IUPAC name for this structure what is the molecular formula of this organic compund? ОН
Given the expanded molecular formula give the IUPAC name for the organic compound: CH3CHCHCH2CH2CH(CH2CH3)CH2CH3 (It might help to take the expanded molecular formula and draw the structural formula) The IUPAC name of the molecule shown above is Give the family name for the organic compound shown here: C-C-C-C-NH2 The family name of the molecule shown above is a(n)
please give the IUPAC name for the following structure and molecular weight/chemical formula. m/z of 74 ?? ?? 3-??2-?? ???
what is the correct iupac name for the compund shown here? Question 7 of 9 What is the correct IUPAC name for the compound shown here? 2- 4. 3. 6- 5- iso di sec- tert- tri BI o с * 6 7 8
Need some help on this Chemistry Lab (Organic Chemicals) Molecular formula Condensed structure Skeletal structure Name: Cis-2-pentene сн(сн), сна см3 Molecular formual: C5 HD Draw a stereoisomer of E Name: Molecular formula: (Fars) Name: 2-methyl-2-butene Molecular formula: a) Is molecule G a structural or stereoisomer of molecules E and F? Explain briefly. b) Can you build a stereoisomer of molecule G? If yes, build it and draw it here. If no. explain briefly. Expanded structure with dash-wedge drawing Name and...
Using IUPAC rules, name the following organic compounds A. Br ОН B. C. ОН D, H E.
ving the molecular formula Chand contac t menclature dve the IUPAC the IUPAC name for each compound CH,CH,CHCH,CHCH,CH,CH CH, CHCHE CH,CH CH CH,CHCCH2CH2CHCHCH,CHCH Сн,сна сносно C. CH,CH,CH,C(CH3)2C(CH3)2CH.CH & CH.CH,C(CH.CH3)2CH(CH3)CH(CH,CH,CH) e. (CH,CHỊ) CCH(CH3)CH CHẠCH f. CH,CHCH(CH3)CH(CH3)CH(CH CH CH3)(CH), CH, 9. (CH2CH2CH2), 4.41 Give the structure and IUPAC name for each of the nine isomers having molecular formula C H20
What is the IUPAC name for the compound? IUPAC name: ОН Hс-
determine the following type of compund: BaCr207 a. ionic b. molecular-acid c. molecular-organic d. molecular-other
The structure below has the formula C7H16. Please name it according to IUPAC rules. The structure below has the formulaC5H12. Please name it according to IUPAC rules.
What is the IUPAC name for the compound shown? ОН name: Нас —С—СH3 ОН