Homework Answers
Add Answer to:
Write the names and colors of all reactants and products: color name Fe(NH)2(SO) (H,O)s H2C O Fe(C:O) (H2O): (NH.)E...
Write the complete electronic configurations for the neutral manganese atom, Mn ion and the manganese ion...
Write the complete electronic configurations for the neutral manganese atom, Mn ion and the manganese ion in MnO. Comment on the relationship between the colors of the MnO. and Mn2 and the electronic configurations. 4. The following reaction was performed for the determination of oxalate in the green salt: 5. 5 CO (aq)+ 2 MnO (ag) + 16 H"(ag)-10 CO:) + 2 Mn (ag) + 8 H:O Determine the oxidation states of all atoms. a. b. Identify the oxidizing and...
please write the steps needed to get this product. A NaBH4/H:0 S KMnO4 HNO3 H2SO4 K...
please write the steps needed to get this product.
A NaBH4/H:0 S KMnO4 HNO3 H2SO4 K HNO3 H2SO4 B LiAlH4/H:07 T CH3MgBr/H:0* U 1. LDA/ 2. CH Br C Dess-Martin L Nal D CrOz/H:07 M H3PO4 V NaCN E H/Pd N Bry/FeBr3 W NH 0 CH:COCI/AICI: X CH3NH2 P CH:CH-CT/AICI: Y SOCI: F SnCl/H30* 1. Hg(OAc)2, H2O/THF G 2. NaBHA HH2SO4, H2O, HgSO4 1. BH3, THF 2. H2O2, OH Q H3O+/H20 Z CH OH R KOH O CHICHI CH3CH CH:CH-C-OH...
EXPERIMENT 8: Synthesis of Aquapentaammine-Cobalt (II) Nitrate, [Co(NH)sH2O1(NO)s Pre-Lab Questions: The complex salt [Cu(NH3)4][SO,1- H,O can...
EXPERIMENT 8: Synthesis of Aquapentaammine-Cobalt (II) Nitrate, [Co(NH)sH2O1(NO)s Pre-Lab Questions: The complex salt [Cu(NH3)4][SO,1- H,O can be prepared by direct combination of its constituents: Cu +4 NH,+SO+ H2O [Cu(NH)JSO. H;O In an aqueous reaction solution contained 1.0 g CuCl, 2H2O, 1.0 mL 14 M NHs, and 1.0 g NazSO, what would be the maximum theoretical vield (in grams) of product? To what percent yield would 0.42 g of product correspond? Your yield of crude product is 1.8 g and you...
Complete the following reaction and write the IUPAC names of the two products. + NaOH H₂O...
Complete the following reaction and write the IUPAC names of the two products. + NaOH H₂O HCOCH2CH3 Submit Answer Retry Entire Group 4 more group attempts remaining Complete the following reaction by drawing structural formulas for the organic product(s). CH3CH2CHCOCH3 + NH3 CH2CH3 • You do not have to consider stereochemistry. • If there are two different organic products, draw both. • Draw one structure per sketcher. Add additional sketchers using the drop-down menu Separate multiple products using the +...
2. For the reactions that were to be completed in Part A of the experiment, prepare a table with ...
Part A:
Part B:
Need help ASAP!!
2. For the reactions that were to be completed in Part A of the experiment, prepare a table with the formulas from Group A as headings of the columns and the formulas of Group B as headings of the ows. Within the table, fill in the formula and systematic name of the predicted precipitates that will form. If no precipitate is expected from the reaction, write 'No Reaction'. For each predicted precipitate, look...
Draw the structure of the final product(s) of this series of reactions 1pt ernces 1 pt...
Draw the structure of the final product(s) of this series of reactions 1pt ernces 1 pt 1. Br 1 pt 2.3 equivalents of NaNH 3. mild acid 1 pt 4. BH 5. H202/ NaOH 1 pt 1 pt 1 pt Use the wedge/hash bond tools to indicate stereochemistry where it exists Include H atoms at chiral centers only If a group is achiral, do not use wedged or hashed bonds on it Draw organic species only. Do not include lone...
Please I need help on this. I'm so lost 1. Acetic acid (H)CO2H) has k, =...
Please I need help on this. I'm so lost
1. Acetic acid (H)CO2H) has k, = 1.8 x 10- and acetate (H:C:01") has ks = 5.6 x 10-10. (a) Write balanced chemical equilibrium equations (with physical states) for acid dissociation of acetic acid and base hydrolysis of acetate ion. (b) Write K, and equilibrium constant expressions for the above reactions. (c) Use your expressions from part b to show that Kx. = 1.0 x 10-* = [H,O'][OH). 2. For each...
2. Write the chemical formulas for the following: b. aluminum a. copper c. hydrochloric acid e....
2. Write the chemical formulas for the following: b. aluminum a. copper c. hydrochloric acid e. copper(II) chloride g. sodium hydroxide i. hydrogen k. carbon dioxide m. calcium carbonate o. aluminum chloride q. calcium chloride d. magnesium sulfate – f. sodium bicarbonate h. methane j. sodium chloride 1. oxygen n. magnesium hydroxide p. sodium carbonate — r. water t. carbon monoxide S. sodium v. iron u. sulfur w.iron (II) sulfide y. sulfuric acid x. magnesium chloride z. sodium sulfate 3....
When you write the answers, please write the page number for which the question is located....
When you write the answers, please write the page number for
which the question is located. Thank you!
Experiment 8 Name: Double Replacement Reactions Background: Some reactions have the net effect of causing the cation of cach reactant to trade places, forming a compound with the other anion. These reactions are known as double replacement reactions. In the example below (unbalanced equation), the barium and sodium cations switch places so that barium forms a product with sulfate while sodium forms...
Convert playlist Diction QUESTIONS 1. (2 Points) Why is it essential to keep the diazonium salt...
Convert playlist Diction QUESTIONS 1. (2 Points) Why is it essential to keep the diazonium salt at zero degrees while you are preparing the sodium 2-naphthoxide solution? 2. (2 Points) Would you need to use sodium carbonate for the diazotization of meta- nitroaniline? Explain your answer. 3. (2 Points) What would be the IUPAC name for the azo dye if you would have used p-chloroaniline instead of sulfanilic acid? Experiment 12 4. (4 Points) Calculate the theoretical yield for Orange...
Write the complete electronic configurations for the neutral manganese atom, Mn ion and the manganese ion in MnO. Comment on the relationship between the colors of the MnO. and Mn2 and the electronic configurations. 4. The following reaction was performed for the determination of oxalate in the green salt: 5. 5 CO (aq)+ 2 MnO (ag) + 16 H"(ag)-10 CO:) + 2 Mn (ag) + 8 H:O Determine the oxidation states of all atoms. a. b. Identify the oxidizing and...
please write the steps needed to get this product.
A NaBH4/H:0 S KMnO4 HNO3 H2SO4 K HNO3 H2SO4 B LiAlH4/H:07 T CH3MgBr/H:0* U 1. LDA/ 2. CH Br C Dess-Martin L Nal D CrOz/H:07 M H3PO4 V NaCN E H/Pd N Bry/FeBr3 W NH 0 CH:COCI/AICI: X CH3NH2 P CH:CH-CT/AICI: Y SOCI: F SnCl/H30* 1. Hg(OAc)2, H2O/THF G 2. NaBHA HH2SO4, H2O, HgSO4 1. BH3, THF 2. H2O2, OH Q H3O+/H20 Z CH OH R KOH O CHICHI CH3CH CH:CH-C-OH...
EXPERIMENT 8: Synthesis of Aquapentaammine-Cobalt (II) Nitrate, [Co(NH)sH2O1(NO)s Pre-Lab Questions: The complex salt [Cu(NH3)4][SO,1- H,O can be prepared by direct combination of its constituents: Cu +4 NH,+SO+ H2O [Cu(NH)JSO. H;O In an aqueous reaction solution contained 1.0 g CuCl, 2H2O, 1.0 mL 14 M NHs, and 1.0 g NazSO, what would be the maximum theoretical vield (in grams) of product? To what percent yield would 0.42 g of product correspond? Your yield of crude product is 1.8 g and you...
Complete the following reaction and write the IUPAC names of the two products. + NaOH H₂O HCOCH2CH3 Submit Answer Retry Entire Group 4 more group attempts remaining Complete the following reaction by drawing structural formulas for the organic product(s). CH3CH2CHCOCH3 + NH3 CH2CH3 • You do not have to consider stereochemistry. • If there are two different organic products, draw both. • Draw one structure per sketcher. Add additional sketchers using the drop-down menu Separate multiple products using the +...
Part A:
Part B:
Need help ASAP!!
2. For the reactions that were to be completed in Part A of the experiment, prepare a table with the formulas from Group A as headings of the columns and the formulas of Group B as headings of the ows. Within the table, fill in the formula and systematic name of the predicted precipitates that will form. If no precipitate is expected from the reaction, write 'No Reaction'. For each predicted precipitate, look...
Draw the structure of the final product(s) of this series of reactions 1pt ernces 1 pt 1. Br 1 pt 2.3 equivalents of NaNH 3. mild acid 1 pt 4. BH 5. H202/ NaOH 1 pt 1 pt 1 pt Use the wedge/hash bond tools to indicate stereochemistry where it exists Include H atoms at chiral centers only If a group is achiral, do not use wedged or hashed bonds on it Draw organic species only. Do not include lone...
Please I need help on this. I'm so lost
1. Acetic acid (H)CO2H) has k, = 1.8 x 10- and acetate (H:C:01") has ks = 5.6 x 10-10. (a) Write balanced chemical equilibrium equations (with physical states) for acid dissociation of acetic acid and base hydrolysis of acetate ion. (b) Write K, and equilibrium constant expressions for the above reactions. (c) Use your expressions from part b to show that Kx. = 1.0 x 10-* = [H,O'][OH). 2. For each...
2. Write the chemical formulas for the following: b. aluminum a. copper c. hydrochloric acid e. copper(II) chloride g. sodium hydroxide i. hydrogen k. carbon dioxide m. calcium carbonate o. aluminum chloride q. calcium chloride d. magnesium sulfate – f. sodium bicarbonate h. methane j. sodium chloride 1. oxygen n. magnesium hydroxide p. sodium carbonate — r. water t. carbon monoxide S. sodium v. iron u. sulfur w.iron (II) sulfide y. sulfuric acid x. magnesium chloride z. sodium sulfate 3....
When you write the answers, please write the page number for
which the question is located. Thank you!
Experiment 8 Name: Double Replacement Reactions Background: Some reactions have the net effect of causing the cation of cach reactant to trade places, forming a compound with the other anion. These reactions are known as double replacement reactions. In the example below (unbalanced equation), the barium and sodium cations switch places so that barium forms a product with sulfate while sodium forms...
Convert playlist Diction QUESTIONS 1. (2 Points) Why is it essential to keep the diazonium salt at zero degrees while you are preparing the sodium 2-naphthoxide solution? 2. (2 Points) Would you need to use sodium carbonate for the diazotization of meta- nitroaniline? Explain your answer. 3. (2 Points) What would be the IUPAC name for the azo dye if you would have used p-chloroaniline instead of sulfanilic acid? Experiment 12 4. (4 Points) Calculate the theoretical yield for Orange...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 16 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 47 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago