Homework Answers
Acetone is a good solvent for the acetone/sodium iodide reagent because
- Acetone increases the rate of SN² reactions
- Sodium chloride and sodium bromide are insoluble in acetone
- Sodium iodide is soluble in acetone.
All the above three statements are true.
Acetone is polar Aprotic solvent which favors SN² reactions.
NaCl and NaBr are insoluble in acetone while NaI is soluble in acetone.
All alkyl halides are soluble in acetone.
Add Answer to:
Acetone is a good solvent for the acetone/sodium iodide reagent because? (check all that apply) acetone...
Choose all that apply I. NH2- ia a good leaving group because it reacts readily with...
Choose all that apply I. NH2- ia a good leaving group because it reacts readily with water. II. Stable anions are the best leaving groups, but are only important in SN2 reactions III. Stable anions are the best leaving groups and are important in both SN1 and SN2 reactions as the leaving group develops a partial negative charge in the transition state of both mechanisms. IV. Iodide anion is the best leaving group followed by bromide anion and chloride anion...
Which of the following aqueous solutions are good buffer systems? (check all that apply) . 0.22...
Which of the following aqueous solutions are good buffer systems? (check all that apply) . 0.22 M hydrochloric acid + 0.20 M sodium chloride 0.21 M acetic acid + 0.18 M sodium acetate 0.13 M sodium hydroxide + 0.26 M sodium chloride 0.38 M calcium iodide + 0.26 M potassium iodide 0.28 M ammonia + 0.39 M potassium hydroxide Which of the following aqueous solutions are good buffer systems? (check all that apply) . 0.19 M acetic acid + 0.15...
In lab you will be performing experiments using Sodium (or Potassium) Iodide in Acetone to determine...
In lab you will be performing experiments using Sodium (or Potassium) Iodide in Acetone to determine reactivity in SN1 reactions and Silver Nitrate in Ethanol to investigate SN2 reactions. How will you know if an alkyl halide is moderately reactive in either test?
3. An alkyl halide is reacted with sodium iodide and sodium chloride in separate test tubes....
3. An alkyl halide is reacted with sodium iodide and sodium chloride in separate test tubes. The rate was the same in both experiments. Is this an Syl or an SN2 reaction? How would you know? 4. Why is sodium iodide used as a solution in acetone in these experiments instead of a solution in water? 5. Will the reaction below be Spl or Sn2? Show the mechanism.
Mechanism for each reaction SN2 reaction conditions: To create reaction conditions suitable for an SN2 reaction,...
Mechanism for each reaction
SN2 reaction conditions: To create reaction conditions suitable for an SN2 reaction, sodium iodide will be employed. Iodide is a great nucleophile, given its highly polarizable nature. Since SN2 reactions work best in an aprotic solvent, acetone will be utilized for these reactions. As a side product, the sodium cation will form an ionic compound with the leaving halides. Since sodium chloride and sodium bromide is not soluble in acetone, thus the successful substitution reaction of...
Mechanism for each reaction SN2 reaction conditions: To create reaction conditions suitable for an SN2 reaction,...
Mechanism for each reaction
SN2 reaction conditions: To create reaction conditions suitable for an SN2 reaction, sodium iodide will be employed. lodide is a great nucleophile, given its highly polarizable nature. Since SN2 reactions work best in an aprotic solvent, acetone will be utilized for these reactions. As a side product, the sodium cation will form an ionic compound with the leaving halides. Since sodium chloride and sodium bromide is not soluble in acetone, thus the successful substitution reaction of...
Please answer all 6 multiquestions and show work! Useful Information DMSO H₃C гсн 요 Acetone PK,...
Please answer all 6 multiquestions and show work!
Useful Information DMSO H₃C гсн 요 Acetone PK, NH3 = 38 Part 1: Multiple Choice: 1) Which atomic orbitals overlap to form the carbon-carbon triple bond of an alkyne? a) 2s + 2s; sp + sp; 2p + 2p b) sp + sp; sp + sp; 2p + 2p c) sp + sp; 2p + 2p; 2p + 2p d) sp + sp?; sp + sp; 2p + 2p 2. In a...
Pick an appropriate solvent to dissolve magnesium bromide (ionic). Check all that apply
Part A Pick an appropriate solvent to dissolve magnesium bromide (ionic). Check all that apply. Water (H2O) Acetone (CH3COCH3) Methanol (CH3OH) Ethanol (CH3CH2OH) Hexane (C6H14) Diethyl ether (CH3CH2OCH2CH3) Toluene (C7H8) Carbon tetrachloride (CCl4) Part B State the kind of intermolecular forces that would occur between the solute and solvent in magnesium bromide (ionic) solution. Check all that apply. dispersion hydrogen bonding ion-dipole dipole-dipole Chart Common polar solvents Common nonpolar solvents Water (H2O) Hexane (C6H14) Acetone (CH3COCH3) Diethyl ether (CH3CH2OCH2CH3) Methanol...
1. In both the sodium iodide test and the silver nitrate test, why does 2-bromobutane react faster...
1. In both the sodium iodide
test and the silver nitrate test, why does 2-bromobutane react
faster than 2-chlorobutane?
Bromine is a better leaving group since it is a weaker base than
chlorine is.
2. a. Why does benzyl chloride react under both
SN1 and SN2 conditions?
Benzyl
chloride is a primary alkyl halide, hence reactive under SN2
conditions.
The
primary carbocation formed due to the departure of Cl- is
stabilized by the pi electrons in the benzene ring.
b. Why is...
What makes a good extraction solvent? [check all that apply.] Group of answer choices Be (almost)...
What makes a good extraction solvent? [check all that apply.] Group of answer choices Be (almost) immiscible with other the solvent used Exhibit high solubility for solute Exhibit low solubility for unwanted compounds/impurities Easily separates from compound after separation Does not react with the compounds Be highly flammable
3. An alkyl halide is reacted with sodium iodide and sodium chloride in separate test tubes. The rate was the same in both experiments. Is this an Syl or an SN2 reaction? How would you know? 4. Why is sodium iodide used as a solution in acetone in these experiments instead of a solution in water? 5. Will the reaction below be Spl or Sn2? Show the mechanism.
Mechanism for each reaction
SN2 reaction conditions: To create reaction conditions suitable for an SN2 reaction, sodium iodide will be employed. Iodide is a great nucleophile, given its highly polarizable nature. Since SN2 reactions work best in an aprotic solvent, acetone will be utilized for these reactions. As a side product, the sodium cation will form an ionic compound with the leaving halides. Since sodium chloride and sodium bromide is not soluble in acetone, thus the successful substitution reaction of...
Mechanism for each reaction
SN2 reaction conditions: To create reaction conditions suitable for an SN2 reaction, sodium iodide will be employed. lodide is a great nucleophile, given its highly polarizable nature. Since SN2 reactions work best in an aprotic solvent, acetone will be utilized for these reactions. As a side product, the sodium cation will form an ionic compound with the leaving halides. Since sodium chloride and sodium bromide is not soluble in acetone, thus the successful substitution reaction of...
Please answer all 6 multiquestions and show work!
Useful Information DMSO H₃C гсн 요 Acetone PK, NH3 = 38 Part 1: Multiple Choice: 1) Which atomic orbitals overlap to form the carbon-carbon triple bond of an alkyne? a) 2s + 2s; sp + sp; 2p + 2p b) sp + sp; sp + sp; 2p + 2p c) sp + sp; 2p + 2p; 2p + 2p d) sp + sp?; sp + sp; 2p + 2p 2. In a...
1. In both the sodium iodide
test and the silver nitrate test, why does 2-bromobutane react
faster than 2-chlorobutane?
Bromine is a better leaving group since it is a weaker base than
chlorine is.
2. a. Why does benzyl chloride react under both
SN1 and SN2 conditions?
Benzyl
chloride is a primary alkyl halide, hence reactive under SN2
conditions.
The
primary carbocation formed due to the departure of Cl- is
stabilized by the pi electrons in the benzene ring.
b. Why is...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 36 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago