Homework Answers
Add Answer to:
4. Can we connect plane stress elements with axisymmetric elements? Why? (2 points) 4. Can we connect plane stress elements with axisymmetric elements? Why? (2 points)
In the coordinate plane connect points (1, 0) and (0, 2), (0, 2) and (2, 2),...
In the coordinate plane connect points (1, 0) and (0, 2), (0, 2)
and (2, 2), (2, 2) and (1, 4), (1, 4) and (5, 2), (5, 2) and (1,
0). What is the area of the polygon obtained?n the coordinate plane connect points (1,
0) and (0, 2), (0, 2) and (2, 2), (2, 2) and (1, 4), (1, 4) and (5,
2), (5, 2) and (1, 0). What is the area of the polygon
obtained?
-3.5+ 2 15...
Briefly answer 1). In an FE simulation with Abaqus, if the unit for the length is...
Briefly answer 1). In an FE simulation with Abaqus, if the unit for the length is μm and the unit for the force is Netwon, what is the correct unit for the elastic modulus? Why? 4). Write down the global matrix equilibrium equation for a static FE analysis of a structure. 5). What is integration point? Where can we obtain the most accurate stress results within an element from an FE analysis? 6). What is a plane stress problem? Provide...
need help with these 4 questions Question 20 2 pts If a plane (2D) stress state...
need help with these 4 questions
Question 20 2 pts If a plane (2D) stress state in the x-plane gives a Moh's Circle and the two related points at corresponding toxplane) and corresponding to y plane as shown below. TA C(1,0) 26.6° MIO IN R = 2.24 Y Knowing the center for the Mohr's circles C11.00 MPa,OMPal and the radius R-224 MP how to find the direction in real geometry along which the normal stress reaches madu Within the plane...
In Python, design and explain algorithm and why it works. Consider the polygon problem: given a set of three or more points in the Cartesian plane, connect them with a closed path consisting of no...
In Python, design and explain algorithm and why it
works.
Consider the polygon problem: given a set of three or more points in the Cartesian plane, connect them with a closed path consisting of non-intersecting line segments through all of the points. Design an algorithm for this problem and determine its efficiency class.
Consider the polygon problem: given a set of three or more points in the Cartesian plane, connect them with a closed path consisting of non-intersecting line segments...
Compute the stiffness matrices of elements 1 and 2 of the two-triangle element model of the rectangular plate in plane stress shown below.
: Compute the stiffness matrices of elements 1 and 2 of the two-triangle element model of the rectangular plate in plane stress shown below. Then use them to compute the global stiffness matrix of the rectangular plate. Where b = 40 in., h = 20 in., thickness = 1 in., Poisson's ration=0.3, and E = 30 x 10 psi. 4 3 0 h 2 b
3. Why can we not measure the rate of glucose formation by cellobiase directly? (2 points)...
3. Why can we not measure the rate of glucose formation by cellobiase directly? (2 points) 4. How do we use analogs of cellobiose to measure the reaction rate of cellobiase activity? Which analog of cellobiose did we use in the lab today? (4 points) 5. Why do we need to use a stop solution in our experiments today? (2 points
Abaqus CAE question how to creat mesh on 2D solid planar (plane stress (CPS4R) and plane...
Abaqus CAE question how to creat mesh on 2D solid planar (plane stress (CPS4R) and plane strain (CPE4R), 4 elements on thickness direction)
2) [10] Draw a Mohr's circle diagram and the principal and shear stress elements, all properly...
2) [10] Draw a Mohr's circle diagram and the principal and shear stress elements, all properly labeled, for the following plane stress. 0x = 20 MPa, ay = -80 MPa, Txy = -60 MPa
Problem 6 (15 points) The state of plane stress at a point is shown on the...
Problem 6 (15 points) The state of plane stress at a point is shown on the element in Figure 6. a. Using Mohr's circle, determine the principal stresses and the maximum in-plane shear stress and average normal stress. Specify the orientation of the element in each case. b. Represent the state of stress on an element oriented 30° counterclockwise from the position shown in Figure 6. 20 MPa 100 MPa 40 MPa Figure 6 (plot Mohr's circle on the next...
your Consider the element in plane stress as shown below. () (2 points) Draw corresponding Mohr's...
your Consider the element in plane stress as shown below. () (2 points) Draw corresponding Mohr's circle coordinate axes with appropriate labels, center point A. radius of the circle (1) (3 points) Using the Mohir's circle, find the magnitude of the principal stresses and principal directions. Show them on a sketch of a properly oriented clement (c) (3 points) Using the Mohr's circle, find the magnitude of the maximun shear stress and associated normal stresses Show them on a sketch...
In the coordinate plane connect points (1, 0) and (0, 2), (0, 2)
and (2, 2), (2, 2) and (1, 4), (1, 4) and (5, 2), (5, 2) and (1,
0). What is the area of the polygon obtained?n the coordinate plane connect points (1,
0) and (0, 2), (0, 2) and (2, 2), (2, 2) and (1, 4), (1, 4) and (5,
2), (5, 2) and (1, 0). What is the area of the polygon
obtained?
-3.5+ 2 15...
need help with these 4 questions
Question 20 2 pts If a plane (2D) stress state in the x-plane gives a Moh's Circle and the two related points at corresponding toxplane) and corresponding to y plane as shown below. TA C(1,0) 26.6° MIO IN R = 2.24 Y Knowing the center for the Mohr's circles C11.00 MPa,OMPal and the radius R-224 MP how to find the direction in real geometry along which the normal stress reaches madu Within the plane...
In Python, design and explain algorithm and why it
works.
Consider the polygon problem: given a set of three or more points in the Cartesian plane, connect them with a closed path consisting of non-intersecting line segments through all of the points. Design an algorithm for this problem and determine its efficiency class.
Consider the polygon problem: given a set of three or more points in the Cartesian plane, connect them with a closed path consisting of non-intersecting line segments...
2) [10] Draw a Mohr's circle diagram and the principal and shear stress elements, all properly labeled, for the following plane stress. 0x = 20 MPa, ay = -80 MPa, Txy = -60 MPa
Problem 6 (15 points) The state of plane stress at a point is shown on the element in Figure 6. a. Using Mohr's circle, determine the principal stresses and the maximum in-plane shear stress and average normal stress. Specify the orientation of the element in each case. b. Represent the state of stress on an element oriented 30° counterclockwise from the position shown in Figure 6. 20 MPa 100 MPa 40 MPa Figure 6 (plot Mohr's circle on the next...
your Consider the element in plane stress as shown below. () (2 points) Draw corresponding Mohr's circle coordinate axes with appropriate labels, center point A. radius of the circle (1) (3 points) Using the Mohir's circle, find the magnitude of the principal stresses and principal directions. Show them on a sketch of a properly oriented clement (c) (3 points) Using the Mohr's circle, find the magnitude of the maximun shear stress and associated normal stresses Show them on a sketch...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 15 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago