Calculate the change in energy, etc.
Will upvote correct answers, thank you!
Homework Answers
Add Answer to:
Calculate the change in energy, etc. Will upvote correct answers, thank you! 1) Calculate the change in energy (in units...
Calculate the change in energy (in units of kJ/mol) between the excited state and ground state...
Calculate the change in energy (in units of kJ/mol) between the excited state and ground state for the transition that results in the emission of 285 nm light. (4 pts) A) 4.20 x 102 kJ/mol B) 6.20 x 102 kJ/mol C) 4.20 x 104 kJ/mol
Question 5 5 pts Calculate the standard free energy change for the reduction of Fe, o,...
Question 5 5 pts Calculate the standard free energy change for the reduction of Fe, o, by hydrogen to produce iron metal and water vapor at 230 °C using the data provided. AHF,0, --8242 KJ-mol-1 AHH,0 = -2418 kJ mol S298 Fe30,- 874 ) mol%. S998 H2 - 130.6 mol S98 Fe - 27.3 J-molk! S%99H20 - 188.7 J-mol-K a. 98.8 kJ b. 142JK C.-7.13 x 10ºkJ d. 27.4k
Calculate the free energy change of the following reaction (in kJ). 2 A + 4B 4C+D Assume the following free energy...
Calculate the free energy change of the following reaction (in kJ). 2 A + 4B 4C+D Assume the following free energy of formations (given in kJ/mol): A = -41.0, B = 225.4, C = 97.6, D = 443.8. free energy change:
Calculate the free energy change for the following reaction at 25°C. 4 CuO(8) + CH4(g) 4...
Calculate the free energy change for the following reaction at 25°C. 4 CuO(8) + CH4(g) 4 Cu(s) + CO2(g) + 2 H2O(g) AH° =-175.2 kJ AS = 368.4 J/K a) -285 kJ b) 466 kJ c) -301 kJ d) -182 kJ
QUESTION 8 PLEASE SHOW YOUR WORK Calculate the free energy change of the following reaction (in...
QUESTION 8 PLEASE SHOW YOUR WORK
Calculate the free energy change of the following reaction (in kJ) 2A + 3B → 3C + D given the following free energy of formations (given in kJ/mol): A-549.3, B = 195.0, c =-375.6, D- -474.6 Number kJ
Using the data below, calculate the change in energy expected for each of the following processes....
Using the data below, calculate the change in energy expected for each of the following processes. Successive Ionization Energies (kJ/mol) Atom Li 11 | 12 520.7282 590.1145 Ca 500 UAE Electron Affinities of the Halogens Atom Electron Affinity (kJ/mol) -295.2 CI -348.7 a. Li(9) + I(9) Lit (9) +I (9) Change in energy = kJ b. Ca(g) + Cl(g) + Cat (g) + C14 (9) Change in energy = kJ c. Cat(g) + C1(g) → Ca2+(g) + CI+ (g) Change...
PLEASE SHOW WORK 1. Calculate the energy (1) change associated with an electron transition from n...
PLEASE SHOW WORK
1. Calculate the energy (1) change associated with an electron transition from n = 2 to n=5 in a Bohr hydrogen atom. (3 points) Rydberg constant, Ry = 1.096776 x 10' m' hcRy = 2.18 x 10'8; Planck's constant, h = 6.626 x 1034 JS c = 2.998 x 109 m/s 2. a) Draw all the possible resonance structures for the carbonate ion. (3 points) b) What is the molecular geometry of the carbonate ion? 3. Using...
Calculate the free energy change of the following reaction (in kJ). 2A + 4B 4C+D Assume the following free energy o...
Calculate the free energy change of the following reaction (in kJ). 2A + 4B 4C+D Assume the following free energy of formations (given in kJ/mol): A = -410, B = 225.4, C = 97.6, D = 443.8. free energy change: 14.6
please help me undersatnd how to solve the following two probekms below, thank you: What's change...
please help me undersatnd how to solve the following two probekms
below, thank you:
What's change in enthalpy at 25 degrees Celsius and 1 atm for the production of 1. 0.345 mol of iron (III) oxide? 4Fe(s)+302(g)-> 2F€2O3(s); AH= -1651 kJ A)-570. kJ B)-285 kJ C)-1140 D)285 kJ E)570. kJ 2) Given the thermochemical equation 2A1203(s) 4Al(s)+302(g); AH = 3352kJ find AHH for the following reaction. 8Al(s)602(g)-»4A1203(s) a) 838 kJ b)1676 kJ c)-6704 kJ d)1676 kJ e) 6704 kJ
(9) A spontaneous process has the change of free energy (a) AG>0 (c) AG = 0...
(9) A spontaneous process has the change of free energy (a) AG>0 (c) AG = 0 (b) AG <O (d) AH>0 and AS <O (10) A chemical reaction has AH = 10 kJ. AS = 50 J/K at temperature T = 300 K. the reaction AG = J. (a) 5000 (b) -5000 (c) 10000 (d) 50 (11) For reaction: Ag (s) + 2 Cl2 (g) Ag° (aq) +CI (aq), the standard free energy of formation: AGf° (Ag*) = 77.1 kJ/mol,...
Question 5 5 pts Calculate the standard free energy change for the reduction of Fe, o, by hydrogen to produce iron metal and water vapor at 230 °C using the data provided. AHF,0, --8242 KJ-mol-1 AHH,0 = -2418 kJ mol S298 Fe30,- 874 ) mol%. S998 H2 - 130.6 mol S98 Fe - 27.3 J-molk! S%99H20 - 188.7 J-mol-K a. 98.8 kJ b. 142JK C.-7.13 x 10ºkJ d. 27.4k
Calculate the free energy change of the following reaction (in kJ). 2 A + 4B 4C+D Assume the following free energy of formations (given in kJ/mol): A = -41.0, B = 225.4, C = 97.6, D = 443.8. free energy change:
Calculate the free energy change for the following reaction at 25°C. 4 CuO(8) + CH4(g) 4 Cu(s) + CO2(g) + 2 H2O(g) AH° =-175.2 kJ AS = 368.4 J/K a) -285 kJ b) 466 kJ c) -301 kJ d) -182 kJ
QUESTION 8 PLEASE SHOW YOUR WORK
Calculate the free energy change of the following reaction (in kJ) 2A + 3B → 3C + D given the following free energy of formations (given in kJ/mol): A-549.3, B = 195.0, c =-375.6, D- -474.6 Number kJ
Using the data below, calculate the change in energy expected for each of the following processes. Successive Ionization Energies (kJ/mol) Atom Li 11 | 12 520.7282 590.1145 Ca 500 UAE Electron Affinities of the Halogens Atom Electron Affinity (kJ/mol) -295.2 CI -348.7 a. Li(9) + I(9) Lit (9) +I (9) Change in energy = kJ b. Ca(g) + Cl(g) + Cat (g) + C14 (9) Change in energy = kJ c. Cat(g) + C1(g) → Ca2+(g) + CI+ (g) Change...
PLEASE SHOW WORK
1. Calculate the energy (1) change associated with an electron transition from n = 2 to n=5 in a Bohr hydrogen atom. (3 points) Rydberg constant, Ry = 1.096776 x 10' m' hcRy = 2.18 x 10'8; Planck's constant, h = 6.626 x 1034 JS c = 2.998 x 109 m/s 2. a) Draw all the possible resonance structures for the carbonate ion. (3 points) b) What is the molecular geometry of the carbonate ion? 3. Using...
Calculate the free energy change of the following reaction (in kJ). 2A + 4B 4C+D Assume the following free energy of formations (given in kJ/mol): A = -410, B = 225.4, C = 97.6, D = 443.8. free energy change: 14.6
please help me undersatnd how to solve the following two probekms
below, thank you:
What's change in enthalpy at 25 degrees Celsius and 1 atm for the production of 1. 0.345 mol of iron (III) oxide? 4Fe(s)+302(g)-> 2F€2O3(s); AH= -1651 kJ A)-570. kJ B)-285 kJ C)-1140 D)285 kJ E)570. kJ 2) Given the thermochemical equation 2A1203(s) 4Al(s)+302(g); AH = 3352kJ find AHH for the following reaction. 8Al(s)602(g)-»4A1203(s) a) 838 kJ b)1676 kJ c)-6704 kJ d)1676 kJ e) 6704 kJ
(9) A spontaneous process has the change of free energy (a) AG>0 (c) AG = 0 (b) AG <O (d) AH>0 and AS <O (10) A chemical reaction has AH = 10 kJ. AS = 50 J/K at temperature T = 300 K. the reaction AG = J. (a) 5000 (b) -5000 (c) 10000 (d) 50 (11) For reaction: Ag (s) + 2 Cl2 (g) Ag° (aq) +CI (aq), the standard free energy of formation: AGf° (Ag*) = 77.1 kJ/mol,...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 2 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 59 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago