Homework Answers
Add Answer to:
pls answer all
Keeping in mind that carbocations have a trigonal planar structure, wwrite a structure...
6. Which Sw2 reaction of each pair would you expect to take place more rapidly? Show...
6. Which Sw2 reaction of each pair would you expect to take place more rapidly? Show products and explain your answer. 1-bromobutane + methanol or 1-bromobutane + sodium methoxide
7. S-2-chloropentane is treated with sodium propooxide Cl Na A. How is sodium propoxide created from...
7. S-2-chloropentane is treated with sodium propooxide Cl Na A. How is sodium propoxide created from propanol? B. This may result in substitution or elimination reactions. Are these unimolecular (Sy1/E1) or bimolecular (SN2/ E2) conditions? C. In the mechanism for the substitution reaction, the propoxide ion is acting as a nucleophile. What role does it play in the elimination mechanism? D. Draw the substitution product and the 3 elimination products. Identify the major and minor elimination products E. Would you...
Which alkyl halide would you expect to react more rapidly by an Sw2 mechanism? Show products and explain your answe...
Which alkyl halide would you expect to react more rapidly by an Sw2 mechanism? Show products and explain your answer. 1-bromooctane or 3-bromooctane
3. If sodium methoxide in methanol was used in place of potassium t butanol, your GC...
3. If sodium methoxide in methanol was used in place of potassium t butanol, your GC analysis would look much more like the 2-butanol/sulfuric acid reaction products. In addition, a new, non-alkene product would be present in the GC analysis from a competing, non-elimination mechanism. Explain why the alkene distribution would change, what the new product would be, and why this new product would form. 4. If 2-bromobutane was reacted with trimethylamine to produce sec-butyl trimethyl- ammonium bromide (see below),...
13 SN1: Synthesis of tert-Butyl Chloride Alkyl halides can be prepared from their corresponding alcohols via...
13 SN1: Synthesis of tert-Butyl Chloride Alkyl halides can be prepared from their corresponding alcohols via an acid catalyzed substitution reaction. The mechanism of these acid catalyzed substitution reactions are labeled as SNI (substitution, nucleophilic, unimolecular) and S 2 (substitution, nucleophilic, bimolecular). Tertiary alcohols follow the Syl route, primary alcohols follow the Sy2 route, and secondary alcohols can follow either path. Under acidic conditions, the mechanism (Figure 1) of the Syl reaction involves rapid protonation of the alcohol, followed by...
13 SN1: Synthesis of tert-Butyl Chloride Alkyl halides can be prepared from their corresponding alcohols via...
13 SN1: Synthesis of tert-Butyl Chloride Alkyl halides can be prepared from their corresponding alcohols via an acid catalyzed substitution reaction. The mechanism of these acid catalyzed substitution reactions are labeled as Syl (substitution, nucleophilic, unimolecular) and S2 (substitution, nucleophilic, bimolecular). Tertiary alcohols follow the Snl route, primary alcohols follow the S2 route, and secondary alcohols can follow either path. Under acidic conditions, the mechanism (Figure 1) of the Sul reaction involves rapid protonation of the alcohol, followed by the...
1. Using the reaction of 2-chloro-1-methylcyclohexane with hydroxide ion, give the mechanism of Sn1 substitution. &...
1. Using the reaction of 2-chloro-1-methylcyclohexane with hydroxide ion, give the mechanism of Sn1 substitution. Complete the question as in question 1 2. Show how you might synthesise the following compounds given the indicated starting materials and anything else you need. In other words, show the reactions that would lead from starting materials to products. Assume that you can purify the products of each reaction. A synthesis may require more than one reaction (products of one reaction are used as starting materials in the...
1.1 In which of the following solvents would the reaction of 1-bromobutane with sodium azide,NaN3, proceed...
1.1 In which of the following solvents would the reaction of
1-bromobutane with sodium azide,NaN3, proceed the fastest?
a.aceticacid
b.ethanol
c.water
d.acetonitrile
1.2 Which of the following solvents is the best choice for the
reaction of 1-chlorohexane with sodium bromide?
a.dimethylsulfoxide
b.water
c.hexane
d.toluene,PhCH3
1.3 Which of the following is most likely to undergo
rearrangement during reaction with methanol?
1.4 Name which energy diagrams represents the course of an
exothermic SN1, SN2,E1, or E2 reaction?
1.5 Which of the following...
CH3 (4) 1. Which of the following alkyl halides would you expect to be most reactive...
CH3 (4) 1. Which of the following alkyl halides would you expect to be most reactive in a unimolecular reaction? a) C&H, CH, CH, CH, BY b) CH 1 CH CH Br C) CH11CCH, Br d) C6H CH2 CH CHỊ CHỊ CH3 CHỊ e) C&H, CCH Br CHE (4) 2. What would you expect to be the chief organic product(s) when tert-butyl bromide reacts with sodium acetylide, i.e., CH3 + - CH2-C-Br + Na :CECH — ? CH a) I...
1. Write the OVERALL reaction for this lab. 2. Show the mechanism's steps for this reaction....
1. Write the OVERALL reaction for this lab. 2. Show the mechanism's steps for this reaction. Be sure to include the arrows showing where the electrons are being transferred. 3. What is(are) the intermediates in this mechanism? 4. Which step is the rate determining step? 13 SN1: Synthesis of tert-Butyl Chloride Alkyl halides can be prepared from their corresponding alcohols via an acid catalyzed substitution reaction. The mechanism of these acid catalyzed substitution reactions are labeled as Syl (substitution, nucleophilic,...
6. Which Sw2 reaction of each pair would you expect to take place more rapidly? Show products and explain your answer. 1-bromobutane + methanol or 1-bromobutane + sodium methoxide
7. S-2-chloropentane is treated with sodium propooxide Cl Na A. How is sodium propoxide created from propanol? B. This may result in substitution or elimination reactions. Are these unimolecular (Sy1/E1) or bimolecular (SN2/ E2) conditions? C. In the mechanism for the substitution reaction, the propoxide ion is acting as a nucleophile. What role does it play in the elimination mechanism? D. Draw the substitution product and the 3 elimination products. Identify the major and minor elimination products E. Would you...
Which alkyl halide would you expect to react more rapidly by an Sw2 mechanism? Show products and explain your answer. 1-bromooctane or 3-bromooctane
3. If sodium methoxide in methanol was used in place of potassium t butanol, your GC analysis would look much more like the 2-butanol/sulfuric acid reaction products. In addition, a new, non-alkene product would be present in the GC analysis from a competing, non-elimination mechanism. Explain why the alkene distribution would change, what the new product would be, and why this new product would form. 4. If 2-bromobutane was reacted with trimethylamine to produce sec-butyl trimethyl- ammonium bromide (see below),...
13 SN1: Synthesis of tert-Butyl Chloride Alkyl halides can be prepared from their corresponding alcohols via an acid catalyzed substitution reaction. The mechanism of these acid catalyzed substitution reactions are labeled as SNI (substitution, nucleophilic, unimolecular) and S 2 (substitution, nucleophilic, bimolecular). Tertiary alcohols follow the Syl route, primary alcohols follow the Sy2 route, and secondary alcohols can follow either path. Under acidic conditions, the mechanism (Figure 1) of the Syl reaction involves rapid protonation of the alcohol, followed by...
13 SN1: Synthesis of tert-Butyl Chloride Alkyl halides can be prepared from their corresponding alcohols via an acid catalyzed substitution reaction. The mechanism of these acid catalyzed substitution reactions are labeled as Syl (substitution, nucleophilic, unimolecular) and S2 (substitution, nucleophilic, bimolecular). Tertiary alcohols follow the Snl route, primary alcohols follow the S2 route, and secondary alcohols can follow either path. Under acidic conditions, the mechanism (Figure 1) of the Sul reaction involves rapid protonation of the alcohol, followed by the...
1.1 In which of the following solvents would the reaction of
1-bromobutane with sodium azide,NaN3, proceed the fastest?
a.aceticacid
b.ethanol
c.water
d.acetonitrile
1.2 Which of the following solvents is the best choice for the
reaction of 1-chlorohexane with sodium bromide?
a.dimethylsulfoxide
b.water
c.hexane
d.toluene,PhCH3
1.3 Which of the following is most likely to undergo
rearrangement during reaction with methanol?
1.4 Name which energy diagrams represents the course of an
exothermic SN1, SN2,E1, or E2 reaction?
1.5 Which of the following...
CH3 (4) 1. Which of the following alkyl halides would you expect to be most reactive in a unimolecular reaction? a) C&H, CH, CH, CH, BY b) CH 1 CH CH Br C) CH11CCH, Br d) C6H CH2 CH CHỊ CHỊ CH3 CHỊ e) C&H, CCH Br CHE (4) 2. What would you expect to be the chief organic product(s) when tert-butyl bromide reacts with sodium acetylide, i.e., CH3 + - CH2-C-Br + Na :CECH — ? CH a) I...
1. Write the OVERALL reaction for this lab. 2. Show the mechanism's steps for this reaction. Be sure to include the arrows showing where the electrons are being transferred. 3. What is(are) the intermediates in this mechanism? 4. Which step is the rate determining step? 13 SN1: Synthesis of tert-Butyl Chloride Alkyl halides can be prepared from their corresponding alcohols via an acid catalyzed substitution reaction. The mechanism of these acid catalyzed substitution reactions are labeled as Syl (substitution, nucleophilic,...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 55 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago