4. Complete following multistep synthetic schemes ACC239 a) M i choan cultisteps (CH2)CO2H 220 H-Ni b)...
4. Draw the structures of the compounds formed in the following synthetic schemes. Br2 (CH3)2CHCH2CH3 UV NaOEt HBr C ROOR 1. Br2 E KOTBU ETOH 2. NaNH2(xs) 3. Нао light a. OH CHCH3 TsCl -сHа HBr B ROOR Кови A На C NaCECH 1. BH E 2. H2O2 NaOH F base Lindlars catalyst b. Br NaOMe HBr A ROOR 1. Br2 с 2. NANH2(xs) 3. H2O KOtBu В (CH3)2CCH2CH3 D MeOH с. Br2 NaOMe HBr c NaC CHD На (CH3)3CH...
Identify the reagents to be used in the following synthetic schemes: (Specify the reagents you would use to carry out the conversion by using letters from the table. Write the letters in the order that they are used, e.g., abc.) Scheme1 CH3 CH3 CH3 CH3 OH Scheme 2 Br CH3 H3C CH3 CH3 a. BH3, THF then H202, OH h. NBS, CCl b. PBr3 c. Mg, ether then H3o* d. (CH3)2Culi e. Br2 f. NaNH2, NH3 g. H2O, H2SO4, HgSO4...
e. 4-HC-C6H4-NH-C(O)-CH3 + Cl2/H4C-COH ------> H30* f. 4-nitro-1-chlorobenzene + NaOH H2O g. Ph-CH2-CH2-CH2-CO2H + AICI: -------> h. All trans-H2C=CH-CH=CH-OCH3 + H2C=CH-C(O)-H i. 1-bromo-3-chlorobenzene + HNO3/H2SO4 j. CsH5-CH=CH-CH3 + HBr/peroxides --------> H30* k. Ph-CH2-CH3 + KMnO./NaOH/A ----------> L. CoHs-CCl3 + Bry/FeBr ---------- H30* m. Ph-Br + KNH/-33 °C --------
Practice Set-lll CH3 o 1. H3c-C- CHa a HaC, CH3 PY ? H-C-N H Нас + OH T CH2 2. ? CH2 he N(CH3)2 O2N HaC CH3 Phosgene, ? (Review a 3. O-CC2 2 CO2H PY ? HaC 4. Нас OH +CH3 NH2 ? H + excess CH30H ? 6. CH(CH2)16 heat b-(CH2)1CH3 heat ? 7. CaHs-C O-CH2 + NH2-OH hydrorylarnine O- Practice Set-lll CH3 o 1. H3c-C- CHa a HaC, CH3 PY ? H-C-N H Нас + OH T...
Identify the reagents to be used in the following synthetic schemes: (Specify the reagents you would use to carry out the conversion by using letters from the table. Write the letters in the order that they are used, c.g..abc.) Scheme 1: Scheme 2: a- -0- Reagents Available a. BH, THF then H2O2, OH h. NBS, CCL b. PBr3 HBO c. Mg. ether then H30 1. H2, Lindlar's catalyst d. (CH), Culi k. RCOOOH e. Brz I. O, then Zn, H30*...
5. Complete the following triacylglycerol reactions: a. Complete Hydrogenation: CH2-0-C-(CH3)-CH-CH (CH)s-CH CH-0-C-(CHỊhCH=CH-(CHỊ) -CH, + 3H, Ni, CH2-0-º-(CH3)-CH=CH-(CHỊ) -CHỊ b. Partial Hydrogenation: CH-0-C-(CH2)-CH-CH-(CH3)-CH; CH-0-C-(CH2)-CH-CH-CH2-CH3 + 2H, N . CH-0-C-(CH3)-CH=CH-(CH3-CH c Acid Hydrolysis: CH2-0-C-(CH3)-CH=CH-(CH3)-CH, -0-C-(CH); -CH=CH-CH2)-CH3 + 3H. 0 . 10 CH2-0-C-(CH2)2CH=CH-(CH2)s -CH; d. Saponification: CH2-0-C-(CH3)-CH=CH-CH2)-CH CH-0-C-(CH)-CH=CH-CH3)-CH+ 3NaOH Heat CH2-0-C-(CH)-CH-CH-CH2-CH,
HC-C+ CH2 CHs a) Icll 11 c) III</</I d) l 11K1 Part B ) Please show how to do the synthetic transformations shown below (You may need multistep synthesis, that is several steps may be needed ). (5 points each). You may only use reactions and molecules described in chapters 1-12 of the textbook. A) он CHM 250 Spring 2019 Final Exam CHM 250 B) C) O N 12 HC-C+ CH2 CHs a) Icll 11 c) III
QUESTION 2: 1. Name for the following compound. CH2CH= CCH2CH3 CH3 2- Complete the following equations: A- CH3 H3C-Ć=CH-CH2 + H-Br — B- CH3 H2C= C + Br2
5. Consider the following compounds a) CH(CH2).CH b) CH.CHEH d) CH.CH. BOH C) CHEECH e) CH(CH2).CH-CHCH, 1) CH (CH2),CEN g) C&H OH h) CH (CH2),N(CH3)2 D) CH.CH CHEN(CH_CH2CH3)2 i) CHCH k) CH3CH2OH ) CH,(CH2), COCH Which one(s) of the above would be soluble in water? Which one(s) would not be soluble in water but would be soluble in 5% HCI? Which one(s) would not be soluble in water but would be soluble in 5% NaOH? Which one(s) would not be...
Complete the following reaction equations (Hint for b and c: Markonikov’s Rule applies; reaction in e refers to oxidation) a. CH3(CH2)2CH=CH2 + Br2 -->?? b. CH3CH2C(CH3)=CHCH3 + HI -->?? c. CH3CH2CH=CH2 + H2O (in the presence of H+) --> ?? d. C6H5-CH=CH2 + H2 (in the presence of Pt @ 25o C and 1 atm) -->?? (note: C6H5 = benzene ring) e. CH3CH=CHCH3 + KMnO4 (in the presence of H2O; cold) --> ??