Homework Answers
Add Answer to:
Select the product formed from adding sodium borohydride to 6-hydroxy-3-p-cyanophenylheptan-2-one 1. Select the product formed from...
F2019-Chem 232-Org II Multiple Selection section (3 pts/ each) 1. Select the product formed from adding...
F2019-Chem 232-Org II Multiple Selection section (3 pts/ each) 1. Select the product formed from adding Lithium aluminum hydride to 6-hydroxy-3-p- cyanophenylheptan-2-one. (3 pts) ОН Oh oh 32 I A. B. C. D. IV E. None 2. Select the correct ranking of base strength for the amines shown (from weakest to strongest), NH2 NH2 1 III IV A. Klll<ll<IV B. IKIIVI C. kli<ll<IV D. IV<ll<llll All are strong because the halogens are electronegative dently the product formed when 3-phenyl-3-oxopropanal is...
3. identify the product formed when 3 phenyl 3 oxopropanol is reacted with ethylene diamine. 4. select the expected pro...
3. identify the product formed when 3 phenyl 3 oxopropanol is
reacted with ethylene diamine.
4. select the expected product from the reaction shown
5.select methods to prepare n-butylqmine without
complications.
are strong because of the lone pale on pitrogen is delocalized into the ring 3. Identify the product formed when 3-phenyl-3-oxopropanal is react ut formed when 3-phenyl-3-oxopronnal is reacted with the ethylene diamine. NH NH H,00 NH2 C. W E. None 4. Select the expected product from the reaction...
5) Why is the Aldol reaction often called an Aldol condensation? A) The initially formed b-hydroxy...
5) Why is the Aldol reaction often called an Aldol condensation? A) The initially formed b-hydroxy carbonyl compound loses water B) The initially formed b-hydroxy carbonvl compound loses an oxygen atom. C) The initially formed b-hydroxy carbonyl compound loses a hydrogen atom D) The initially formed b-hydroxy carbonyl compound loses a hydroxyl group. 6) When is a crossed Aldol reaction said to be synthetically useful? A) When both carbonyl compounds have a hydrogens B) When one carbonyl compound has no...
are strong because of the lone pale on pitrogen is delocalized into the ring 3. Identify...
are strong because of the lone pale on pitrogen is delocalized
into the ring 3. Identify the product formed when
3-phenyl-3-oxopropanal is react ut formed when
3-phenyl-3-oxopronnal is reacted with the ethylene diamine. NH NH
H,00 NH2 C. W E. None 4. Select the expected product from the
reaction shown. be as gros A. No Reaction B. IV C. III D. I E. II
5. Select methods to prepare n-butylamine without complications?
INH -INH,Br] 1. KOH 2. butylbromide 3. Hydrazine...
61. What product is finally formed when the initial compound formed from cyclohexanone and pyrrolidine is...
61. What product is finally formed when the initial compound formed from cyclohexanone and pyrrolidine is mixed with allyl chloride and that product is heated and then hydrolyzed? HO ora III A) I B) II C) III D) IV E) V 59. Which reagent would best serve as the basis for a simple chemical test to distinguish between CH3 ? CH3 and M A) NaOI (12 in NaOH) B) Bry/CCL C) CrO3/H2SO4 D) NaHCO3/H20 E) Ag(NH3)2+ 60. What would be...
8. What is the major product formed from the reaction shown? 1. CH3I 2. Ag2O, H2O...
8. What is the major product formed from the reaction shown? 1. CH3I 2. Ag2O, H2O Ci I II Ш IV А. III В. I С. II D. IV E. II and III F. I and IV
5. Select methods to prepare n-butylamine without complications? I. NH, - [NH,Br] 1. KOH 2. butylbromide...
5. Select methods to prepare n-butylamine without complications? I. NH, - [NH,Br] 1. KOH 2. butylbromide 3.Hydrazine 1. NaN3 2. LAH 3.H20 BH(CN) 1.03 2. DMS A. I, III and IV B. II, III and IV C. I and IV D. II, IV and V E. III, IV and V 6. Select the two products expected from the reaction shown. HO A. I and VI B. III and V C. II and I D. IV and V E. Illand VI...
9. which of the following intermediates shown is present in the sigma complex formed from the...
9. which of the following intermediates shown is present in the
sigma complex formed from the nitration of anisole?
10.What product is formed from the reaction below?
Which of the intermediates shown is present in the sigma complex formed from the nitratie 9 ОСHа ОСН ОСHа ОСHа NO2 NO2 NO2 NO2 I п Ш IV А. П В. IV С. I D. III E. None 10. What product is formed from the reaction shown below? CI 1. NAOCH3 ? 2.H2O...
Page 2 of 24 Page 3 of 24 )What is the final product 3) Select the...
Page 2 of 24 Page 3 of 24 )What is the final product 3) Select the correct reagents(s) for the following reaction: the following synt hesis? OH H2/NizB (P-2) (1) Os04 сHзсиссн C4He Final Product Он (2) NaHBO3 A) LIAlIHether: then HO B) NaBH/methanol; then HO C) H2 with Pd/C E ABand C A) I B) II 4) Which structure represents (S)-Ichloro-1-fluoroethane? D) IV E) An equimolar mixture of III and IV CHa Cl CH, H- 2) What is the...
7. What product is formed when acetophenone is reacted with nitric acid and sur OCH OCH3...
7. What product is formed when acetophenone is reacted with nitric acid and sur OCH OCH3 SO3H NO, NO2 ги шу A. II B. IV C. I D. III E. None 8. What product is formed when isopropylbenzene is reacted with 2-chloro-3-methylbutane and aluminum trichloride? I II IV V B. III C. I D. V E. II F. None
F2019-Chem 232-Org II Multiple Selection section (3 pts/ each) 1. Select the product formed from adding Lithium aluminum hydride to 6-hydroxy-3-p- cyanophenylheptan-2-one. (3 pts) ОН Oh oh 32 I A. B. C. D. IV E. None 2. Select the correct ranking of base strength for the amines shown (from weakest to strongest), NH2 NH2 1 III IV A. Klll<ll<IV B. IKIIVI C. kli<ll<IV D. IV<ll<llll All are strong because the halogens are electronegative dently the product formed when 3-phenyl-3-oxopropanal is...
3. identify the product formed when 3 phenyl 3 oxopropanol is
reacted with ethylene diamine.
4. select the expected product from the reaction shown
5.select methods to prepare n-butylqmine without
complications.
are strong because of the lone pale on pitrogen is delocalized into the ring 3. Identify the product formed when 3-phenyl-3-oxopropanal is react ut formed when 3-phenyl-3-oxopronnal is reacted with the ethylene diamine. NH NH H,00 NH2 C. W E. None 4. Select the expected product from the reaction...
5) Why is the Aldol reaction often called an Aldol condensation? A) The initially formed b-hydroxy carbonyl compound loses water B) The initially formed b-hydroxy carbonvl compound loses an oxygen atom. C) The initially formed b-hydroxy carbonyl compound loses a hydrogen atom D) The initially formed b-hydroxy carbonyl compound loses a hydroxyl group. 6) When is a crossed Aldol reaction said to be synthetically useful? A) When both carbonyl compounds have a hydrogens B) When one carbonyl compound has no...
are strong because of the lone pale on pitrogen is delocalized
into the ring 3. Identify the product formed when
3-phenyl-3-oxopropanal is react ut formed when
3-phenyl-3-oxopronnal is reacted with the ethylene diamine. NH NH
H,00 NH2 C. W E. None 4. Select the expected product from the
reaction shown. be as gros A. No Reaction B. IV C. III D. I E. II
5. Select methods to prepare n-butylamine without complications?
INH -INH,Br] 1. KOH 2. butylbromide 3. Hydrazine...
61. What product is finally formed when the initial compound formed from cyclohexanone and pyrrolidine is mixed with allyl chloride and that product is heated and then hydrolyzed? HO ora III A) I B) II C) III D) IV E) V 59. Which reagent would best serve as the basis for a simple chemical test to distinguish between CH3 ? CH3 and M A) NaOI (12 in NaOH) B) Bry/CCL C) CrO3/H2SO4 D) NaHCO3/H20 E) Ag(NH3)2+ 60. What would be...
8. What is the major product formed from the reaction shown? 1. CH3I 2. Ag2O, H2O Ci I II Ш IV А. III В. I С. II D. IV E. II and III F. I and IV
5. Select methods to prepare n-butylamine without complications? I. NH, - [NH,Br] 1. KOH 2. butylbromide 3.Hydrazine 1. NaN3 2. LAH 3.H20 BH(CN) 1.03 2. DMS A. I, III and IV B. II, III and IV C. I and IV D. II, IV and V E. III, IV and V 6. Select the two products expected from the reaction shown. HO A. I and VI B. III and V C. II and I D. IV and V E. Illand VI...
9. which of the following intermediates shown is present in the
sigma complex formed from the nitration of anisole?
10.What product is formed from the reaction below?
Which of the intermediates shown is present in the sigma complex formed from the nitratie 9 ОСHа ОСН ОСHа ОСHа NO2 NO2 NO2 NO2 I п Ш IV А. П В. IV С. I D. III E. None 10. What product is formed from the reaction shown below? CI 1. NAOCH3 ? 2.H2O...
Page 2 of 24 Page 3 of 24 )What is the final product 3) Select the correct reagents(s) for the following reaction: the following synt hesis? OH H2/NizB (P-2) (1) Os04 сHзсиссн C4He Final Product Он (2) NaHBO3 A) LIAlIHether: then HO B) NaBH/methanol; then HO C) H2 with Pd/C E ABand C A) I B) II 4) Which structure represents (S)-Ichloro-1-fluoroethane? D) IV E) An equimolar mixture of III and IV CHa Cl CH, H- 2) What is the...
7. What product is formed when acetophenone is reacted with nitric acid and sur OCH OCH3 SO3H NO, NO2 ги шу A. II B. IV C. I D. III E. None 8. What product is formed when isopropylbenzene is reacted with 2-chloro-3-methylbutane and aluminum trichloride? I II IV V B. III C. I D. V E. II F. None
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 5 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago