What is the mechanism for the first step of Dilantin synthesis (Benzil + Urea in the presence of NaOH)?
What is the mechanism for the first step of Dilantin synthesis (Benzil + Urea in the presence of NaOH)?
Homework Answers
ANS-:The mechanism of this reaction begins with
the nucleophilic attack of a urea nitrogen atom on
one of the carbonyls of benzil. The loss of a
proton from the quaternary nitrogen atom produces an intermediate
containing a ketone and an oxyanion.
THANK
YOU
Add Answer to:
What is the mechanism for the first step of Dilantin synthesis (Benzil + Urea in the presence of NaOH)?
9. Based on looking at your TLC plate taken during step 2 of Dilantin synthesis, answer...
9. Based on looking at your TLC plate taken during step 2 of Dilantin synthesis, answer the following questions (a) Which is more polar, benzoin or benzil? Circle Below. Benzoin Benzil (b) Now look at the structures of benzoin and benzil. Specifically explain why one of these compounds has a lower Rr value than the other. You must address structure in your answer. Explain in one or two sentences (c) How can you tell by TLC if your reaction went...
16. The second step of Dilantin synthesis is an oxidation/reduction reaction. Show how you would complete...
16. The second step of Dilantin synthesis is an oxidation/reduction reaction. Show how you would complete the following oxidation/reduction reactions below: H3C CH3 ?? PCC ?? CH2Cl2
Post-Lab Questions: 1. Propose a detailed mechanism for the synthesis of phenytoin from benzil. (10 pts)...
Post-Lab Questions: 1. Propose a detailed mechanism for the synthesis of phenytoin from benzil. (10 pts) 'H NMR and C NMR Assignment: Assign the 'H NMR and C NMR signals by filling in the corresponding blanks. (The points for this assignment are included in the lab report.)
write a complete step-wise mechanism showing the oxidation of benzoin to benzil. (show curved arrow, lone...
write a complete step-wise mechanism showing the oxidation of benzoin to benzil. (show curved arrow, lone pairs, charges)
A.) What is the mechanism for the first step? B.) What is the mechanism for the...
A.) What is the mechanism for the first step? B.) What is the
mechanism for the second step? C.) What is the thermodynamic drivng
force for the conversion of A to B?
HAH HCI CH.OK P OCHz C/O NH3. Ph-CN Ph NH2 + CH3OH B a. Provide a mechanism for the first step, which forms imino ester salt A. b. Provide a mechanism for the second step, which forms amidine salt B. c. What is the thermodynamic driving force for...
Organic Chemistry question partial step of a synthesis. Can someone explain the mechanism? Thank you. c)...
Organic Chemistry question
partial step of a synthesis. Can someone explain the mechanism?
Thank you.
c) NaOH, H2O O O HCI, H20 d) Heat cyclobutyl methyl ketone
5. Complete the following synthesis and draw the mechanism of step 5. O Na Step 1...
5. Complete the following synthesis and draw the mechanism of step 5. O Na Step 1 Step 2 Step 3 Na2Cr207, H2SO4, H2O Step 5 HCI, H2O Step 4 Mechanism of Step 5:
• Provide the step-by-step synthesis route/pathway (not mechanism) from the below starting material to the desired...
• Provide the step-by-step synthesis route/pathway (not mechanism) from the below starting material to the desired final product. (4 points) OH
The synthesis of ____________ is the first committed step of fatty acid synthesis and the enzyme...
The synthesis of ____________ is the first committed step of fatty acid synthesis and the enzyme that catalyzes this reaction,_____________ is the major site of regulation of fatty acid synthesis.
12. In a synthesis of isopropyl pyridine, the 3-methyl-2- presence of sodium ethoxide to give a...
12. In a synthesis of isopropyl pyridine, the 3-methyl-2- presence of sodium ethoxide to give a dicarbonyl compo NaOCH.CH opropyl pyridine, the 3 with ethyl formate in the 0 ethyl formate 3-methyl-2-butanone a) In the first step of the mechanism, sodiu alpha position to form an enolate. Complete the as necessary (4 points) step of the mechanism, sodium ethoxide deprotonates 3-methyl-2-buthone at the O form an enolate, Complete this reaction with curly arrows drawing in H atoms b) Why is...
9. Based on looking at your TLC plate taken during step 2 of Dilantin synthesis, answer the following questions (a) Which is more polar, benzoin or benzil? Circle Below. Benzoin Benzil (b) Now look at the structures of benzoin and benzil. Specifically explain why one of these compounds has a lower Rr value than the other. You must address structure in your answer. Explain in one or two sentences (c) How can you tell by TLC if your reaction went...
16. The second step of Dilantin synthesis is an oxidation/reduction reaction. Show how you would complete the following oxidation/reduction reactions below: H3C CH3 ?? PCC ?? CH2Cl2
Post-Lab Questions: 1. Propose a detailed mechanism for the synthesis of phenytoin from benzil. (10 pts) 'H NMR and C NMR Assignment: Assign the 'H NMR and C NMR signals by filling in the corresponding blanks. (The points for this assignment are included in the lab report.)
A.) What is the mechanism for the first step? B.) What is the
mechanism for the second step? C.) What is the thermodynamic drivng
force for the conversion of A to B?
HAH HCI CH.OK P OCHz C/O NH3. Ph-CN Ph NH2 + CH3OH B a. Provide a mechanism for the first step, which forms imino ester salt A. b. Provide a mechanism for the second step, which forms amidine salt B. c. What is the thermodynamic driving force for...
Organic Chemistry question
partial step of a synthesis. Can someone explain the mechanism?
Thank you.
c) NaOH, H2O O O HCI, H20 d) Heat cyclobutyl methyl ketone
5. Complete the following synthesis and draw the mechanism of step 5. O Na Step 1 Step 2 Step 3 Na2Cr207, H2SO4, H2O Step 5 HCI, H2O Step 4 Mechanism of Step 5:
• Provide the step-by-step synthesis route/pathway (not mechanism) from the below starting material to the desired final product. (4 points) OH
12. In a synthesis of isopropyl pyridine, the 3-methyl-2- presence of sodium ethoxide to give a dicarbonyl compo NaOCH.CH opropyl pyridine, the 3 with ethyl formate in the 0 ethyl formate 3-methyl-2-butanone a) In the first step of the mechanism, sodiu alpha position to form an enolate. Complete the as necessary (4 points) step of the mechanism, sodium ethoxide deprotonates 3-methyl-2-buthone at the O form an enolate, Complete this reaction with curly arrows drawing in H atoms b) Why is...
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 1 minute ago -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 18 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 19 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 33 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 5 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago