53 grams. What is the formula of the hydrate?
()UESTIONS 1. If you had used a different mass of magnesium metal, would you expect the empirical formula of the compound to be the same? Explain. 2. If you had omitted steps 12 and 13 from the experiment, how would this omission have affected your results in terms of the empirical formula of the magnesium oxide? In other words, would the ratio of the magnesium to the oxygen have been greater or less than the obtained ratio? 3. From the...
Post-Lab Questions: 1. If you had a solution which contained only chloride, bromide, or iodide ion, which of the three tests would most clearly tell you which anion was in the solution? Explain. 2.) Suppose that you were quite sure that your unknown centained only sulfate ion. Which test would most quickly 3. Consider each set of results below which were carried out on a solution containing either (1)one of the six anions studied in this experiment, or (2) none...
Determination of Ka and Identification of an Unknown Weak Acid Post-lab Question 1. Suppose that a student performing this experiment mistakenly calibrated the pH meter using pH 8 buffer instead of pH 7 buffer. As a result of this error, all of the student's pH readings were too low. a) Would this error have affected the calculated molar mass of the unknown acid? Briefly explain. b) Would this error have affected the experimentally determined pKa of the unknown acid? Briefly...
1
Ka Cr Oy MI-A 3x1 C4 - NO STOR : The Empirical Formula of an Oxide analysis it was found to 2. A sample of ampound containing Co, and silver (Ag) weighed 1.372 g. On analysis it was 28 Oand 0974 g Ag. The molar mass of the compound is 303.8 g mol and the masses of c and Ag are 12.01 g mol-16.00 g mol), and 107.9 g mol, respectively. Dete the empirical and molecular formulas of the...
E AFTER COMPLETING LAB. ANSWER IN SPACE PROVIDED. Suppose the heat of neutralization had been determined using a glass beaker instead of a polystyrene coffee cup How would the measured value have been affected? The heat of combustion of octane, C,H,. can be measured in a way similar to the method youC used to measure the heat of neutralization. The bomb calorimeter is used instead of a coffee cup. The reaction is 2C,H,1)+ 25 O, (g) 16 CO, (g) +...
Post-Lab Questions: 1. If you had a solution which contained only chloride, bromide, or iodide ion, which of the three tests would most clearly tell you which anion was in the solution? Explain. 2.) Suppose that you were quite sure that your unknown contained only sulfate ion. Which test would most quickly (that is, in the fewest steps) confirm your hypothesis? Explain. Consider each set of results below which were carried out on a solution containing either (1)one of the...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago