Homework Answers
a) The balanced molecular equation is
H3PO4(aq) + 3NaOH(aq) ------> Na3PO4(aq) + 3H2O(l)
b) Stoichiometrically, 1mole of H3PO4 reacts with 3moles of NaOH
molarity = number of moles of solute per liter of solution
moles of NaOH consumed = ( 2.4mol/ 1000ml)× 0.85ml = 0.00204mol
moles of H3PO4 present in the 45.0ml solution = 0.00204mol/3 = 0.00068mol
molarity of H3PO4 solution = (0.00068mol/45.0ml) × 1000ml = 0.01511M
Add Answer to:
0.85 mL of 2.4 M NaOH was added to neutralize 45.0 mL of a H3PO4 solution....
47.8 ml of a 2.4 M NaOH solution is needed to neutralize 10.0 ml of an...
47.8 ml of a 2.4 M NaOH solution is needed to neutralize 10.0 ml of an unknown HCl solution. What is the concentration of the HCl?
10. During a titration, it is found that 53.5 mL of a solution of NaOH is needed to neutralize a solution that cont...
10. During a titration, it is found that 53.5 mL of a solution of NaOH is needed to neutralize a solution that contains 1.86 g of HCI. What is the concentration in molarity of the NaOH solution? [Hint: Write balanced equation for the reaction.] What volume of a 0.452 M NaOH solution is needed to neutralize 85 mL of a 0.176 M solution of H2SO? A) 218.3 mL B) 66.2 mL C) 38.4 mL D) 436.6 mL E) 33 mL
1- A) How many milliliters of 0.100 M NaOH are needed to neutralize 50.00 mL of...
1- A) How many milliliters of 0.100 M NaOH are needed to neutralize 50.00 mL of a 0.150 M solution of acetic acid (CH3COOH), a monoprotic acid? View Available Hint(s) B)What is the concentration of a solution of HCl in which a 10.0 mL sample of acid required 50.0 mL of 0.150 M NaOH solution for neutralization? C))What is the concentration of a phosphoric acid solution of a 25.00 mL sample if the acid requires 42.24 mL of 0.135 M...
How many mL of a 0.10 M NaOH solution are needed to neutralize 15 mL of...
How many mL of a 0.10 M NaOH solution are needed to neutralize 15 mL of 0.20 M H3PO4? Equation (hint): H3PO4+3NaOH----> 3H2O + Na3PO4
3. Calculate the molar concentration of an NaOH solution that required 15.81 ml to com pletely...
3. Calculate the molar concentration of an NaOH solution that required 15.81 ml to com pletely neutralize 0.509 g of KHP (Remember that the "P" in KHP does not mean phos- phorus. See the molecular structure and molar mass of KHP given earlier in the lab.) KHP(s) + NaOH(aq) - NaKP(aq) + H,O(C) 4. Calculate the mass of KHP that will react completely with 25.00 mL of 0.1750 M NaOH. 5. Write the balanced equation for the reaction that occurs...
2. Answer the following questions about phosphoric acid (H3PO4). a. (2 points) What color will a...
2. Answer the following questions about phosphoric acid (H3PO4). a. (2 points) What color will a 0.1 M solution of H3PO4 turn blue litmus paper? b. (2 points) What color will a 0.1 M solution of H3PO4 turn red litmus paper? c. (2 points) What color will phenolphthalein be in a 0.1 M solution of H,POA? d. (5 points) Write an equation for the reaction that takes place when phosphoric acid is added to water e. (4 points) What is...
In the titration of 100 ml of a 0.1 M H3PO4 with 0.5 M NAOH, calculate...
In the titration of 100 ml of a 0.1 M H3PO4 with 0.5 M NAOH, calculate the pH of the solution at each of the following points: A) before any NaOH added B) After 10 mL of NaOH added C) at 1st equivalence point
5. Calculate the pH at 25°C of a 0.85 M aqueous solution of phosphoric acid (H3PO4)....
5. Calculate the pH at 25°C of a 0.85 M aqueous solution of phosphoric acid (H3PO4). 5. (Ka1, Ka2, and Ka3 for phosphoric acid are 7.5 × 10−3, 6.25 × 10−8, and 4.8 × 10−13, respectively.)
1- It takes 83.0 mL of a 0.45 M NaOH solution to neutralize 235 mL of...
1- It takes 83.0 mL of a 0.45 M NaOH solution to neutralize 235 mL of an HCI solution. What is the concentration of the HCl solution? 2- It takes 12.5 mL of a 0.30 M HCl solution to neutralize 285 mL of NaOH solution. What is the concentration of the NaOH solution? 3- During titration, 22.4 mLofo.100 M NaOH was required to neutralize the acidic analyte. Calculate the number of moles of sodium hydroxide in the titer.
A 31.00 mL sample of an unknown H3PO4 solution is titrated with a 0.130 M NaOH...
A 31.00 mL sample of an unknown H3PO4 solution is titrated with a 0.130 M NaOH solution. The equivalence point is reached when 26.08 mL of NaOH solution is added. What is the concentration of the unknown H3PO4 solution? The neutralization reaction is H3PO4(aq)+3NaOH(aq)→3H2O(l)+Na3PO4(aq)
10. During a titration, it is found that 53.5 mL of a solution of NaOH is needed to neutralize a solution that contains 1.86 g of HCI. What is the concentration in molarity of the NaOH solution? [Hint: Write balanced equation for the reaction.] What volume of a 0.452 M NaOH solution is needed to neutralize 85 mL of a 0.176 M solution of H2SO? A) 218.3 mL B) 66.2 mL C) 38.4 mL D) 436.6 mL E) 33 mL
3. Calculate the molar concentration of an NaOH solution that required 15.81 ml to com pletely neutralize 0.509 g of KHP (Remember that the "P" in KHP does not mean phos- phorus. See the molecular structure and molar mass of KHP given earlier in the lab.) KHP(s) + NaOH(aq) - NaKP(aq) + H,O(C) 4. Calculate the mass of KHP that will react completely with 25.00 mL of 0.1750 M NaOH. 5. Write the balanced equation for the reaction that occurs...
2. Answer the following questions about phosphoric acid (H3PO4). a. (2 points) What color will a 0.1 M solution of H3PO4 turn blue litmus paper? b. (2 points) What color will a 0.1 M solution of H3PO4 turn red litmus paper? c. (2 points) What color will phenolphthalein be in a 0.1 M solution of H,POA? d. (5 points) Write an equation for the reaction that takes place when phosphoric acid is added to water e. (4 points) What is...
1- It takes 83.0 mL of a 0.45 M NaOH solution to neutralize 235 mL of an HCI solution. What is the concentration of the HCl solution? 2- It takes 12.5 mL of a 0.30 M HCl solution to neutralize 285 mL of NaOH solution. What is the concentration of the NaOH solution? 3- During titration, 22.4 mLofo.100 M NaOH was required to neutralize the acidic analyte. Calculate the number of moles of sodium hydroxide in the titer.
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 45 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago