Homework Answers
Add Answer to:
16. Draw a mechanism to show how two alkylation products are formed in this reaction. a. LDA b. CHI 17. Briefly exp...
3. When 2-ethylcyclohexanone is treated with LDA (in the solvent THF), followed by ethyl bromide, two...
3. When 2-ethylcyclohexanone is treated with LDA (in the solvent THF), followed by ethyl bromide, two different alkylated products are formed. Answer the following questions about this reaction. 1) LDA THE two products 2) CH CH Br 3. a. What is LDA and what is its purpose? 3. b. Draw mechanisms for the reactions and show how the two different products are formed. Product A Mechanism Product B Mechanism 3. c. Draw an energy diagram for the formation of both...
2. Provide the complete mechanism (curved arrows) to show how the product is formed. Include all...
2. Provide the complete mechanism (curved arrows) to show how the product is formed. Include all lone pairs, formal charges, curved arrows, intermediates, and products. You do not need to draw the structures of transition states. If there is a carbocation rearrangement and/or a proton transfer, be sure to include it (them) in your mechanism. (Remember to start by drawing all ionic compounds as ions/drawing out the structure of all reagents, and drawing in all lone pairs.) HCI 3. Which...
Draw the complete mechanism for the following reaction showing how the products are formed from the...
Draw the complete mechanism for the following reaction showing
how the products are formed from the given reagents. Show all
reaction intermediates and use proper electron flow arrows
throughout.
a) Here is the overall reaction: HO I have drawn the first two arrows to guide you... please complete the mechanism (6 marks).:
6. Draw the two organic products formed in the following reaction. HO Write a mechanism for...
6. Draw the two organic products formed in the following reaction. HO Write a mechanism for the above process.
please answers part A B&C. A. draw the major products of the above reaction. Be mindful...
please answers part A B&C.
A. draw the major products of the above reaction. Be
mindful of stereochemistry.
B. A student did not wait the required time for stage
one to occur prior to adding the chemical for stage 2, instead of
mixing all three chemicals together. This mistake led to additional
(different) products being formed. Draw the major products of two
other reactions that could a occur. You do not have to decide which
among these reactions is major...
7. Under the following conditions, three products are formed in this reaction. OH H2O a. Draw...
7. Under the following conditions, three products are formed in this reaction. OH H2O a. Draw the mechanism that leads to the product that is the least likely to form in the space below. (7pts) b. In the space below, explain why that product is the most likely to form. You should be able to justify your answer. (4pts)
Question 3. Predict the major products of the reactions below. Draw the full mechanism for the...
Question 3. Predict the major products of the reactions below. Draw the full mechanism for the reactions, using appropriate arrows to indicate electron movement and the full structures of any intermediate(s). Use the mechanism of the reaction to provide a rationale for why the major product formed. OM (1 equivalent) ansole Bry Febr (1 culle brambenzone Fer (1 equivalent Priloromethylbenzene (9 marks) Question 4. Predict the major product from the treatment of 2,5-dibromopyridine with ammonia. Draw the full mechanism for...
5. For the following acid-base reactions, complete the products, show the mechanism (curved arrows), and label...
5. For the following acid-base reactions, complete the products, show the mechanism (curved arrows), and label the acid, base, conjugate acid, and conjugate base. A) ? O:N H B) :- ? H Page 2 of 3 6. For the reaction in question 5 (A and B), write the pk, values of the acid and conjugate acid underneath them and then circle the side of the equilibrium that is favored. If neither side is favored, write "neither." Briefly explain quantitatively (using...
please explain 2. (A) Draw the products of the acid/base reaction, (B) determine the position of the equilibrium, (C) us...
please explain
2. (A) Draw the products of the acid/base reaction, (B) determine the position of the equilibrium, (C) use curved arrows to show the mechanism of the reaction and (D) briefly answer "Would water be suitable to protonate the carboxylic acid?". (8 pts) H-O + F3C H
1) Give the product of the two reactions shown. КОН xs Br2 can form. 2) Draw...
1) Give the product of the two reactions shown. КОН xs Br2 can form. 2) Draw the arrows for this enolization mechanism and explain why the enolate anion can سلسل • -- Why can the enolate anion form? 3) Fill in the arrows for the alkylation mechanism below. Explain why the enolate anion 1) KOH late anion can form OH : -Br Why can the enolate ion form? 4) Give the product of the following reaction. NaOEt CH3Br H30 5)...
3. When 2-ethylcyclohexanone is treated with LDA (in the solvent THF), followed by ethyl bromide, two different alkylated products are formed. Answer the following questions about this reaction. 1) LDA THE two products 2) CH CH Br 3. a. What is LDA and what is its purpose? 3. b. Draw mechanisms for the reactions and show how the two different products are formed. Product A Mechanism Product B Mechanism 3. c. Draw an energy diagram for the formation of both...
2. Provide the complete mechanism (curved arrows) to show how the product is formed. Include all lone pairs, formal charges, curved arrows, intermediates, and products. You do not need to draw the structures of transition states. If there is a carbocation rearrangement and/or a proton transfer, be sure to include it (them) in your mechanism. (Remember to start by drawing all ionic compounds as ions/drawing out the structure of all reagents, and drawing in all lone pairs.) HCI 3. Which...
Draw the complete mechanism for the following reaction showing
how the products are formed from the given reagents. Show all
reaction intermediates and use proper electron flow arrows
throughout.
a) Here is the overall reaction: HO I have drawn the first two arrows to guide you... please complete the mechanism (6 marks).:
6. Draw the two organic products formed in the following reaction. HO Write a mechanism for the above process.
please answers part A B&C.
A. draw the major products of the above reaction. Be
mindful of stereochemistry.
B. A student did not wait the required time for stage
one to occur prior to adding the chemical for stage 2, instead of
mixing all three chemicals together. This mistake led to additional
(different) products being formed. Draw the major products of two
other reactions that could a occur. You do not have to decide which
among these reactions is major...
7. Under the following conditions, three products are formed in this reaction. OH H2O a. Draw the mechanism that leads to the product that is the least likely to form in the space below. (7pts) b. In the space below, explain why that product is the most likely to form. You should be able to justify your answer. (4pts)
Question 3. Predict the major products of the reactions below. Draw the full mechanism for the reactions, using appropriate arrows to indicate electron movement and the full structures of any intermediate(s). Use the mechanism of the reaction to provide a rationale for why the major product formed. OM (1 equivalent) ansole Bry Febr (1 culle brambenzone Fer (1 equivalent Priloromethylbenzene (9 marks) Question 4. Predict the major product from the treatment of 2,5-dibromopyridine with ammonia. Draw the full mechanism for...
5. For the following acid-base reactions, complete the products, show the mechanism (curved arrows), and label the acid, base, conjugate acid, and conjugate base. A) ? O:N H B) :- ? H Page 2 of 3 6. For the reaction in question 5 (A and B), write the pk, values of the acid and conjugate acid underneath them and then circle the side of the equilibrium that is favored. If neither side is favored, write "neither." Briefly explain quantitatively (using...
please explain
2. (A) Draw the products of the acid/base reaction, (B) determine the position of the equilibrium, (C) use curved arrows to show the mechanism of the reaction and (D) briefly answer "Would water be suitable to protonate the carboxylic acid?". (8 pts) H-O + F3C H
1) Give the product of the two reactions shown. КОН xs Br2 can form. 2) Draw the arrows for this enolization mechanism and explain why the enolate anion can سلسل • -- Why can the enolate anion form? 3) Fill in the arrows for the alkylation mechanism below. Explain why the enolate anion 1) KOH late anion can form OH : -Br Why can the enolate ion form? 4) Give the product of the following reaction. NaOEt CH3Br H30 5)...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 7 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 38 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago