Why would concentrated hydrochloric acid be an inappropriate catalyst for the dehydration of cyclohexanol?
Why would concentrated hydrochloric acid be an inappropriate catalyst for the dehydration of cyclohexanol?
Homework Answers
In HCl, Cl- is a good nucleophile. Hence elimination reactions compete with nucleophilic substitution reactions. HCl is not a good dehydrating agent like H2SO4.
As concentrated sulphuric acid is available as 98% and HCl is available as 37% . Hence in HCl, more amount of water is present than sulphuric acid. Hence HCl cannot acts as dehydrating agent.
Add Answer to:
Why would concentrated hydrochloric acid be an inappropriate catalyst for the dehydration of cyclohexanol?
1. What is the function of the acid catalyst in promoting the dehydration of cyclohexanol?
1. What is the function of the acid catalyst in promoting the dehydration of cyclohexanol?
why would concentrated hydrochloric acid be a poor choice as the acid catalyst the too informatjon...
why would concentrated hydrochloric acid be a poor choice as
the acid catalyst
the
too informatjon was not supposed to be there
[References) Draw the major product(s) of the following reactions including stereochemistry when it is appropriate (CH3)2CHCH2-CEC-H . 1 Br2 • Consider E/Z stereochemistry of alkenes. If there is more than one major product possible, draw all of them. Draw one structure per sketcher. Add additional sketchers using the drop-down menu in the bottom right comer. • Separate multiple...
2. a. Both concentrated sulfuric acid and concentrated phosphoric acid are known to catalyze the conversion...
2. a. Both concentrated sulfuric acid and concentrated phosphoric acid are known to catalyze the conversion of cyclohexanol to cyclohexene via dehydration reaction. Concentrated hydrochloric acid, however, is not a viable option. Provide two reasons on what make sulfuric acid and phosphoric acid advantageous over hydrochloric acid. Look up additional information on these acids if needed. b. In preparation of the bromohydrin (trans-2-bromo-1-methylcyclohexanol) with bromine, side products dibromides shown below are often observed. This side reaction can be essentially avoided...
What is the major disadvantage of using concentrated sulfuric acid (or hydrochloric acid) rather...
What is the major disadvantage of using concentrated sulfuric acid (or hydrochloric acid) rather than85% phosphoric acid for the dehydration of alcohols?
In the presence of an acid catalyst, cyclohexanol (100.16 g/mol) is dehydrated to give cyclohexane (82.14...
In the presence of an acid catalyst, cyclohexanol (100.16 g/mol) is dehydrated to give cyclohexane (82.14 g/mol) and water. A dehydration reaction starting with 3.23.2 g cyclohexanol produces 2.12.1 g cyclohexene. Calculate the percent yield for this reaction. Report your answer with two significant figures.
Convert Cyclohexanol to Cyclohexene via a Acid-Catalyzed Dehydration reaction 1. Why does the product ‘come over’...
Convert Cyclohexanol to Cyclohexene via a Acid-Catalyzed Dehydration reaction 1. Why does the product ‘come over’ after being formed? Please think about the properties of the starting material and product. 2. If there was no acid present, would you expect to get a product? Why/why not? 3. If we start off with 10 molecules of the starting alcohol and only get an 80% yield, how many molecules will we find in the product flask? 4. Look up the concept of...
What would be the balanced equation for the addition of concentrated hydrochloric acid to cobalt chloride?...
What would be the balanced equation for the addition of concentrated hydrochloric acid to cobalt chloride? CoCl2(aq) + CoCl2(aq) + ????
In the dehydration reaction of cyclohexanol to cyclohexene, What problems would be encountered if 3-heptanol is...
In the dehydration reaction of cyclohexanol to cyclohexene,
What problems would be encountered if 3-heptanol is used as a
starting material, (instead of cyclohexanol) and how can they be
circumvented?
OH O 04 + upon 4. O + ho + H3PO4 - + H2O cyclohexanol cyclohexene Figure 10. The dehydration of cyclohexanol to form cyclohexene.
Write equations for the mechanistic steps in the dehydration of cyclohexanol assuming an E1 mechanism. What...
Write equations for the mechanistic steps in the dehydration of cyclohexanol assuming an E1 mechanism. What is the role of phosphoric acid? Why is heat required?
In the Dehydration of Cyclohexanol (used Cyclohexanol to get Cyclohexene), we had to do distillation twice....
In the Dehydration of Cyclohexanol (used Cyclohexanol to get Cyclohexene), we had to do distillation twice. Why is that? My TA said it had something to do with Azeotropes but I can't figure out why.
why would concentrated hydrochloric acid be a poor choice as
the acid catalyst
the
too informatjon was not supposed to be there
[References) Draw the major product(s) of the following reactions including stereochemistry when it is appropriate (CH3)2CHCH2-CEC-H . 1 Br2 • Consider E/Z stereochemistry of alkenes. If there is more than one major product possible, draw all of them. Draw one structure per sketcher. Add additional sketchers using the drop-down menu in the bottom right comer. • Separate multiple...
2. a. Both concentrated sulfuric acid and concentrated phosphoric acid are known to catalyze the conversion of cyclohexanol to cyclohexene via dehydration reaction. Concentrated hydrochloric acid, however, is not a viable option. Provide two reasons on what make sulfuric acid and phosphoric acid advantageous over hydrochloric acid. Look up additional information on these acids if needed. b. In preparation of the bromohydrin (trans-2-bromo-1-methylcyclohexanol) with bromine, side products dibromides shown below are often observed. This side reaction can be essentially avoided...
In the dehydration reaction of cyclohexanol to cyclohexene,
What problems would be encountered if 3-heptanol is used as a
starting material, (instead of cyclohexanol) and how can they be
circumvented?
OH O 04 + upon 4. O + ho + H3PO4 - + H2O cyclohexanol cyclohexene Figure 10. The dehydration of cyclohexanol to form cyclohexene.
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 43 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago