Identify the elements that have the following short hand electron configurations. a. (Xe) 6s2 4f14 5d10 6p3 b. (Ar) 4s2...
Identify the elements that have the following short hand electron configurations.
a. (Xe) 6s2 4f14 5d10 6p3
b. (Ar) 4s2 3d3
c. (Xe 6s2 4f14 5d6
Homework Answers
Add Answer to:
Identify the elements that have the following short hand electron configurations. a. (Xe) 6s2 4f14 5d10 6p3 b. (Ar) 4s2...
Which electron configurations of neutral atoms represent excited states? D (Xe]6s24h [Kr]5s4d [Ar]4s23d3 1s22s22p3s23p63d2 252 Which...
Which electron configurations of neutral atoms represent excited states? D (Xe]6s24h [Kr]5s4d [Ar]4s23d3 1s22s22p3s23p63d2 252 Which neutral atoms have the given electron configurations in either a ground state or excited state? Enter the name or symbol. [Ar]4s23dº: [Xe]6s24h:
Can you help me answer these 5 questions? 1. What is the correct electron configuration for the Mn2+ ion? A. [Ar] 4s2 3d...
Can you help me answer these 5 questions? 1. What is the correct electron configuration for the Mn2+ ion? A. [Ar] 4s2 3d4 4p4 B. [Ar] 4s2 3d3 C. [Ne] 3s2 3d4 D. [Ar] 3d5 E. [Ar] 4s2 3d9 2. Which of the following formulas is incorrect? A. CaCO3 B. CaBr C. KOH D. Na2SO4 E. Na2O 3. Which of the following names are incorrect for the formula they're paired with? (Select ALLincorrect pairings) A. NH4F - ammonium fluoride B....
Identify two ions that have the following ground-state electron configurations. Part A [Ar] Check all that...
Identify two ions that have the following ground-state electron configurations. Part A [Ar] Check all that apply. Lit Ca2+ ОСІ Na+ Fe2+ Part C [Kr]58-4d10 Check all that apply. Sb3+ Sn- Sn2+ Pdt O Fr+
14) Write ground state electron configurations for the following elements. (3) Cr 15) Write the condensed...
14) Write ground state electron configurations for the following elements. (3) Cr 15) Write the condensed electron configurations of the following elements.(3) 16) Write the ground state electron configurations for the following ions. (3) Zn Ag 17) Identify the following elements by their configuration 1s 2s 2p 3s 3p 4s 3d 4p 1s 2s 2p 3s 3p 4s 3d [Kr] 5s4d"5p [Ar] 4s
Q42. Which elements have these electron configurations? Give both the symbol and the name: a. 1s...
Q42. Which elements have these electron configurations? Give both the symbol and the name: a. 1s 2s22p": b. 1s?2s22p 3s': c. 1s 2s 2pº3s 3p: d. [Ar]4s 3d: e. (Ne]3s 3p": f. [Kr]5s4d!º5p a
.(12pts) Identify the group of elements that correspond to each of the following generalized electron configurations....
.(12pts) Identify the group of elements that correspond to each of the following generalized electron configurations. No partial credit. You should check your work using table 7.3 of text. (a) [Noble gas] ns2np5 (b) [Noble gas] ns2(n-1)d2 (c) [Noble gas] ns2(n-1)d10np1 (d) [Noble gas] ns2(n-2)f6
1. (i) Write the complete electron configurations for the following elements: a. Ci b. Ca c....
1. (i) Write the complete electron configurations for the following elements: a. Ci b. Ca c. Sb (ii) Give the total number of electrons and write the shorthand (beyond the filled noble gas) electron configurations for the following elements: # of electrons a. o b. Sr c. Am
Which of the following electron configurations correspond to an excited state? Identify and write the ground...
Which of the following electron configurations correspond to an excited state? Identify and write the ground state electron configuration where appropriate. a) 1s 2s 3p b) 1s 2s 2p c) [Ar] 4s? 3d$ 4p'
1. Which two electron configurations represent elements that would have similar chemical properties? I. 1s22s22p+ II....
1. Which two electron configurations represent elements that would have similar chemical properties? I. 1s22s22p+ II. 1s22s22p III. [Ar]4523d104p3 IV. [Ar]4s23d104p* A) I and II B) I and III C) I and IV D) II and IV E) II and III
5.(12pts) Identify the group of elements that correspond to each of the following generalized electron configurations....
5.(12pts) Identify the group of elements that correspond to each of the following generalized electron configurations. No partial credit. You should check your work using table 7.3 of text. (a) [Noble gas] ns²nps (b) [Noble gas) ns?(n-1)d? (c) [Noble gas] ns´(n-1)dlºnp' (d) [Noble gas] ns”(n-2)fº
Which electron configurations of neutral atoms represent excited states? D (Xe]6s24h [Kr]5s4d [Ar]4s23d3 1s22s22p3s23p63d2 252 Which neutral atoms have the given electron configurations in either a ground state or excited state? Enter the name or symbol. [Ar]4s23dº: [Xe]6s24h:
Identify two ions that have the following ground-state electron configurations. Part A [Ar] Check all that apply. Lit Ca2+ ОСІ Na+ Fe2+ Part C [Kr]58-4d10 Check all that apply. Sb3+ Sn- Sn2+ Pdt O Fr+
14) Write ground state electron configurations for the following elements. (3) Cr 15) Write the condensed electron configurations of the following elements.(3) 16) Write the ground state electron configurations for the following ions. (3) Zn Ag 17) Identify the following elements by their configuration 1s 2s 2p 3s 3p 4s 3d 4p 1s 2s 2p 3s 3p 4s 3d [Kr] 5s4d"5p [Ar] 4s
Q42. Which elements have these electron configurations? Give both the symbol and the name: a. 1s 2s22p": b. 1s?2s22p 3s': c. 1s 2s 2pº3s 3p: d. [Ar]4s 3d: e. (Ne]3s 3p": f. [Kr]5s4d!º5p a
1. (i) Write the complete electron configurations for the following elements: a. Ci b. Ca c. Sb (ii) Give the total number of electrons and write the shorthand (beyond the filled noble gas) electron configurations for the following elements: # of electrons a. o b. Sr c. Am
Which of the following electron configurations correspond to an excited state? Identify and write the ground state electron configuration where appropriate. a) 1s 2s 3p b) 1s 2s 2p c) [Ar] 4s? 3d$ 4p'
1. Which two electron configurations represent elements that would have similar chemical properties? I. 1s22s22p+ II. 1s22s22p III. [Ar]4523d104p3 IV. [Ar]4s23d104p* A) I and II B) I and III C) I and IV D) II and IV E) II and III
5.(12pts) Identify the group of elements that correspond to each of the following generalized electron configurations. No partial credit. You should check your work using table 7.3 of text. (a) [Noble gas] ns²nps (b) [Noble gas) ns?(n-1)d? (c) [Noble gas] ns´(n-1)dlºnp' (d) [Noble gas] ns”(n-2)fº
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago