Can you please show the products and the steps for the reaction:
Homework Answers
Add Answer to:
Can you please show the products and the steps for the reaction: 1. HCrO4, H20 2. SOCI2 You 3. a) MeMgBr, Et20 b) NHACI...
Predict the products. 16. K2Cr207 (excess) H2SO4, H2O HO 1. Phli, Et20 2. HCI, H20 3....
Predict the products.
16. K2Cr207 (excess) H2SO4, H2O HO 1. Phli, Et20 2. HCI, H20 3. SOCI2, Etz 4. NaOAC 1. Mg (1 eq), Et O Br 2. (1 eq) | C-CHO 3. HCI, H20 1. NaBH, MeOH, 0°C 2. PBrz. THE 3. LiAIDA, THE 4. HCI, H20 1. SOCI, NEtz, THE CHO 2. 2 eq Li, hexane 3. HCI, H20 hint: multiple steps 1. LiAlH4, THE 2. HCI, H2O 3. PBr3, THE 1. PCC, DCM OH 2. Mg, Eto...
If someone can help please help me with this, and please show each reaction so I can learn!
If someone can help please help me with this, and
please show each reaction so I can learn!
6: 3: Reaction of 2-propanol with the reagents listed here afforded which product? 1) PBr3 2) Mg, Et20; 3) CHsCHO; 4) H20; 5) PCC, CH2Cl2; 6) [H3O], Br2; 7) Pyridine 8) Et2CULI 9) C3 10) NaOH, Br2; 11) H3O 12) SOCI2;13) LİAİ(OR)3H 14) H20; 7: Reaction of oxirane with the reagents listed here afforded which product? 1) MeMgBr; 2) H20; 3) PCC,...
Topic: Organic Chemistry Please make all drawings very clear. Please show all work and side products...
Topic: Organic Chemistry Please make all drawings very clear.
Please show all work and side products along with brief
explanations. Thank you.
1. Provide the missing starting material for each of the following transformations. There may be multiple possibilities for a particular sequence of reactions, but you need only provide one correct answer to receive full credit. 1. NH3, pyridine 2. LAIH, Et20 3. H+ workup b. 1. H30* 2. SOCI2 3. EtOH C. N-CH3 1. CrO3, pyridine I 2....
Which reagents will accomplish the following transformation? OH HN H2N A. 1. MeMgBr/Et20 2. acid workup...
Which reagents will accomplish the following transformation? OH HN H2N A. 1. MeMgBr/Et20 2. acid workup B. Zn° / HCI OC. NaBH4 (aq) OD. 1. LiAlH4 / Et20 2. acid workup Which is the major product of this reaction sequence? KOH H2O/H30* Hoc-Ppha ОА. OC
provide the major product in the following reaction NH2 NaBH3CN a. NaNg, EtOH b. H20, A...
provide the major product in the following reaction
NH2 NaBH3CN a. NaNg, EtOH b. H20, A ОН 1. SOCI2, pyridine 2. NaN3, DMF 3. LIAIH4, Et20
Topic: Organic Chemistry Please make all drawings very clear. Please show all work and side products...
Topic: Organic Chemistry Please make all drawings very clear.
Please show all work and side products along with brief
explanations. Thank you.
2. Fill in each box with the expected organic product of the indicated multistep transformation. Be sure that each product you draw takes into account all steps of the transformation, including workup steps! Remember to account for stereochemistry where appropriate. он 1. CrO2, H20 2. MeOH, H+ cat. 1. HNEt2, pyridine 2. LiAlH4, Et20 3. H* workup NMez...
Draw the major product for each reaction. он. CH3 heat N(CH3)3 a. LiAIH4, Et20 b. H30*/H20...
Draw the major product for each reaction. он. CH3 heat N(CH3)3 a. LiAIH4, Et20 b. H30*/H20 1. NaCN, DMSO Br 2. a. LiAIH4. THF b. H3O+/H2O 1. NaN3, DMSO Br 2. a. LiAIH4, THF b. H3O /H20 1. HNO3, H2SO4 2. SnCl2 3. Br2 4. a. HNO2, H2SO4 H3C b. H2PO2 NH2 1. NaNO2, HCI, H20 но 2. HBF4
predict the products 1. Mg (1 еq), Et20 V. -Br 2. (1 eд) «СНО 3. HС,...
predict the products
1. Mg (1 еq), Et20 V. -Br 2. (1 eд) «СНО 3. HС, Н20 W. 1. NaBH, MeCОН, 0° С 2. PBrз, THF 3. LIAID4, THF 4. HСI, Н-О ОН х. 1. SOCI2, NEt3, THF 2. 2 eq Li, hexane 3. НСІ, НО СНО т
predict the reactants and products to complete reaction mechanism OTE oprer Br hint: multiple steps 1....
predict the reactants and products to complete reaction
mechanism
OTE oprer Br hint: multiple steps 1. LiAIH4, THE 2. HCI, H2O 3. PBr3, THE 3 D LO a1. 1. PCC, DCM 2. Mg, Et20 3. HCI, H20 1. MSCI, pyr 2. KO'Bu, 'BuOH uw
SHOW STEPS PLEASE lor the following products for the following reaction. reaction. 1.Br NaOH 2" 2.H1o
SHOW STEPS PLEASE
lor the following products for the following reaction. reaction. 1.Br NaOH 2" 2.H1o
Predict the products.
16. K2Cr207 (excess) H2SO4, H2O HO 1. Phli, Et20 2. HCI, H20 3. SOCI2, Etz 4. NaOAC 1. Mg (1 eq), Et O Br 2. (1 eq) | C-CHO 3. HCI, H20 1. NaBH, MeOH, 0°C 2. PBrz. THE 3. LiAIDA, THE 4. HCI, H20 1. SOCI, NEtz, THE CHO 2. 2 eq Li, hexane 3. HCI, H20 hint: multiple steps 1. LiAlH4, THE 2. HCI, H2O 3. PBr3, THE 1. PCC, DCM OH 2. Mg, Eto...
If someone can help please help me with this, and
please show each reaction so I can learn!
6: 3: Reaction of 2-propanol with the reagents listed here afforded which product? 1) PBr3 2) Mg, Et20; 3) CHsCHO; 4) H20; 5) PCC, CH2Cl2; 6) [H3O], Br2; 7) Pyridine 8) Et2CULI 9) C3 10) NaOH, Br2; 11) H3O 12) SOCI2;13) LİAİ(OR)3H 14) H20; 7: Reaction of oxirane with the reagents listed here afforded which product? 1) MeMgBr; 2) H20; 3) PCC,...
Topic: Organic Chemistry Please make all drawings very clear.
Please show all work and side products along with brief
explanations. Thank you.
1. Provide the missing starting material for each of the following transformations. There may be multiple possibilities for a particular sequence of reactions, but you need only provide one correct answer to receive full credit. 1. NH3, pyridine 2. LAIH, Et20 3. H+ workup b. 1. H30* 2. SOCI2 3. EtOH C. N-CH3 1. CrO3, pyridine I 2....
Which reagents will accomplish the following transformation? OH HN H2N A. 1. MeMgBr/Et20 2. acid workup B. Zn° / HCI OC. NaBH4 (aq) OD. 1. LiAlH4 / Et20 2. acid workup Which is the major product of this reaction sequence? KOH H2O/H30* Hoc-Ppha ОА. OC
provide the major product in the following reaction
NH2 NaBH3CN a. NaNg, EtOH b. H20, A ОН 1. SOCI2, pyridine 2. NaN3, DMF 3. LIAIH4, Et20
Topic: Organic Chemistry Please make all drawings very clear.
Please show all work and side products along with brief
explanations. Thank you.
2. Fill in each box with the expected organic product of the indicated multistep transformation. Be sure that each product you draw takes into account all steps of the transformation, including workup steps! Remember to account for stereochemistry where appropriate. он 1. CrO2, H20 2. MeOH, H+ cat. 1. HNEt2, pyridine 2. LiAlH4, Et20 3. H* workup NMez...
Draw the major product for each reaction. он. CH3 heat N(CH3)3 a. LiAIH4, Et20 b. H30*/H20 1. NaCN, DMSO Br 2. a. LiAIH4. THF b. H3O+/H2O 1. NaN3, DMSO Br 2. a. LiAIH4, THF b. H3O /H20 1. HNO3, H2SO4 2. SnCl2 3. Br2 4. a. HNO2, H2SO4 H3C b. H2PO2 NH2 1. NaNO2, HCI, H20 но 2. HBF4
predict the products
1. Mg (1 еq), Et20 V. -Br 2. (1 eд) «СНО 3. HС, Н20 W. 1. NaBH, MeCОН, 0° С 2. PBrз, THF 3. LIAID4, THF 4. HСI, Н-О ОН х. 1. SOCI2, NEt3, THF 2. 2 eq Li, hexane 3. НСІ, НО СНО т
predict the reactants and products to complete reaction
mechanism
OTE oprer Br hint: multiple steps 1. LiAIH4, THE 2. HCI, H2O 3. PBr3, THE 3 D LO a1. 1. PCC, DCM 2. Mg, Et20 3. HCI, H20 1. MSCI, pyr 2. KO'Bu, 'BuOH uw
SHOW STEPS PLEASE
lor the following products for the following reaction. reaction. 1.Br NaOH 2" 2.H1o
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 36 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 6 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago