Calculate the mass of 0.00456 moles of (NH4)2SO4
what is the molar concentration of NH4+ ions in a 3.1 M solution of (NH4)2SO4?
what is the molar concentration of NH4+ lions in a 3.1 M solution of (NH4)2SO4
Calculate the molality of a 20.0% by mass ammonium sulfate (NH4)2SO4 solution. The density of the solution is 1.117 g/mL.
The boiling point of an aqueous 1.83 m (NH4)2SO4 (molar mass = 132.15 g/mol) solution is 102.5°C. Determine the value of the van't Hoff factor for this solute if the Kb for water is 0.512°C/m. Answer's 2.7 but I have no idea how to solve for this, can someone show me how to solve with LOTS of steps? Thanks.
rank the following fertilizers in decreasing order of mass percentage of nitrogen KNO3 (NH4)H2PO4 (NH4)2SO4 NH4NO3 NH3 (NHO4)2HPO4
what mass of (nh4)2so4 must be mixed with 55.0kg of Kno3 to produce a fertilizer that has 15.4 mass% nitrogen
What mass of (NH4)2SO4 must be mixed with 70.0 kg of KNO3 to produce a fertilizer that has 18.1 mass % nitrogen?
Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:
10. Consider the reaction KOH +(NH4)2SO4 ? K2SO4 + NH4OH If 20.0 grams of KOH reacts with 15.0 grams of (NH4)2S04 to produce 15.6 grams of K2SO4, calculate the percent yield for the reaction.