In the compound [Ag(NH3)2]Cl, what is the ligand? ?Ag, Cl, NH3 or [Ag(NH3)2]+ ? Write the electronic configuration of...
In the compound [Ag(NH3)2]Cl, what is the ligand? ?Ag, Cl, NH3 or [Ag(NH3)2]+ ?
Write the electronic configuration of an Fe atom.
Write the electronic configuration of an Fe 3+ atom.
Can you please write the long version of the electron configuration? Not the shorthand/condensed
Homework Answers
The one with lone pair or electron rich group will be the ligand. Here the metal ion which is electron deficient Ag. The ligands are Cl, NH3.
The electronic configuration of Fe is
The 3d comes after 4s because the energy of 4s < 3d.
The electron is taken from the 4s only eventhough they are lesser in energy than 3d. The outer most shell is still 4s. Thus the electrons will be first taken from 4s and then it goes to 3d.
Add Answer to:
In the compound [Ag(NH3)2]Cl, what is the ligand? ?Ag, Cl, NH3 or [Ag(NH3)2]+ ? Write the electronic configuration of...
The experimental ground state electronic configuration of a silver (Ag) atom is exceptional in that it...
The experimental ground state electronic configuration of a silver (Ag) atom is exceptional in that it does not agree with the configuration predicted by the nl rule. The following questions pertain to the ground state of a hypothetical Ag atom, whose electron configuration does conform to the n l rule. Recall that Ag has 47 electrons a) What ground state electron configuration would Ag have if it conformed to the nl rule? b) What would the ground state term symbol...
Testbank, Question 17.074 In an aqueous solution silver ions can form Ag(NH3)2+(aq) in the presence of...
Testbank, Question 17.074
In an aqueous solution silver ions can form
Ag(NH3)2+(aq) in the
presence of ammonia. For
Ag(NH3)2+(aq): (see
photo)
Testbank, Question 17.074 In an aqueous solution silver ions can form Ag(NH3)2+ (aq) in the presence of ammonia. For Ag(NH3)2+(aq) Ag(NH3)2+(aq) is a complex ion; NH3 is a donor atom; Ag+ is a ligand Ag(NH3)2+(aq) is an acceptor ion; NH3 is a ligand; Ag+ is a complex ion Ag(NH3)2+(aq) is a complex ion; NH3 is a ligand; Ag+ is...
A pictorial representation of an electronic configuration is shown. Attempt 3 to Tu Te Tu Hai...
A pictorial representation of an electronic configuration is shown. Attempt 3 to Tu Te Tu Hai Tu To Me Te Te TU TU TU TU 11 - Give the full electron configuration. Do not use the noble gas abbreviation. electron configuration: Name the element, assuming that the configuration describes a neutral atom. element name: germanium Write the ground state electron configuration of Zn using the noble-gas shorthand notation. [Ar]4s3d10 How many electrons in an atom could have these sets of...
(b) Determine the oxidation state of the metal, the d electron configuration, the number of unpaired electrons and the ligand field stabilisation energy for the following complexes: (i) [Co(NH3)5Br]2+...
(b) Determine the oxidation state of the metal, the d electron configuration, the number of unpaired electrons and the ligand field stabilisation energy for the following complexes: (i) [Co(NH3)5Br]2+ (ii) [MnO4]- (iii) [Fe(CN)6]3- (iv) [Cu(H2O)6]2+
Quantum Theory and the Electronic structure of atoms; 1-the electron configuration of a neutral atom is...
Quantum Theory and the Electronic structure of atoms; 1-the electron configuration of a neutral atom is 1s²2s²2p^63s². Write a complete set of quantum numbers for each of the electrons. name the element. 2-what is the maximum number of electrons in an atom that can have the following quantum numbers? Specify the orbitals in which the electrons would be found. (A) n=2, ms= +1/2; (b) n=4, mℓ=+1; (c) n=3, ℓ=2; (d) n=2, ℓ=0, ms= -1/2; (e) n=4, ℓ=3, mℓ=-2. 3- certain...
Write the equations of mass balance for a 1.0x10-5 M [Ag(NH3)2]Cl solution
Write the equations of mass balance for a 1.0x10-5 M [Ag(NH3)2]Cl solution
The electronic configuration for boron is 1s22s22p1, and the electronic configuration for aluminum is 1s22s22p6 352...
The electronic configuration for boron is 1s22s22p1, and the electronic configuration for aluminum is 1s22s22p6 352 3p1. It requires 8.298 eV to remove the outermost electron (2p1) from boron. What can you say about the energy required to remove the outermost electron from aluminum (3p1)? Since each is the outermost electron around the atom, the energy required will be equal to 8.298 eV. Since each electron is in a porbital, the energy required will be equal to 8.298 ev. Since...
The electronic configuration for boron is 152 252 2p1, and the electronic configuration for aluminum is...
The electronic configuration for boron is 152 252 2p1, and the electronic configuration for aluminum is 192 252 2p6 352 3p1. It requires 8.298 eV to remove the outermost electron (2p1) from boron. What can you say about the energy required to remove the outermost electron from aluminum (3p1)? Since each is the outermost electron around the atom, the energy required will be equal to 8.298 eV. Since each electron is in a p orbital, the energy required will be...
The electronic configuration for boron is 1s2 2s2 2p1, and the electronic configuration for aluminum is...
The electronic configuration for boron is 1s2 2s2 2p1, and the electronic configuration for aluminum is 1s2 2s2 2p6 3s2 3p1. It requires 8.298 eV to remove the outermost electron (2p1) from boron. What can you say about the energy required to remove the outermost electron from aluminum (3p1)? Since each is the outermost electron around the atom, the energy required will be equal to 8.298 eV. Since each electron is in a p orbital, the energy required will be equal...
The electronic configuration for boron is 152 2s22p1, and the electronic configuration for aluminum is 1s2...
The electronic configuration for boron is 152 2s22p1, and the electronic configuration for aluminum is 1s2 2s22p6 352 3p1. It requires 8.298 eV to remove the outermost electron (2p1) from boron. What can you say about the energy required to remove the outermost electron from aluminum (3p1)? Since each is the outermost electron around the atom, the energy required will be equal to 8.298 eV. Since each electron is in a p orbital, the energy required will be equal to...
The experimental ground state electronic configuration of a silver (Ag) atom is exceptional in that it does not agree with the configuration predicted by the nl rule. The following questions pertain to the ground state of a hypothetical Ag atom, whose electron configuration does conform to the n l rule. Recall that Ag has 47 electrons a) What ground state electron configuration would Ag have if it conformed to the nl rule? b) What would the ground state term symbol...
Testbank, Question 17.074
In an aqueous solution silver ions can form
Ag(NH3)2+(aq) in the
presence of ammonia. For
Ag(NH3)2+(aq): (see
photo)
Testbank, Question 17.074 In an aqueous solution silver ions can form Ag(NH3)2+ (aq) in the presence of ammonia. For Ag(NH3)2+(aq) Ag(NH3)2+(aq) is a complex ion; NH3 is a donor atom; Ag+ is a ligand Ag(NH3)2+(aq) is an acceptor ion; NH3 is a ligand; Ag+ is a complex ion Ag(NH3)2+(aq) is a complex ion; NH3 is a ligand; Ag+ is...
A pictorial representation of an electronic configuration is shown. Attempt 3 to Tu Te Tu Hai Tu To Me Te Te TU TU TU TU 11 - Give the full electron configuration. Do not use the noble gas abbreviation. electron configuration: Name the element, assuming that the configuration describes a neutral atom. element name: germanium Write the ground state electron configuration of Zn using the noble-gas shorthand notation. [Ar]4s3d10 How many electrons in an atom could have these sets of...
The electronic configuration for boron is 1s22s22p1, and the electronic configuration for aluminum is 1s22s22p6 352 3p1. It requires 8.298 eV to remove the outermost electron (2p1) from boron. What can you say about the energy required to remove the outermost electron from aluminum (3p1)? Since each is the outermost electron around the atom, the energy required will be equal to 8.298 eV. Since each electron is in a porbital, the energy required will be equal to 8.298 ev. Since...
The electronic configuration for boron is 152 252 2p1, and the electronic configuration for aluminum is 192 252 2p6 352 3p1. It requires 8.298 eV to remove the outermost electron (2p1) from boron. What can you say about the energy required to remove the outermost electron from aluminum (3p1)? Since each is the outermost electron around the atom, the energy required will be equal to 8.298 eV. Since each electron is in a p orbital, the energy required will be...
The electronic configuration for boron is 152 2s22p1, and the electronic configuration for aluminum is 1s2 2s22p6 352 3p1. It requires 8.298 eV to remove the outermost electron (2p1) from boron. What can you say about the energy required to remove the outermost electron from aluminum (3p1)? Since each is the outermost electron around the atom, the energy required will be equal to 8.298 eV. Since each electron is in a p orbital, the energy required will be equal to...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 55 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago