1) Why, in this case, does theβ,β’-dihyroxyketone intermediate (I)lose two water molecules? 2) Dibenzalacetone has a...
1) Why, in this case, does theβ,β’-dihyroxyketone intermediate (I)lose two water molecules?
2) Dibenzalacetone has a light yellowcolor. Why is it colored?
Homework Answers
the water molecules the product is in conjugation hence it ismore stable.
The compound Dibenzalacetone is light yellow color asthe the compound has a conjugation and it has a chromophere as
carbonyl group in the product with two Aromaticrings.
Add Answer to:
1) Why, in this case, does
theβ,β’-dihyroxyketone intermediate (I)lose two water
molecules?
2) Dibenzalacetone has a...
Why does ice float on liquid water? The linear structure of the water molecule allows ice molecules to pack together...
Why does ice float on liquid water? The linear structure of the water molecule allows ice molecules to pack together tightly enough to allowice to float Oxygen's low electronegativity leads to the collapse of the crystal structure allowing the molecules to become closer together in water It is a compound without carbon atoms that exists in the liquid state at room temperature and pressure Water molecules in the solid forme d in a crystal matter that has voids between the...
Why does octanol has higher bouling point than water? I belive that water can form 4...
Why does octanol has higher bouling point than water? I belive that water can form 4 H bonds and more polar than octanol. So I expected to see higher boiling point for water. But actually, octanol has higher boiling point than water. Does it imply that octanol has stringer intermolecular force? If so, could anyone explain why?
1.. How is hydrogen bonding involved in cohesive attraction of water molecules? 2.. Water molecules also...
1.. How is hydrogen bonding involved in cohesive attraction of water molecules? 2.. Water molecules also attract other sorts of molecules, particularly ions. Why is this?
1. Explain why one molecule of NaBH4 will reduce only two molecules of benzil. 2. In...
1. Explain why one molecule of NaBH4 will reduce only two molecules of benzil. 2. In the case of reducing benzil, how many stereo centers will be produced?
Post-lab questions (1) In a Michael reaction, an α carbon attacks the β carbon of an α,β-unsatura...
Post-lab questions (1) In a Michael reaction, an α carbon attacks the β carbon of an α,β-unsaturated carbonyl com pound to afford a 1,5-dicarbonyl compound. Ethyl acetoacetate has two a carbons: why does the a carbon sandwiched between the two carbonyls conduct the attack? Ph Ph 0 Ph Michael OCH2CH3 5 OCH2CH3 OCH2CH 0 This forms... ...not this: Why? (2) In a Robinson annulation, an α,β-unsaturated carbonyl compound reacts with a carbonyl compound to afford a (new) cyclic α,β-unsaturated ketone...
1 CO& molecules. Justify your answer. rst ionization energies for Na and K are given in...
1 CO& molecules. Justify your answer. rst ionization energies for Na and K are given in the table below. Na metal reacts vigorously with water to form hydrogen gas and a metal hydroxide. K metal reacts vigorously as well, but it bursts into a violet-colored flame Element First Ionization Energy (J/mol) Na 4.95 x 105 4.19 x 10s Based on principles of atomic structure, explain why the first ionization energy of K is lower than the first A student hypothesizes...
Consider the following two molecules: O Nat 2 a. Name each species (i) and (ii). b....
Consider the following two molecules: O Nat 2 a. Name each species (i) and (ii). b. Which of the two species, (i) or (ii), will be more soluble in water? c. Explain your reasoning for (b). (Use clear logic and sentences to explain why one of the compounds (i) or (ii) is more soluble than the other.) HTML Editora BIVA - A - IX EE 3 1. x'x, IEE - Do @ VO T : 12pt - Paragraph - O...
1. Explain why this reactiob is not carried out in water as a solvent. 2. Does...
1. Explain why this reactiob is not carried out in
water as a solvent.
2. Does the attached IR spectrum of the product show
any evidence of the decomposed by product? Why or why not?
279 40000 3000 1500 VOO We were unable to transcribe this image1:27 D 70%. © Alder worksheet.pdf + : Spa 1000 1900 3000 Deco - Fotolo o 1. Explain why this reactiob is not carried out in water as a solvent. 2. Does the attached...
1) What effect does water have on the melting temperature of a material? 2) why would...
1) What effect does water have on the melting temperature of a material? 2) why would the effect of water on the melting temperature of a rock be important at subduction zones 2) Why would the effect of water on the melting temperature of a rock be important at subduction zones? 3) Where in the world can you find an island arc system?
Analysis 1. Calculate the molar masses of the reactants, sodium phosphate dodecahydrate (12 water molecules are...
Analysis 1. Calculate the molar masses of the reactants, sodium phosphate dodecahydrate (12 water molecules are included), and barium chloride dihydrate. (2 water molecules are included) 2. Write the balanced equation for the reaction of the two salts (do not include the waters of hydration). 3. Calculate the molar masses for the two products. 4. Based upon your data in part B, identify the limiting reagent. Justify your answer. CHEM 1314 - General Chemistry I Lab Lab 6 - Limiting...
Why does ice float on liquid water? The linear structure of the water molecule allows ice molecules to pack together tightly enough to allowice to float Oxygen's low electronegativity leads to the collapse of the crystal structure allowing the molecules to become closer together in water It is a compound without carbon atoms that exists in the liquid state at room temperature and pressure Water molecules in the solid forme d in a crystal matter that has voids between the...
Post-lab questions (1) In a Michael reaction, an α carbon attacks the β carbon of an α,β-unsaturated carbonyl com pound to afford a 1,5-dicarbonyl compound. Ethyl acetoacetate has two a carbons: why does the a carbon sandwiched between the two carbonyls conduct the attack? Ph Ph 0 Ph Michael OCH2CH3 5 OCH2CH3 OCH2CH 0 This forms... ...not this: Why? (2) In a Robinson annulation, an α,β-unsaturated carbonyl compound reacts with a carbonyl compound to afford a (new) cyclic α,β-unsaturated ketone...
1 CO& molecules. Justify your answer. rst ionization energies for Na and K are given in the table below. Na metal reacts vigorously with water to form hydrogen gas and a metal hydroxide. K metal reacts vigorously as well, but it bursts into a violet-colored flame Element First Ionization Energy (J/mol) Na 4.95 x 105 4.19 x 10s Based on principles of atomic structure, explain why the first ionization energy of K is lower than the first A student hypothesizes...
Consider the following two molecules: O Nat 2 a. Name each species (i) and (ii). b. Which of the two species, (i) or (ii), will be more soluble in water? c. Explain your reasoning for (b). (Use clear logic and sentences to explain why one of the compounds (i) or (ii) is more soluble than the other.) HTML Editora BIVA - A - IX EE 3 1. x'x, IEE - Do @ VO T : 12pt - Paragraph - O...
1. Explain why this reactiob is not carried out in
water as a solvent.
2. Does the attached IR spectrum of the product show
any evidence of the decomposed by product? Why or why not?
279 40000 3000 1500 VOO We were unable to transcribe this image1:27 D 70%. © Alder worksheet.pdf + : Spa 1000 1900 3000 Deco - Fotolo o 1. Explain why this reactiob is not carried out in water as a solvent. 2. Does the attached...
Analysis 1. Calculate the molar masses of the reactants, sodium phosphate dodecahydrate (12 water molecules are included), and barium chloride dihydrate. (2 water molecules are included) 2. Write the balanced equation for the reaction of the two salts (do not include the waters of hydration). 3. Calculate the molar masses for the two products. 4. Based upon your data in part B, identify the limiting reagent. Justify your answer. CHEM 1314 - General Chemistry I Lab Lab 6 - Limiting...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 37 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago