Homework Answers
Add Answer to:
show the coefficient for each reaction to balance the electrons lost = electrons gained ITIN TIL Cileillilal Equatio...
In each of the equations, add the appropriate number of electrons gained or lost in order...
In each of the equations, add the appropriate number of electrons gained or lost in order to balance the half-reaction. The symbol for an electron is e−e−. equation 1: Sn4+−⇀↽−2Sn2+Sn4+↽−−⇀2Sn2+ equation 2: Co2+−⇀↽−Co3+Co2+↽−−⇀Co3+ equation 3: Cr3+−⇀↽−Cr3Cr3+↽−−⇀Cr3 equation 4: Hg2+2−⇀↽−2Hg2+
Question 1 -/10 In the process of oxidation electrons are gained and the charge gets more...
Question 1 -/10 In the process of oxidation electrons are gained and the charge gets more negative electrons are gained and the charge gets more positive 2 electrons are lost and the charge gets more positive 3 electrons are lost and the charge gets more negative 4 Question 2 10 When the equation Mn2+ Bio3 MnO4 Bi3+ is balanced in acid solution, the coefficient + in front of Bi3+ is 1 3 2 4 3 5 4 Question 3 -/10...
whrite the balanced oxidation half reaction and the balanced reduction half reaction for this Il SuicS TIN OLI COLL...
whrite the balanced oxidation half reaction and the balanced
reduction half reaction for this
Il SuicS TIN OLI COLLIDE 111) " how fast a reaction goes is called a rate equation. For the rate € anion with oxalic acid, it was found that the Excel graph using speed of the reaction and the temperature at which the reactic the best fit, yielding an R2 value closest to 1. This means that t for this reaction. The chemical equation for the...
The following oxidation-reduction reaction was performed: 5 0,0%" + 2 Mno" +16 H1+ 10 CO2 +...
The following oxidation-reduction reaction was performed: 5 0,0%" + 2 Mno" +16 H1+ 10 CO2 + 2 Mn2+ +8 H,0 a. Determine the oxidation states of all atoms. b. Identify the oxidizing agent and reducing agent. c. Balance each half reaction: C,04 → CO2 and Mno" - Mn2+ Identify the oxidation reaction and reduction reaction. Show that the total number of electrons lost in the oxidation is the same number of electron gained in the reduction
What is the equilibrium constant K at 25°C for an electrochemical cell when E° = +0.0140...
What is the equilibrium constant K at 25°C for an electrochemical cell when E° = +0.0140 V and n = 2? (F = 96,500 J/(V•mol), R = 8.314 J/ (mol·K)) 0.3353 1 2 3 x 4 5 6 с 7 00 9 O +/- x 100 Complete and balance the following redox reaction in basic solution MnO4 (aq) + C2042-(aq) → MnO2 (s) + CO2(g) 3C22 Reset < > х 1 2 3 4 5 6 7 8 9 0...
For each reaction below, identify the atom oxidized, the atom reduced, the oxidizing agent, the reducing...
For each reaction below, identify the atom oxidized, the atom
reduced, the oxidizing agent, the reducing agent, the oxidation
half reaction, the reduction half reaction, and then balance the
equation by the method of oxidation-reduction showing all electrons
transfers.
KMnO4 NaClH2SO4 à Cl2 K2SO4 MnSO4 H20 Na2SO4 5. Cr2O3 6. K2CR2O7 H20 + S à SO2 + KOH KCIO3 C12H22011 à KCI + H20 + CO2 7 H2C204+K2MnO4 à CO2 K20 Mn203 H20 8. 9. Mn(NO3) 2 NaBiO3 HNO3 à...
U NO+H2O 24. Balance the equation NaBHA + BF3 --> NaBFA+B_H6 5. Balance the equation MgCl2 + K PO 4 --> Mg,(P...
U NO+H2O 24. Balance the equation NaBHA + BF3 --> NaBFA+B_H6 5. Balance the equation MgCl2 + K PO 4 --> Mg,(PO 22+ KCI 3M gclzt k3 (P84), Mg₂ (PO4)2 t. 3ko 6. Balance the equation CH14+02 --> CO2 + H20 7. Balance the equation As Oz(s) + Ca(OH)2(aq) --> Caz(AsO2 (s) + H20(1) 8. Balance the equation Mg(OH)2(aq) + HBr(aq) --> MgBr_(aq) + H2O(1) 9. Balance the equation Sb() + O2() --> Sb2O3(9)
In addition to mass balance, oxidation-reduction reactions must be balanced such that the number of electrons...
In addition to mass balance, oxidation-reduction reactions must be balanced such that the number of electrons lost in the oxidation equals the number of electrons gained in the reduction. This balancing can be done by two methods: the half-reaction method or the oxidation number method. The half-reaction method balances the electrons lost in the oxidation half-reaction with the electrons gained in the reduction half-reaction. In either method H2O(l), OH−(aq), and H+(aq) may be added to complete the mass balance. Which...
Balance the reaction below and determine the #electrons (in mol) involved in the reaction. a. CH4...
Balance the reaction below and determine the #electrons (in mol) involved in the reaction. a. CH4 + O2 -> b. C2H6 + 02 -> C. C3H2 + O2 -> C4H10 + O2 -> e. C5H12 + O2-> f. C6H14 + O2 -> g. C6H14 + 02-> h. C2H4+ 02 -> i. C2H2 + O2 -> j. C6H6 + O2 ->
HNO C H,504 Question 98 (0.05 points) Which of the following is an acid-base reaction? Question...
HNO C H,504 Question 98 (0.05 points) Which of the following is an acid-base reaction? Question 98 options: C C(s)+02(g) CO2(g) С 2 HC104(aq) + CalOH)2(aq) 2 H2O(l) + Ca(C104)2(aq) C Fe(s) + 2 AgNO3(aq)-> 2 Ag(s) + Fe(NO3)2(aq) MgSO4(aq)+ Ba(NO3)2(aq)Mg(NO3)2(aq)+Bas04(s) None of the above are acid base reactions. Question 99 (0.05 points) How many electrons are gained or lost in the following half-reaction? Question 99 options: C 1/2 electron is gained C 2 electrons are gained C 1/2 electron...
Question 1 -/10 In the process of oxidation electrons are gained and the charge gets more negative electrons are gained and the charge gets more positive 2 electrons are lost and the charge gets more positive 3 electrons are lost and the charge gets more negative 4 Question 2 10 When the equation Mn2+ Bio3 MnO4 Bi3+ is balanced in acid solution, the coefficient + in front of Bi3+ is 1 3 2 4 3 5 4 Question 3 -/10...
whrite the balanced oxidation half reaction and the balanced
reduction half reaction for this
Il SuicS TIN OLI COLLIDE 111) " how fast a reaction goes is called a rate equation. For the rate € anion with oxalic acid, it was found that the Excel graph using speed of the reaction and the temperature at which the reactic the best fit, yielding an R2 value closest to 1. This means that t for this reaction. The chemical equation for the...
The following oxidation-reduction reaction was performed: 5 0,0%" + 2 Mno" +16 H1+ 10 CO2 + 2 Mn2+ +8 H,0 a. Determine the oxidation states of all atoms. b. Identify the oxidizing agent and reducing agent. c. Balance each half reaction: C,04 → CO2 and Mno" - Mn2+ Identify the oxidation reaction and reduction reaction. Show that the total number of electrons lost in the oxidation is the same number of electron gained in the reduction
What is the equilibrium constant K at 25°C for an electrochemical cell when E° = +0.0140 V and n = 2? (F = 96,500 J/(V•mol), R = 8.314 J/ (mol·K)) 0.3353 1 2 3 x 4 5 6 с 7 00 9 O +/- x 100 Complete and balance the following redox reaction in basic solution MnO4 (aq) + C2042-(aq) → MnO2 (s) + CO2(g) 3C22 Reset < > х 1 2 3 4 5 6 7 8 9 0...
For each reaction below, identify the atom oxidized, the atom
reduced, the oxidizing agent, the reducing agent, the oxidation
half reaction, the reduction half reaction, and then balance the
equation by the method of oxidation-reduction showing all electrons
transfers.
KMnO4 NaClH2SO4 à Cl2 K2SO4 MnSO4 H20 Na2SO4 5. Cr2O3 6. K2CR2O7 H20 + S à SO2 + KOH KCIO3 C12H22011 à KCI + H20 + CO2 7 H2C204+K2MnO4 à CO2 K20 Mn203 H20 8. 9. Mn(NO3) 2 NaBiO3 HNO3 à...
U NO+H2O 24. Balance the equation NaBHA + BF3 --> NaBFA+B_H6 5. Balance the equation MgCl2 + K PO 4 --> Mg,(PO 22+ KCI 3M gclzt k3 (P84), Mg₂ (PO4)2 t. 3ko 6. Balance the equation CH14+02 --> CO2 + H20 7. Balance the equation As Oz(s) + Ca(OH)2(aq) --> Caz(AsO2 (s) + H20(1) 8. Balance the equation Mg(OH)2(aq) + HBr(aq) --> MgBr_(aq) + H2O(1) 9. Balance the equation Sb() + O2() --> Sb2O3(9)
Balance the reaction below and determine the #electrons (in mol) involved in the reaction. a. CH4 + O2 -> b. C2H6 + 02 -> C. C3H2 + O2 -> C4H10 + O2 -> e. C5H12 + O2-> f. C6H14 + O2 -> g. C6H14 + 02-> h. C2H4+ 02 -> i. C2H2 + O2 -> j. C6H6 + O2 ->
HNO C H,504 Question 98 (0.05 points) Which of the following is an acid-base reaction? Question 98 options: C C(s)+02(g) CO2(g) С 2 HC104(aq) + CalOH)2(aq) 2 H2O(l) + Ca(C104)2(aq) C Fe(s) + 2 AgNO3(aq)-> 2 Ag(s) + Fe(NO3)2(aq) MgSO4(aq)+ Ba(NO3)2(aq)Mg(NO3)2(aq)+Bas04(s) None of the above are acid base reactions. Question 99 (0.05 points) How many electrons are gained or lost in the following half-reaction? Question 99 options: C 1/2 electron is gained C 2 electrons are gained C 1/2 electron...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 47 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago